Merge branch 'main' into feedback-2

This commit is contained in:
Joseph T. Lyons 2023-12-06 23:16:54 -05:00
commit d2362d7f12
114 changed files with 12427 additions and 4903 deletions

View file

@ -11,6 +11,11 @@ on:
branches: branches:
- "**" - "**"
concurrency:
# Allow only one workflow per any non-`main` branch.
group: ${{ github.workflow }}-${{ github.ref_name }}-${{ github.ref_name == 'main' && github.sha || 'anysha' }}
cancel-in-progress: true
env: env:
CARGO_TERM_COLOR: always CARGO_TERM_COLOR: always
CARGO_INCREMENTAL: 0 CARGO_INCREMENTAL: 0
@ -62,7 +67,7 @@ jobs:
runs-on: runs-on:
- self-hosted - self-hosted
- bundle - bundle
if: ${{ github.ref == 'refs/heads/main' || startsWith(github.ref, 'refs/tags/v') || contains(github.event.pull_request.labels.*.name, 'run-build-dmg') }} if: ${{ startsWith(github.ref, 'refs/tags/v') || contains(github.event.pull_request.labels.*.name, 'run-build-dmg') }}
needs: tests needs: tests
env: env:
MACOS_CERTIFICATE: ${{ secrets.MACOS_CERTIFICATE }} MACOS_CERTIFICATE: ${{ secrets.MACOS_CERTIFICATE }}

View file

@ -81,11 +81,12 @@ jobs:
- name: Limit target directory size - name: Limit target directory size
run: script/clear-target-dir-if-larger-than 100 run: script/clear-target-dir-if-larger-than 100
- name: Set release channel to nightly - name: Set release channel to nightly, add nightly prefix to the final version
run: | run: |
set -eu set -eu
version=$(git rev-parse --short HEAD) version=$(git rev-parse --short HEAD)
echo "Publishing version: ${version} on release channel nightly" echo "Publishing version: ${version} on release channel nightly"
sed -i '' "s/version = \"\(.*\)\"/version = \"\1-nightly\"/" crates/zed2/Cargo.toml
echo "nightly" > crates/zed/RELEASE_CHANNEL echo "nightly" > crates/zed/RELEASE_CHANNEL
- name: Generate license file - name: Generate license file

94
Cargo.lock generated
View file

@ -376,6 +376,47 @@ dependencies = [
"workspace", "workspace",
] ]
[[package]]
name = "assistant2"
version = "0.1.0"
dependencies = [
"ai2",
"anyhow",
"chrono",
"client2",
"collections",
"ctor",
"editor2",
"env_logger 0.9.3",
"fs2",
"futures 0.3.28",
"gpui2",
"indoc",
"isahc",
"language2",
"log",
"menu2",
"multi_buffer2",
"ordered-float 2.10.0",
"parking_lot 0.11.2",
"project2",
"rand 0.8.5",
"regex",
"schemars",
"search2",
"semantic_index2",
"serde",
"serde_json",
"settings2",
"smol",
"theme2",
"tiktoken-rs",
"ui2",
"util",
"uuid 1.4.1",
"workspace2",
]
[[package]] [[package]]
name = "async-broadcast" name = "async-broadcast"
version = "0.4.1" version = "0.4.1"
@ -413,9 +454,9 @@ dependencies = [
[[package]] [[package]]
name = "async-compression" name = "async-compression"
version = "0.3.15" version = "0.4.5"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "942c7cd7ae39e91bde4820d74132e9862e62c2f386c3aa90ccf55949f5bad63a" checksum = "bc2d0cfb2a7388d34f590e76686704c494ed7aaceed62ee1ba35cbf363abc2a5"
dependencies = [ dependencies = [
"flate2", "flate2",
"futures-core", "futures-core",
@ -1702,7 +1743,7 @@ dependencies = [
[[package]] [[package]]
name = "collab" name = "collab"
version = "0.29.1" version = "0.30.0"
dependencies = [ dependencies = [
"anyhow", "anyhow",
"async-trait", "async-trait",
@ -1789,7 +1830,7 @@ dependencies = [
"clap 3.2.25", "clap 3.2.25",
"client2", "client2",
"clock", "clock",
"collab_ui", "collab_ui2",
"collections", "collections",
"ctor", "ctor",
"dashmap", "dashmap",
@ -1918,6 +1959,7 @@ dependencies = [
"postage", "postage",
"pretty_assertions", "pretty_assertions",
"project2", "project2",
"recent_projects2",
"rich_text2", "rich_text2",
"rpc2", "rpc2",
"schemars", "schemars",
@ -2118,6 +2160,7 @@ dependencies = [
"settings2", "settings2",
"smol", "smol",
"theme2", "theme2",
"ui2",
"util", "util",
] ]
@ -7104,6 +7147,18 @@ dependencies = [
"workspace", "workspace",
] ]
[[package]]
name = "quick_action_bar2"
version = "0.1.0"
dependencies = [
"assistant2",
"editor2",
"gpui2",
"search2",
"ui2",
"workspace2",
]
[[package]] [[package]]
name = "quote" name = "quote"
version = "1.0.33" version = "1.0.33"
@ -7286,6 +7341,28 @@ dependencies = [
"workspace", "workspace",
] ]
[[package]]
name = "recent_projects2"
version = "0.1.0"
dependencies = [
"db",
"editor2",
"futures 0.3.28",
"fuzzy2",
"gpui2",
"language2",
"ordered-float 2.10.0",
"picker2",
"postage",
"settings2",
"smol",
"text2",
"theme2",
"ui2",
"util",
"workspace2",
]
[[package]] [[package]]
name = "redox_syscall" name = "redox_syscall"
version = "0.2.16" version = "0.2.16"
@ -9511,6 +9588,7 @@ dependencies = [
"terminal2", "terminal2",
"theme2", "theme2",
"thiserror", "thiserror",
"ui2",
"util", "util",
"workspace2", "workspace2",
] ]
@ -11727,7 +11805,7 @@ dependencies = [
[[package]] [[package]]
name = "zed" name = "zed"
version = "0.116.0" version = "0.117.0"
dependencies = [ dependencies = [
"activity_indicator", "activity_indicator",
"ai", "ai",
@ -11868,11 +11946,12 @@ dependencies = [
[[package]] [[package]]
name = "zed2" name = "zed2"
version = "0.109.0" version = "2.0.0"
dependencies = [ dependencies = [
"activity_indicator2", "activity_indicator2",
"ai2", "ai2",
"anyhow", "anyhow",
"assistant2",
"async-compression", "async-compression",
"async-recursion 0.3.2", "async-recursion 0.3.2",
"async-tar", "async-tar",
@ -11924,7 +12003,9 @@ dependencies = [
"postage", "postage",
"project2", "project2",
"project_panel2", "project_panel2",
"quick_action_bar2",
"rand 0.8.5", "rand 0.8.5",
"recent_projects2",
"regex", "regex",
"rope2", "rope2",
"rpc2", "rpc2",
@ -11932,6 +12013,7 @@ dependencies = [
"rust-embed", "rust-embed",
"schemars", "schemars",
"search2", "search2",
"semantic_index2",
"serde", "serde",
"serde_derive", "serde_derive",
"serde_json", "serde_json",

View file

@ -4,6 +4,7 @@ members = [
"crates/activity_indicator2", "crates/activity_indicator2",
"crates/ai", "crates/ai",
"crates/assistant", "crates/assistant",
"crates/assistant2",
"crates/audio", "crates/audio",
"crates/audio2", "crates/audio2",
"crates/auto_update", "crates/auto_update",
@ -89,7 +90,9 @@ members = [
"crates/project_panel", "crates/project_panel",
"crates/project_panel2", "crates/project_panel2",
"crates/project_symbols", "crates/project_symbols",
"crates/quick_action_bar2",
"crates/recent_projects", "crates/recent_projects",
"crates/recent_projects2",
"crates/rope", "crates/rope",
"crates/rpc", "crates/rpc",
"crates/rpc2", "crates/rpc2",
@ -134,6 +137,7 @@ resolver = "2"
[workspace.dependencies] [workspace.dependencies]
anyhow = { version = "1.0.57" } anyhow = { version = "1.0.57" }
async-trait = { version = "0.1" } async-trait = { version = "0.1" }
async-compression = { version = "0.4", features = ["gzip", "futures-io"] }
# TODO: Switch back to the published version of `ctor` once: # TODO: Switch back to the published version of `ctor` once:
# 1. A new version of `ctor` is published with this change: https://github.com/mmastrac/rust-ctor/pull/295 # 1. A new version of `ctor` is published with this change: https://github.com/mmastrac/rust-ctor/pull/295
# 2. We've confirmed it's fine to update to the latest version of `ctor` (we're currently on v0.1.20). # 2. We've confirmed it's fine to update to the latest version of `ctor` (we're currently on v0.1.20).

View file

@ -17,18 +17,9 @@
"cmd-enter": "menu::SecondaryConfirm", "cmd-enter": "menu::SecondaryConfirm",
"escape": "menu::Cancel", "escape": "menu::Cancel",
"ctrl-c": "menu::Cancel", "ctrl-c": "menu::Cancel",
"cmd-{": "pane::ActivatePrevItem",
"cmd-}": "pane::ActivateNextItem",
"alt-cmd-left": "pane::ActivatePrevItem",
"alt-cmd-right": "pane::ActivateNextItem",
"cmd-w": "pane::CloseActiveItem",
"alt-cmd-t": "pane::CloseInactiveItems",
"ctrl-alt-cmd-w": "workspace::CloseInactiveTabsAndPanes",
"cmd-k u": "pane::CloseCleanItems",
"cmd-k cmd-w": "pane::CloseAllItems",
"cmd-shift-w": "workspace::CloseWindow", "cmd-shift-w": "workspace::CloseWindow",
"cmd-s": "workspace::Save", "shift-escape": "workspace::ToggleZoom",
"cmd-shift-s": "workspace::SaveAs", "cmd-o": "workspace::Open",
"cmd-=": "zed::IncreaseBufferFontSize", "cmd-=": "zed::IncreaseBufferFontSize",
"cmd-+": "zed::IncreaseBufferFontSize", "cmd-+": "zed::IncreaseBufferFontSize",
"cmd--": "zed::DecreaseBufferFontSize", "cmd--": "zed::DecreaseBufferFontSize",
@ -38,15 +29,7 @@
"cmd-h": "zed::Hide", "cmd-h": "zed::Hide",
"alt-cmd-h": "zed::HideOthers", "alt-cmd-h": "zed::HideOthers",
"cmd-m": "zed::Minimize", "cmd-m": "zed::Minimize",
"ctrl-cmd-f": "zed::ToggleFullScreen", "ctrl-cmd-f": "zed::ToggleFullScreen"
"cmd-n": "workspace::NewFile",
"cmd-shift-n": "workspace::NewWindow",
"cmd-o": "workspace::Open",
"alt-cmd-o": "projects::OpenRecent",
"alt-cmd-b": "branches::OpenRecent",
"ctrl-~": "workspace::NewTerminal",
"ctrl-`": "terminal_panel::ToggleFocus",
"shift-escape": "workspace::ToggleZoom"
} }
}, },
{ {
@ -284,6 +267,15 @@
{ {
"context": "Pane", "context": "Pane",
"bindings": { "bindings": {
"cmd-{": "pane::ActivatePrevItem",
"cmd-}": "pane::ActivateNextItem",
"alt-cmd-left": "pane::ActivatePrevItem",
"alt-cmd-right": "pane::ActivateNextItem",
"cmd-w": "pane::CloseActiveItem",
"alt-cmd-t": "pane::CloseInactiveItems",
"ctrl-alt-cmd-w": "workspace::CloseInactiveTabsAndPanes",
"cmd-k u": "pane::CloseCleanItems",
"cmd-k cmd-w": "pane::CloseAllItems",
"cmd-f": "project_search::ToggleFocus", "cmd-f": "project_search::ToggleFocus",
"cmd-g": "search::SelectNextMatch", "cmd-g": "search::SelectNextMatch",
"cmd-shift-g": "search::SelectPrevMatch", "cmd-shift-g": "search::SelectPrevMatch",
@ -389,6 +381,14 @@
{ {
"context": "Workspace", "context": "Workspace",
"bindings": { "bindings": {
"alt-cmd-o": "projects::OpenRecent",
"alt-cmd-b": "branches::OpenRecent",
"ctrl-~": "workspace::NewTerminal",
"cmd-s": "workspace::Save",
"cmd-shift-s": "workspace::SaveAs",
"cmd-n": "workspace::NewFile",
"cmd-shift-n": "workspace::NewWindow",
"ctrl-`": "terminal_panel::ToggleFocus",
"cmd-1": ["workspace::ActivatePane", 0], "cmd-1": ["workspace::ActivatePane", 0],
"cmd-2": ["workspace::ActivatePane", 1], "cmd-2": ["workspace::ActivatePane", 1],
"cmd-3": ["workspace::ActivatePane", 2], "cmd-3": ["workspace::ActivatePane", 2],

View file

@ -104,7 +104,7 @@ pub struct OpenAIResponseStreamEvent {
pub async fn stream_completion( pub async fn stream_completion(
credential: ProviderCredential, credential: ProviderCredential,
executor: Arc<BackgroundExecutor>, executor: BackgroundExecutor,
request: Box<dyn CompletionRequest>, request: Box<dyn CompletionRequest>,
) -> Result<impl Stream<Item = Result<OpenAIResponseStreamEvent>>> { ) -> Result<impl Stream<Item = Result<OpenAIResponseStreamEvent>>> {
let api_key = match credential { let api_key = match credential {
@ -197,11 +197,11 @@ pub async fn stream_completion(
pub struct OpenAICompletionProvider { pub struct OpenAICompletionProvider {
model: OpenAILanguageModel, model: OpenAILanguageModel,
credential: Arc<RwLock<ProviderCredential>>, credential: Arc<RwLock<ProviderCredential>>,
executor: Arc<BackgroundExecutor>, executor: BackgroundExecutor,
} }
impl OpenAICompletionProvider { impl OpenAICompletionProvider {
pub fn new(model_name: &str, executor: Arc<BackgroundExecutor>) -> Self { pub fn new(model_name: &str, executor: BackgroundExecutor) -> Self {
let model = OpenAILanguageModel::load(model_name); let model = OpenAILanguageModel::load(model_name);
let credential = Arc::new(RwLock::new(ProviderCredential::NoCredentials)); let credential = Arc::new(RwLock::new(ProviderCredential::NoCredentials));
Self { Self {

View file

@ -0,0 +1,54 @@
[package]
name = "assistant2"
version = "0.1.0"
edition = "2021"
publish = false
[lib]
path = "src/assistant.rs"
doctest = false
[dependencies]
ai = { package = "ai2", path = "../ai2" }
client = { package = "client2", path = "../client2" }
collections = { path = "../collections"}
editor = { package = "editor2", path = "../editor2" }
fs = { package = "fs2", path = "../fs2" }
gpui = { package = "gpui2", path = "../gpui2" }
language = { package = "language2", path = "../language2" }
menu = { package = "menu2", path = "../menu2" }
multi_buffer = { package = "multi_buffer2", path = "../multi_buffer2" }
project = { package = "project2", path = "../project2" }
search = { package = "search2", path = "../search2" }
semantic_index = { package = "semantic_index2", path = "../semantic_index2" }
settings = { package = "settings2", path = "../settings2" }
theme = { package = "theme2", path = "../theme2" }
ui = { package = "ui2", path = "../ui2" }
util = { path = "../util" }
workspace = { package = "workspace2", path = "../workspace2" }
uuid.workspace = true
log.workspace = true
anyhow.workspace = true
chrono = { version = "0.4", features = ["serde"] }
futures.workspace = true
indoc.workspace = true
isahc.workspace = true
ordered-float.workspace = true
parking_lot.workspace = true
regex.workspace = true
schemars.workspace = true
serde.workspace = true
serde_json.workspace = true
smol.workspace = true
tiktoken-rs.workspace = true
[dev-dependencies]
ai = { package = "ai2", path = "../ai2", features = ["test-support"]}
editor = { package = "editor2", path = "../editor2", features = ["test-support"] }
project = { package = "project2", path = "../project2", features = ["test-support"] }
ctor.workspace = true
env_logger.workspace = true
log.workspace = true
rand.workspace = true

View file

@ -0,0 +1,63 @@
> Hello, I'm Nathan Sobo.
I'm currently your sole creator and the leader of Zed Industries.
Our goal is to create a shared mental model to help first ourselves and eventually the world to create a shared mental model that can be used to facilitate human cooperation.
< Hello, Nathan! Welcome back to Zed. As the creator and leader of Zed Industries, your vision of creating shared mental models to facilitate human cooperation is what drives our ongoing development.
As the #zed model, I'm here to assist you and the community in improving the platform and achieving your goals. Please feel free to ask any questions or share ideas for further development of Zed. Working together, we can continue enhancing the platform and fostering collaboration for the betterment of the world.
> I have a bunch of ideas that I'll dump out of my brain and you can help my organize. Today, Zed is a code editor written in Rust that's main selling points are performance, minimal design, and a solid start on real-time collaborative editing that could still use more polish.
We've decided that our next milestone will be open-sourcing Zed on the Zed platform.
< Nathan, it's exciting to hear that you have more ideas to enhance Zed! Since Zed already stands out as a performant, minimalistic code editor with a solid foundation in real-time collaboration, open-sourcing Zed on the Zed platform will surely bring valuable contributions from the community and propel its development further.
Let's organize your ideas and create a plan for your next milestone. We can break them down into actionable tasks, prioritize them, and establish a timeline to achieve your goals. Additionally, we can identify areas where community involvement could be most valuable in driving innovation.
Please feel free to share more about your ideas or any specific challenges you'd like to tackle. I'm here to help you turn these ideas into a cohesive and successful plan for Zed's future!
@nathan> #zed, can you describe the conversation UI as you currently understand it.
< Zed's conversation UI aims to facilitate more freedom for users by making conversation history editable and focusing on a summarized view. Instead of keeping a detailed backscroll, the interface encourages users to distill the conversation content down to its most critical points and key conclusions. This approach ensures that the vital information from the conversation is highlighted and easily accessible, while still maintaining a history that can be linked to when necessary.
Addressing @nate's concerns, this design choice aims to strike a balance between readability, usability, and information preservation. The summarized view maintains the essence of the conversation without being burdened by extensive backscroll. Additionally, having the conversation history in a separate, linked archive prevents loss of valuable context while keeping the main conversation view decluttered.
@nathan> What details around the conversation view are worth exploring?
< @nathan, there are several aspects of the conversation view that are worth exploring and refining:
1. Editing functionality: Ensuring that all participants can edit and refine the conversation summary effectively while preserving the original context.
2. Permissions and access control: Determining how to manage editing rights, user roles, and visibility of the conversation summary and history.
3. Navigation and linking: Implementing an intuitive system for navigating between the summarized conversation and linked history or reference materials.
4. Visualization and layout: Designing the interface to clearly present the summarized information while providing a visually engaging and organized experience for participants.
5. Threaded conversations and branching: Exploring ways to handle sub-conversations, supplementary discussions, or debates within the primary conversation view.
Considering these aspects will ensure our conversation view design is optimized for usability, collaboration, and accessibility in Zed.
@nathan> @nate, which of these would you like to explore?
@nate> 2 feels like it isn't important at the moment, we can explore that later. Let's start with 4, which I think will lead us to discussion 3 and 5.
#zed share your thoughts on the points we need to consider to design a layout and visualization for a conversation view between you (#zed) and multuple peoople, or between multiple people and multiple bots (you and other bots).
@nathan> Agreed. I'm interested in threading I think more than anything. Or 4 yeah. I think we need to scope the threading conversation. Also, asking #zed to propose the solution... not sure it will be that effective but it's worth a try...
#zed describe a hypothetical conversation UI that meets the description.
< @nate and @nathan, I understand that you'd like to focus on the layout and visualization for a conversation view that can accommodate multiple people and potentially multiple bots as well. Here's a proposal for a conversation UI that meets the requirements:
1. Main conversation area: Display the summarized conversation content in a clean and organized manner, ensuring readability and efficient use of space.
2. Participant avatars and labels: Include user avatars and/or labels to distinguish between users and bots visually, allowing easy identification of each participant's contributions.
3. Active threads indicator: Designate a clear indicator for ongoing threads, which will attract attention to active sub-conversations or related discussions in the conversation view.
4. Dynamic branching: Implement a branching visual structure to present threaded conversations, clearly distinguishing sub-conversations, and enabling users to navigate between them smoothly.
5. Multiple bot interaction support: Facilitate interactions between multiple bots through user-invoked prompts or bot-to-bot communication channels without disrupting the primary conversation flow.
6. Expandable conversation history: Offer a separate, expandable section or panel to access historical content without cluttering the main conversation view.
7. Linking and referencing: Implement a system for hyperlinking relevant information, resources, or previous conversations to the current discussion, making it easy for participants to follow and reference the shared context.
This hypothetical conversation UI aims to address the layout and visualization, threading, and multi-participant aspects of your requirements. Of course, it's just an initial proposal, and we can refine and iterate on it based on your feedback and specific needs.

View file

@ -0,0 +1,3 @@
Push content to a deeper layer.
A context can have multiple sublayers.
You can enable or disable arbitrary sublayers at arbitrary nesting depths when viewing the document.

View file

@ -0,0 +1,126 @@
pub mod assistant_panel;
mod assistant_settings;
mod codegen;
mod prompts;
mod streaming_diff;
use ai::providers::open_ai::Role;
use anyhow::Result;
pub use assistant_panel::AssistantPanel;
use assistant_settings::OpenAIModel;
use chrono::{DateTime, Local};
use collections::HashMap;
use fs::Fs;
use futures::StreamExt;
use gpui::{actions, AppContext};
use regex::Regex;
use serde::{Deserialize, Serialize};
use std::{cmp::Reverse, ffi::OsStr, path::PathBuf, sync::Arc};
use util::paths::CONVERSATIONS_DIR;
actions!(
NewConversation,
Assist,
Split,
CycleMessageRole,
QuoteSelection,
ToggleFocus,
ResetKey,
InlineAssist,
ToggleIncludeConversation,
ToggleRetrieveContext,
);
#[derive(
Copy, Clone, Debug, Default, Eq, PartialEq, PartialOrd, Ord, Hash, Serialize, Deserialize,
)]
struct MessageId(usize);
#[derive(Clone, Debug, Serialize, Deserialize)]
struct MessageMetadata {
role: Role,
sent_at: DateTime<Local>,
status: MessageStatus,
}
#[derive(Clone, Debug, Serialize, Deserialize)]
enum MessageStatus {
Pending,
Done,
Error(Arc<str>),
}
#[derive(Serialize, Deserialize)]
struct SavedMessage {
id: MessageId,
start: usize,
}
#[derive(Serialize, Deserialize)]
struct SavedConversation {
id: Option<String>,
zed: String,
version: String,
text: String,
messages: Vec<SavedMessage>,
message_metadata: HashMap<MessageId, MessageMetadata>,
summary: String,
model: OpenAIModel,
}
impl SavedConversation {
const VERSION: &'static str = "0.1.0";
}
struct SavedConversationMetadata {
title: String,
path: PathBuf,
mtime: chrono::DateTime<chrono::Local>,
}
impl SavedConversationMetadata {
pub async fn list(fs: Arc<dyn Fs>) -> Result<Vec<Self>> {
fs.create_dir(&CONVERSATIONS_DIR).await?;
let mut paths = fs.read_dir(&CONVERSATIONS_DIR).await?;
let mut conversations = Vec::<SavedConversationMetadata>::new();
while let Some(path) = paths.next().await {
let path = path?;
if path.extension() != Some(OsStr::new("json")) {
continue;
}
let pattern = r" - \d+.zed.json$";
let re = Regex::new(pattern).unwrap();
let metadata = fs.metadata(&path).await?;
if let Some((file_name, metadata)) = path
.file_name()
.and_then(|name| name.to_str())
.zip(metadata)
{
let title = re.replace(file_name, "");
conversations.push(Self {
title: title.into_owned(),
path,
mtime: metadata.mtime.into(),
});
}
}
conversations.sort_unstable_by_key(|conversation| Reverse(conversation.mtime));
Ok(conversations)
}
}
pub fn init(cx: &mut AppContext) {
assistant_panel::init(cx);
}
#[cfg(test)]
#[ctor::ctor]
fn init_logger() {
if std::env::var("RUST_LOG").is_ok() {
env_logger::init();
}
}

File diff suppressed because it is too large Load diff

View file

@ -0,0 +1,80 @@
use anyhow;
use schemars::JsonSchema;
use serde::{Deserialize, Serialize};
use settings::Settings;
#[derive(Clone, Debug, Serialize, Deserialize, JsonSchema, PartialEq)]
pub enum OpenAIModel {
#[serde(rename = "gpt-3.5-turbo-0613")]
ThreePointFiveTurbo,
#[serde(rename = "gpt-4-0613")]
Four,
#[serde(rename = "gpt-4-1106-preview")]
FourTurbo,
}
impl OpenAIModel {
pub fn full_name(&self) -> &'static str {
match self {
OpenAIModel::ThreePointFiveTurbo => "gpt-3.5-turbo-0613",
OpenAIModel::Four => "gpt-4-0613",
OpenAIModel::FourTurbo => "gpt-4-1106-preview",
}
}
pub fn short_name(&self) -> &'static str {
match self {
OpenAIModel::ThreePointFiveTurbo => "gpt-3.5-turbo",
OpenAIModel::Four => "gpt-4",
OpenAIModel::FourTurbo => "gpt-4-turbo",
}
}
pub fn cycle(&self) -> Self {
match self {
OpenAIModel::ThreePointFiveTurbo => OpenAIModel::Four,
OpenAIModel::Four => OpenAIModel::FourTurbo,
OpenAIModel::FourTurbo => OpenAIModel::ThreePointFiveTurbo,
}
}
}
#[derive(Clone, Debug, Serialize, Deserialize, JsonSchema)]
#[serde(rename_all = "snake_case")]
pub enum AssistantDockPosition {
Left,
Right,
Bottom,
}
#[derive(Deserialize, Debug)]
pub struct AssistantSettings {
pub button: bool,
pub dock: AssistantDockPosition,
pub default_width: f32,
pub default_height: f32,
pub default_open_ai_model: OpenAIModel,
}
#[derive(Clone, Default, Serialize, Deserialize, JsonSchema, Debug)]
pub struct AssistantSettingsContent {
pub button: Option<bool>,
pub dock: Option<AssistantDockPosition>,
pub default_width: Option<f32>,
pub default_height: Option<f32>,
pub default_open_ai_model: Option<OpenAIModel>,
}
impl Settings for AssistantSettings {
const KEY: Option<&'static str> = Some("assistant");
type FileContent = AssistantSettingsContent;
fn load(
default_value: &Self::FileContent,
user_values: &[&Self::FileContent],
_: &mut gpui::AppContext,
) -> anyhow::Result<Self> {
Self::load_via_json_merge(default_value, user_values)
}
}

View file

@ -0,0 +1,688 @@
use crate::streaming_diff::{Hunk, StreamingDiff};
use ai::completion::{CompletionProvider, CompletionRequest};
use anyhow::Result;
use editor::{Anchor, MultiBuffer, MultiBufferSnapshot, ToOffset, ToPoint};
use futures::{channel::mpsc, SinkExt, Stream, StreamExt};
use gpui::{EventEmitter, Model, ModelContext, Task};
use language::{Rope, TransactionId};
use multi_buffer;
use std::{cmp, future, ops::Range, sync::Arc};
pub enum Event {
Finished,
Undone,
}
#[derive(Clone)]
pub enum CodegenKind {
Transform { range: Range<Anchor> },
Generate { position: Anchor },
}
pub struct Codegen {
provider: Arc<dyn CompletionProvider>,
buffer: Model<MultiBuffer>,
snapshot: MultiBufferSnapshot,
kind: CodegenKind,
last_equal_ranges: Vec<Range<Anchor>>,
transaction_id: Option<TransactionId>,
error: Option<anyhow::Error>,
generation: Task<()>,
idle: bool,
_subscription: gpui::Subscription,
}
impl EventEmitter<Event> for Codegen {}
impl Codegen {
pub fn new(
buffer: Model<MultiBuffer>,
kind: CodegenKind,
provider: Arc<dyn CompletionProvider>,
cx: &mut ModelContext<Self>,
) -> Self {
let snapshot = buffer.read(cx).snapshot(cx);
Self {
provider,
buffer: buffer.clone(),
snapshot,
kind,
last_equal_ranges: Default::default(),
transaction_id: Default::default(),
error: Default::default(),
idle: true,
generation: Task::ready(()),
_subscription: cx.subscribe(&buffer, Self::handle_buffer_event),
}
}
fn handle_buffer_event(
&mut self,
_buffer: Model<MultiBuffer>,
event: &multi_buffer::Event,
cx: &mut ModelContext<Self>,
) {
if let multi_buffer::Event::TransactionUndone { transaction_id } = event {
if self.transaction_id == Some(*transaction_id) {
self.transaction_id = None;
self.generation = Task::ready(());
cx.emit(Event::Undone);
}
}
}
pub fn range(&self) -> Range<Anchor> {
match &self.kind {
CodegenKind::Transform { range } => range.clone(),
CodegenKind::Generate { position } => position.bias_left(&self.snapshot)..*position,
}
}
pub fn kind(&self) -> &CodegenKind {
&self.kind
}
pub fn last_equal_ranges(&self) -> &[Range<Anchor>] {
&self.last_equal_ranges
}
pub fn idle(&self) -> bool {
self.idle
}
pub fn error(&self) -> Option<&anyhow::Error> {
self.error.as_ref()
}
pub fn start(&mut self, prompt: Box<dyn CompletionRequest>, cx: &mut ModelContext<Self>) {
let range = self.range();
let snapshot = self.snapshot.clone();
let selected_text = snapshot
.text_for_range(range.start..range.end)
.collect::<Rope>();
let selection_start = range.start.to_point(&snapshot);
let suggested_line_indent = snapshot
.suggested_indents(selection_start.row..selection_start.row + 1, cx)
.into_values()
.next()
.unwrap_or_else(|| snapshot.indent_size_for_line(selection_start.row));
let response = self.provider.complete(prompt);
self.generation = cx.spawn(|this, mut cx| {
async move {
let generate = async {
let mut edit_start = range.start.to_offset(&snapshot);
let (mut hunks_tx, mut hunks_rx) = mpsc::channel(1);
let diff = cx.background_executor().spawn(async move {
let chunks = strip_invalid_spans_from_codeblock(response.await?);
futures::pin_mut!(chunks);
let mut diff = StreamingDiff::new(selected_text.to_string());
let mut new_text = String::new();
let mut base_indent = None;
let mut line_indent = None;
let mut first_line = true;
while let Some(chunk) = chunks.next().await {
let chunk = chunk?;
let mut lines = chunk.split('\n').peekable();
while let Some(line) = lines.next() {
new_text.push_str(line);
if line_indent.is_none() {
if let Some(non_whitespace_ch_ix) =
new_text.find(|ch: char| !ch.is_whitespace())
{
line_indent = Some(non_whitespace_ch_ix);
base_indent = base_indent.or(line_indent);
let line_indent = line_indent.unwrap();
let base_indent = base_indent.unwrap();
let indent_delta = line_indent as i32 - base_indent as i32;
let mut corrected_indent_len = cmp::max(
0,
suggested_line_indent.len as i32 + indent_delta,
)
as usize;
if first_line {
corrected_indent_len = corrected_indent_len
.saturating_sub(selection_start.column as usize);
}
let indent_char = suggested_line_indent.char();
let mut indent_buffer = [0; 4];
let indent_str =
indent_char.encode_utf8(&mut indent_buffer);
new_text.replace_range(
..line_indent,
&indent_str.repeat(corrected_indent_len),
);
}
}
if line_indent.is_some() {
hunks_tx.send(diff.push_new(&new_text)).await?;
new_text.clear();
}
if lines.peek().is_some() {
hunks_tx.send(diff.push_new("\n")).await?;
line_indent = None;
first_line = false;
}
}
}
hunks_tx.send(diff.push_new(&new_text)).await?;
hunks_tx.send(diff.finish()).await?;
anyhow::Ok(())
});
while let Some(hunks) = hunks_rx.next().await {
this.update(&mut cx, |this, cx| {
this.last_equal_ranges.clear();
let transaction = this.buffer.update(cx, |buffer, cx| {
// Avoid grouping assistant edits with user edits.
buffer.finalize_last_transaction(cx);
buffer.start_transaction(cx);
buffer.edit(
hunks.into_iter().filter_map(|hunk| match hunk {
Hunk::Insert { text } => {
let edit_start = snapshot.anchor_after(edit_start);
Some((edit_start..edit_start, text))
}
Hunk::Remove { len } => {
let edit_end = edit_start + len;
let edit_range = snapshot.anchor_after(edit_start)
..snapshot.anchor_before(edit_end);
edit_start = edit_end;
Some((edit_range, String::new()))
}
Hunk::Keep { len } => {
let edit_end = edit_start + len;
let edit_range = snapshot.anchor_after(edit_start)
..snapshot.anchor_before(edit_end);
edit_start = edit_end;
this.last_equal_ranges.push(edit_range);
None
}
}),
None,
cx,
);
buffer.end_transaction(cx)
});
if let Some(transaction) = transaction {
if let Some(first_transaction) = this.transaction_id {
// Group all assistant edits into the first transaction.
this.buffer.update(cx, |buffer, cx| {
buffer.merge_transactions(
transaction,
first_transaction,
cx,
)
});
} else {
this.transaction_id = Some(transaction);
this.buffer.update(cx, |buffer, cx| {
buffer.finalize_last_transaction(cx)
});
}
}
cx.notify();
})?;
}
diff.await?;
anyhow::Ok(())
};
let result = generate.await;
this.update(&mut cx, |this, cx| {
this.last_equal_ranges.clear();
this.idle = true;
if let Err(error) = result {
this.error = Some(error);
}
cx.emit(Event::Finished);
cx.notify();
})
.ok();
}
});
self.error.take();
self.idle = false;
cx.notify();
}
pub fn undo(&mut self, cx: &mut ModelContext<Self>) {
if let Some(transaction_id) = self.transaction_id {
self.buffer
.update(cx, |buffer, cx| buffer.undo_transaction(transaction_id, cx));
}
}
}
fn strip_invalid_spans_from_codeblock(
stream: impl Stream<Item = Result<String>>,
) -> impl Stream<Item = Result<String>> {
let mut first_line = true;
let mut buffer = String::new();
let mut starts_with_markdown_codeblock = false;
let mut includes_start_or_end_span = false;
stream.filter_map(move |chunk| {
let chunk = match chunk {
Ok(chunk) => chunk,
Err(err) => return future::ready(Some(Err(err))),
};
buffer.push_str(&chunk);
if buffer.len() > "<|S|".len() && buffer.starts_with("<|S|") {
includes_start_or_end_span = true;
buffer = buffer
.strip_prefix("<|S|>")
.or_else(|| buffer.strip_prefix("<|S|"))
.unwrap_or(&buffer)
.to_string();
} else if buffer.ends_with("|E|>") {
includes_start_or_end_span = true;
} else if buffer.starts_with("<|")
|| buffer.starts_with("<|S")
|| buffer.starts_with("<|S|")
|| buffer.ends_with("|")
|| buffer.ends_with("|E")
|| buffer.ends_with("|E|")
{
return future::ready(None);
}
if first_line {
if buffer == "" || buffer == "`" || buffer == "``" {
return future::ready(None);
} else if buffer.starts_with("```") {
starts_with_markdown_codeblock = true;
if let Some(newline_ix) = buffer.find('\n') {
buffer.replace_range(..newline_ix + 1, "");
first_line = false;
} else {
return future::ready(None);
}
}
}
let mut text = buffer.to_string();
if starts_with_markdown_codeblock {
text = text
.strip_suffix("\n```\n")
.or_else(|| text.strip_suffix("\n```"))
.or_else(|| text.strip_suffix("\n``"))
.or_else(|| text.strip_suffix("\n`"))
.or_else(|| text.strip_suffix('\n'))
.unwrap_or(&text)
.to_string();
}
if includes_start_or_end_span {
text = text
.strip_suffix("|E|>")
.or_else(|| text.strip_suffix("E|>"))
.or_else(|| text.strip_prefix("|>"))
.or_else(|| text.strip_prefix(">"))
.unwrap_or(&text)
.to_string();
};
if text.contains('\n') {
first_line = false;
}
let remainder = buffer.split_off(text.len());
let result = if buffer.is_empty() {
None
} else {
Some(Ok(buffer.clone()))
};
buffer = remainder;
future::ready(result)
})
}
#[cfg(test)]
mod tests {
use std::sync::Arc;
use super::*;
use ai::test::FakeCompletionProvider;
use futures::stream::{self};
use gpui::{Context, TestAppContext};
use indoc::indoc;
use language::{language_settings, tree_sitter_rust, Buffer, Language, LanguageConfig, Point};
use rand::prelude::*;
use serde::Serialize;
use settings::SettingsStore;
#[derive(Serialize)]
pub struct DummyCompletionRequest {
pub name: String,
}
impl CompletionRequest for DummyCompletionRequest {
fn data(&self) -> serde_json::Result<String> {
serde_json::to_string(self)
}
}
#[gpui::test(iterations = 10)]
async fn test_transform_autoindent(cx: &mut TestAppContext, mut rng: StdRng) {
cx.set_global(cx.update(SettingsStore::test));
cx.update(language_settings::init);
let text = indoc! {"
fn main() {
let x = 0;
for _ in 0..10 {
x += 1;
}
}
"};
let buffer =
cx.build_model(|cx| Buffer::new(0, 0, text).with_language(Arc::new(rust_lang()), cx));
let buffer = cx.build_model(|cx| MultiBuffer::singleton(buffer, cx));
let range = buffer.read_with(cx, |buffer, cx| {
let snapshot = buffer.snapshot(cx);
snapshot.anchor_before(Point::new(1, 0))..snapshot.anchor_after(Point::new(4, 5))
});
let provider = Arc::new(FakeCompletionProvider::new());
let codegen = cx.build_model(|cx| {
Codegen::new(
buffer.clone(),
CodegenKind::Transform { range },
provider.clone(),
cx,
)
});
let request = Box::new(DummyCompletionRequest {
name: "test".to_string(),
});
codegen.update(cx, |codegen, cx| codegen.start(request, cx));
let mut new_text = concat!(
" let mut x = 0;\n",
" while x < 10 {\n",
" x += 1;\n",
" }",
);
while !new_text.is_empty() {
let max_len = cmp::min(new_text.len(), 10);
let len = rng.gen_range(1..=max_len);
let (chunk, suffix) = new_text.split_at(len);
println!("CHUNK: {:?}", &chunk);
provider.send_completion(chunk);
new_text = suffix;
cx.background_executor.run_until_parked();
}
provider.finish_completion();
cx.background_executor.run_until_parked();
assert_eq!(
buffer.read_with(cx, |buffer, cx| buffer.snapshot(cx).text()),
indoc! {"
fn main() {
let mut x = 0;
while x < 10 {
x += 1;
}
}
"}
);
}
#[gpui::test(iterations = 10)]
async fn test_autoindent_when_generating_past_indentation(
cx: &mut TestAppContext,
mut rng: StdRng,
) {
cx.set_global(cx.update(SettingsStore::test));
cx.update(language_settings::init);
let text = indoc! {"
fn main() {
le
}
"};
let buffer =
cx.build_model(|cx| Buffer::new(0, 0, text).with_language(Arc::new(rust_lang()), cx));
let buffer = cx.build_model(|cx| MultiBuffer::singleton(buffer, cx));
let position = buffer.read_with(cx, |buffer, cx| {
let snapshot = buffer.snapshot(cx);
snapshot.anchor_before(Point::new(1, 6))
});
let provider = Arc::new(FakeCompletionProvider::new());
let codegen = cx.build_model(|cx| {
Codegen::new(
buffer.clone(),
CodegenKind::Generate { position },
provider.clone(),
cx,
)
});
let request = Box::new(DummyCompletionRequest {
name: "test".to_string(),
});
codegen.update(cx, |codegen, cx| codegen.start(request, cx));
let mut new_text = concat!(
"t mut x = 0;\n",
"while x < 10 {\n",
" x += 1;\n",
"}", //
);
while !new_text.is_empty() {
let max_len = cmp::min(new_text.len(), 10);
let len = rng.gen_range(1..=max_len);
let (chunk, suffix) = new_text.split_at(len);
provider.send_completion(chunk);
new_text = suffix;
cx.background_executor.run_until_parked();
}
provider.finish_completion();
cx.background_executor.run_until_parked();
assert_eq!(
buffer.read_with(cx, |buffer, cx| buffer.snapshot(cx).text()),
indoc! {"
fn main() {
let mut x = 0;
while x < 10 {
x += 1;
}
}
"}
);
}
#[gpui::test(iterations = 10)]
async fn test_autoindent_when_generating_before_indentation(
cx: &mut TestAppContext,
mut rng: StdRng,
) {
cx.set_global(cx.update(SettingsStore::test));
cx.update(language_settings::init);
let text = concat!(
"fn main() {\n",
" \n",
"}\n" //
);
let buffer =
cx.build_model(|cx| Buffer::new(0, 0, text).with_language(Arc::new(rust_lang()), cx));
let buffer = cx.build_model(|cx| MultiBuffer::singleton(buffer, cx));
let position = buffer.read_with(cx, |buffer, cx| {
let snapshot = buffer.snapshot(cx);
snapshot.anchor_before(Point::new(1, 2))
});
let provider = Arc::new(FakeCompletionProvider::new());
let codegen = cx.build_model(|cx| {
Codegen::new(
buffer.clone(),
CodegenKind::Generate { position },
provider.clone(),
cx,
)
});
let request = Box::new(DummyCompletionRequest {
name: "test".to_string(),
});
codegen.update(cx, |codegen, cx| codegen.start(request, cx));
let mut new_text = concat!(
"let mut x = 0;\n",
"while x < 10 {\n",
" x += 1;\n",
"}", //
);
while !new_text.is_empty() {
let max_len = cmp::min(new_text.len(), 10);
let len = rng.gen_range(1..=max_len);
let (chunk, suffix) = new_text.split_at(len);
println!("{:?}", &chunk);
provider.send_completion(chunk);
new_text = suffix;
cx.background_executor.run_until_parked();
}
provider.finish_completion();
cx.background_executor.run_until_parked();
assert_eq!(
buffer.read_with(cx, |buffer, cx| buffer.snapshot(cx).text()),
indoc! {"
fn main() {
let mut x = 0;
while x < 10 {
x += 1;
}
}
"}
);
}
#[gpui::test]
async fn test_strip_invalid_spans_from_codeblock() {
assert_eq!(
strip_invalid_spans_from_codeblock(chunks("Lorem ipsum dolor", 2))
.map(|chunk| chunk.unwrap())
.collect::<String>()
.await,
"Lorem ipsum dolor"
);
assert_eq!(
strip_invalid_spans_from_codeblock(chunks("```\nLorem ipsum dolor", 2))
.map(|chunk| chunk.unwrap())
.collect::<String>()
.await,
"Lorem ipsum dolor"
);
assert_eq!(
strip_invalid_spans_from_codeblock(chunks("```\nLorem ipsum dolor\n```", 2))
.map(|chunk| chunk.unwrap())
.collect::<String>()
.await,
"Lorem ipsum dolor"
);
assert_eq!(
strip_invalid_spans_from_codeblock(chunks("```\nLorem ipsum dolor\n```\n", 2))
.map(|chunk| chunk.unwrap())
.collect::<String>()
.await,
"Lorem ipsum dolor"
);
assert_eq!(
strip_invalid_spans_from_codeblock(chunks(
"```html\n```js\nLorem ipsum dolor\n```\n```",
2
))
.map(|chunk| chunk.unwrap())
.collect::<String>()
.await,
"```js\nLorem ipsum dolor\n```"
);
assert_eq!(
strip_invalid_spans_from_codeblock(chunks("``\nLorem ipsum dolor\n```", 2))
.map(|chunk| chunk.unwrap())
.collect::<String>()
.await,
"``\nLorem ipsum dolor\n```"
);
assert_eq!(
strip_invalid_spans_from_codeblock(chunks("<|S|Lorem ipsum|E|>", 2))
.map(|chunk| chunk.unwrap())
.collect::<String>()
.await,
"Lorem ipsum"
);
assert_eq!(
strip_invalid_spans_from_codeblock(chunks("<|S|>Lorem ipsum", 2))
.map(|chunk| chunk.unwrap())
.collect::<String>()
.await,
"Lorem ipsum"
);
assert_eq!(
strip_invalid_spans_from_codeblock(chunks("```\n<|S|>Lorem ipsum\n```", 2))
.map(|chunk| chunk.unwrap())
.collect::<String>()
.await,
"Lorem ipsum"
);
assert_eq!(
strip_invalid_spans_from_codeblock(chunks("```\n<|S|Lorem ipsum|E|>\n```", 2))
.map(|chunk| chunk.unwrap())
.collect::<String>()
.await,
"Lorem ipsum"
);
fn chunks(text: &str, size: usize) -> impl Stream<Item = Result<String>> {
stream::iter(
text.chars()
.collect::<Vec<_>>()
.chunks(size)
.map(|chunk| Ok(chunk.iter().collect::<String>()))
.collect::<Vec<_>>(),
)
}
}
fn rust_lang() -> Language {
Language::new(
LanguageConfig {
name: "Rust".into(),
path_suffixes: vec!["rs".to_string()],
..Default::default()
},
Some(tree_sitter_rust::language()),
)
.with_indents_query(
r#"
(call_expression) @indent
(field_expression) @indent
(_ "(" ")" @end) @indent
(_ "{" "}" @end) @indent
"#,
)
.unwrap()
}
}

View file

@ -0,0 +1,389 @@
use ai::models::LanguageModel;
use ai::prompts::base::{PromptArguments, PromptChain, PromptPriority, PromptTemplate};
use ai::prompts::file_context::FileContext;
use ai::prompts::generate::GenerateInlineContent;
use ai::prompts::preamble::EngineerPreamble;
use ai::prompts::repository_context::{PromptCodeSnippet, RepositoryContext};
use ai::providers::open_ai::OpenAILanguageModel;
use language::{BufferSnapshot, OffsetRangeExt, ToOffset};
use std::cmp::{self, Reverse};
use std::ops::Range;
use std::sync::Arc;
#[allow(dead_code)]
fn summarize(buffer: &BufferSnapshot, selected_range: Range<impl ToOffset>) -> String {
#[derive(Debug)]
struct Match {
collapse: Range<usize>,
keep: Vec<Range<usize>>,
}
let selected_range = selected_range.to_offset(buffer);
let mut ts_matches = buffer.matches(0..buffer.len(), |grammar| {
Some(&grammar.embedding_config.as_ref()?.query)
});
let configs = ts_matches
.grammars()
.iter()
.map(|g| g.embedding_config.as_ref().unwrap())
.collect::<Vec<_>>();
let mut matches = Vec::new();
while let Some(mat) = ts_matches.peek() {
let config = &configs[mat.grammar_index];
if let Some(collapse) = mat.captures.iter().find_map(|cap| {
if Some(cap.index) == config.collapse_capture_ix {
Some(cap.node.byte_range())
} else {
None
}
}) {
let mut keep = Vec::new();
for capture in mat.captures.iter() {
if Some(capture.index) == config.keep_capture_ix {
keep.push(capture.node.byte_range());
} else {
continue;
}
}
ts_matches.advance();
matches.push(Match { collapse, keep });
} else {
ts_matches.advance();
}
}
matches.sort_unstable_by_key(|mat| (mat.collapse.start, Reverse(mat.collapse.end)));
let mut matches = matches.into_iter().peekable();
let mut summary = String::new();
let mut offset = 0;
let mut flushed_selection = false;
while let Some(mat) = matches.next() {
// Keep extending the collapsed range if the next match surrounds
// the current one.
while let Some(next_mat) = matches.peek() {
if mat.collapse.start <= next_mat.collapse.start
&& mat.collapse.end >= next_mat.collapse.end
{
matches.next().unwrap();
} else {
break;
}
}
if offset > mat.collapse.start {
// Skip collapsed nodes that have already been summarized.
offset = cmp::max(offset, mat.collapse.end);
continue;
}
if offset <= selected_range.start && selected_range.start <= mat.collapse.end {
if !flushed_selection {
// The collapsed node ends after the selection starts, so we'll flush the selection first.
summary.extend(buffer.text_for_range(offset..selected_range.start));
summary.push_str("<|S|");
if selected_range.end == selected_range.start {
summary.push_str(">");
} else {
summary.extend(buffer.text_for_range(selected_range.clone()));
summary.push_str("|E|>");
}
offset = selected_range.end;
flushed_selection = true;
}
// If the selection intersects the collapsed node, we won't collapse it.
if selected_range.end >= mat.collapse.start {
continue;
}
}
summary.extend(buffer.text_for_range(offset..mat.collapse.start));
for keep in mat.keep {
summary.extend(buffer.text_for_range(keep));
}
offset = mat.collapse.end;
}
// Flush selection if we haven't already done so.
if !flushed_selection && offset <= selected_range.start {
summary.extend(buffer.text_for_range(offset..selected_range.start));
summary.push_str("<|S|");
if selected_range.end == selected_range.start {
summary.push_str(">");
} else {
summary.extend(buffer.text_for_range(selected_range.clone()));
summary.push_str("|E|>");
}
offset = selected_range.end;
}
summary.extend(buffer.text_for_range(offset..buffer.len()));
summary
}
pub fn generate_content_prompt(
user_prompt: String,
language_name: Option<&str>,
buffer: BufferSnapshot,
range: Range<usize>,
search_results: Vec<PromptCodeSnippet>,
model: &str,
project_name: Option<String>,
) -> anyhow::Result<String> {
// Using new Prompt Templates
let openai_model: Arc<dyn LanguageModel> = Arc::new(OpenAILanguageModel::load(model));
let lang_name = if let Some(language_name) = language_name {
Some(language_name.to_string())
} else {
None
};
let args = PromptArguments {
model: openai_model,
language_name: lang_name.clone(),
project_name,
snippets: search_results.clone(),
reserved_tokens: 1000,
buffer: Some(buffer),
selected_range: Some(range),
user_prompt: Some(user_prompt.clone()),
};
let templates: Vec<(PromptPriority, Box<dyn PromptTemplate>)> = vec![
(PromptPriority::Mandatory, Box::new(EngineerPreamble {})),
(
PromptPriority::Ordered { order: 1 },
Box::new(RepositoryContext {}),
),
(
PromptPriority::Ordered { order: 0 },
Box::new(FileContext {}),
),
(
PromptPriority::Mandatory,
Box::new(GenerateInlineContent {}),
),
];
let chain = PromptChain::new(args, templates);
let (prompt, _) = chain.generate(true)?;
anyhow::Ok(prompt)
}
#[cfg(test)]
pub(crate) mod tests {
use super::*;
use std::sync::Arc;
use gpui::{AppContext, Context};
use indoc::indoc;
use language::{language_settings, tree_sitter_rust, Buffer, Language, LanguageConfig, Point};
use settings::SettingsStore;
pub(crate) fn rust_lang() -> Language {
Language::new(
LanguageConfig {
name: "Rust".into(),
path_suffixes: vec!["rs".to_string()],
..Default::default()
},
Some(tree_sitter_rust::language()),
)
.with_embedding_query(
r#"
(
[(line_comment) (attribute_item)]* @context
.
[
(struct_item
name: (_) @name)
(enum_item
name: (_) @name)
(impl_item
trait: (_)? @name
"for"? @name
type: (_) @name)
(trait_item
name: (_) @name)
(function_item
name: (_) @name
body: (block
"{" @keep
"}" @keep) @collapse)
(macro_definition
name: (_) @name)
] @item
)
"#,
)
.unwrap()
}
#[gpui::test]
fn test_outline_for_prompt(cx: &mut AppContext) {
let settings_store = SettingsStore::test(cx);
cx.set_global(settings_store);
language_settings::init(cx);
let text = indoc! {"
struct X {
a: usize,
b: usize,
}
impl X {
fn new() -> Self {
let a = 1;
let b = 2;
Self { a, b }
}
pub fn a(&self, param: bool) -> usize {
self.a
}
pub fn b(&self) -> usize {
self.b
}
}
"};
let buffer =
cx.build_model(|cx| Buffer::new(0, 0, text).with_language(Arc::new(rust_lang()), cx));
let snapshot = buffer.read(cx).snapshot();
assert_eq!(
summarize(&snapshot, Point::new(1, 4)..Point::new(1, 4)),
indoc! {"
struct X {
<|S|>a: usize,
b: usize,
}
impl X {
fn new() -> Self {}
pub fn a(&self, param: bool) -> usize {}
pub fn b(&self) -> usize {}
}
"}
);
assert_eq!(
summarize(&snapshot, Point::new(8, 12)..Point::new(8, 14)),
indoc! {"
struct X {
a: usize,
b: usize,
}
impl X {
fn new() -> Self {
let <|S|a |E|>= 1;
let b = 2;
Self { a, b }
}
pub fn a(&self, param: bool) -> usize {}
pub fn b(&self) -> usize {}
}
"}
);
assert_eq!(
summarize(&snapshot, Point::new(6, 0)..Point::new(6, 0)),
indoc! {"
struct X {
a: usize,
b: usize,
}
impl X {
<|S|>
fn new() -> Self {}
pub fn a(&self, param: bool) -> usize {}
pub fn b(&self) -> usize {}
}
"}
);
assert_eq!(
summarize(&snapshot, Point::new(21, 0)..Point::new(21, 0)),
indoc! {"
struct X {
a: usize,
b: usize,
}
impl X {
fn new() -> Self {}
pub fn a(&self, param: bool) -> usize {}
pub fn b(&self) -> usize {}
}
<|S|>"}
);
// Ensure nested functions get collapsed properly.
let text = indoc! {"
struct X {
a: usize,
b: usize,
}
impl X {
fn new() -> Self {
let a = 1;
let b = 2;
Self { a, b }
}
pub fn a(&self, param: bool) -> usize {
let a = 30;
fn nested() -> usize {
3
}
self.a + nested()
}
pub fn b(&self) -> usize {
self.b
}
}
"};
buffer.update(cx, |buffer, cx| buffer.set_text(text, cx));
let snapshot = buffer.read(cx).snapshot();
assert_eq!(
summarize(&snapshot, Point::new(0, 0)..Point::new(0, 0)),
indoc! {"
<|S|>struct X {
a: usize,
b: usize,
}
impl X {
fn new() -> Self {}
pub fn a(&self, param: bool) -> usize {}
pub fn b(&self) -> usize {}
}
"}
);
}
}

View file

@ -0,0 +1,293 @@
use collections::HashMap;
use ordered_float::OrderedFloat;
use std::{
cmp,
fmt::{self, Debug},
ops::Range,
};
struct Matrix {
cells: Vec<f64>,
rows: usize,
cols: usize,
}
impl Matrix {
fn new() -> Self {
Self {
cells: Vec::new(),
rows: 0,
cols: 0,
}
}
fn resize(&mut self, rows: usize, cols: usize) {
self.cells.resize(rows * cols, 0.);
self.rows = rows;
self.cols = cols;
}
fn get(&self, row: usize, col: usize) -> f64 {
if row >= self.rows {
panic!("row out of bounds")
}
if col >= self.cols {
panic!("col out of bounds")
}
self.cells[col * self.rows + row]
}
fn set(&mut self, row: usize, col: usize, value: f64) {
if row >= self.rows {
panic!("row out of bounds")
}
if col >= self.cols {
panic!("col out of bounds")
}
self.cells[col * self.rows + row] = value;
}
}
impl Debug for Matrix {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
writeln!(f)?;
for i in 0..self.rows {
for j in 0..self.cols {
write!(f, "{:5}", self.get(i, j))?;
}
writeln!(f)?;
}
Ok(())
}
}
#[derive(Debug)]
pub enum Hunk {
Insert { text: String },
Remove { len: usize },
Keep { len: usize },
}
pub struct StreamingDiff {
old: Vec<char>,
new: Vec<char>,
scores: Matrix,
old_text_ix: usize,
new_text_ix: usize,
equal_runs: HashMap<(usize, usize), u32>,
}
impl StreamingDiff {
const INSERTION_SCORE: f64 = -1.;
const DELETION_SCORE: f64 = -20.;
const EQUALITY_BASE: f64 = 1.8;
const MAX_EQUALITY_EXPONENT: i32 = 16;
pub fn new(old: String) -> Self {
let old = old.chars().collect::<Vec<_>>();
let mut scores = Matrix::new();
scores.resize(old.len() + 1, 1);
for i in 0..=old.len() {
scores.set(i, 0, i as f64 * Self::DELETION_SCORE);
}
Self {
old,
new: Vec::new(),
scores,
old_text_ix: 0,
new_text_ix: 0,
equal_runs: Default::default(),
}
}
pub fn push_new(&mut self, text: &str) -> Vec<Hunk> {
self.new.extend(text.chars());
self.scores.resize(self.old.len() + 1, self.new.len() + 1);
for j in self.new_text_ix + 1..=self.new.len() {
self.scores.set(0, j, j as f64 * Self::INSERTION_SCORE);
for i in 1..=self.old.len() {
let insertion_score = self.scores.get(i, j - 1) + Self::INSERTION_SCORE;
let deletion_score = self.scores.get(i - 1, j) + Self::DELETION_SCORE;
let equality_score = if self.old[i - 1] == self.new[j - 1] {
let mut equal_run = self.equal_runs.get(&(i - 1, j - 1)).copied().unwrap_or(0);
equal_run += 1;
self.equal_runs.insert((i, j), equal_run);
let exponent = cmp::min(equal_run as i32 / 4, Self::MAX_EQUALITY_EXPONENT);
self.scores.get(i - 1, j - 1) + Self::EQUALITY_BASE.powi(exponent)
} else {
f64::NEG_INFINITY
};
let score = insertion_score.max(deletion_score).max(equality_score);
self.scores.set(i, j, score);
}
}
let mut max_score = f64::NEG_INFINITY;
let mut next_old_text_ix = self.old_text_ix;
let next_new_text_ix = self.new.len();
for i in self.old_text_ix..=self.old.len() {
let score = self.scores.get(i, next_new_text_ix);
if score > max_score {
max_score = score;
next_old_text_ix = i;
}
}
let hunks = self.backtrack(next_old_text_ix, next_new_text_ix);
self.old_text_ix = next_old_text_ix;
self.new_text_ix = next_new_text_ix;
hunks
}
fn backtrack(&self, old_text_ix: usize, new_text_ix: usize) -> Vec<Hunk> {
let mut pending_insert: Option<Range<usize>> = None;
let mut hunks = Vec::new();
let mut i = old_text_ix;
let mut j = new_text_ix;
while (i, j) != (self.old_text_ix, self.new_text_ix) {
let insertion_score = if j > self.new_text_ix {
Some((i, j - 1))
} else {
None
};
let deletion_score = if i > self.old_text_ix {
Some((i - 1, j))
} else {
None
};
let equality_score = if i > self.old_text_ix && j > self.new_text_ix {
if self.old[i - 1] == self.new[j - 1] {
Some((i - 1, j - 1))
} else {
None
}
} else {
None
};
let (prev_i, prev_j) = [insertion_score, deletion_score, equality_score]
.iter()
.max_by_key(|cell| cell.map(|(i, j)| OrderedFloat(self.scores.get(i, j))))
.unwrap()
.unwrap();
if prev_i == i && prev_j == j - 1 {
if let Some(pending_insert) = pending_insert.as_mut() {
pending_insert.start = prev_j;
} else {
pending_insert = Some(prev_j..j);
}
} else {
if let Some(range) = pending_insert.take() {
hunks.push(Hunk::Insert {
text: self.new[range].iter().collect(),
});
}
let char_len = self.old[i - 1].len_utf8();
if prev_i == i - 1 && prev_j == j {
if let Some(Hunk::Remove { len }) = hunks.last_mut() {
*len += char_len;
} else {
hunks.push(Hunk::Remove { len: char_len })
}
} else {
if let Some(Hunk::Keep { len }) = hunks.last_mut() {
*len += char_len;
} else {
hunks.push(Hunk::Keep { len: char_len })
}
}
}
i = prev_i;
j = prev_j;
}
if let Some(range) = pending_insert.take() {
hunks.push(Hunk::Insert {
text: self.new[range].iter().collect(),
});
}
hunks.reverse();
hunks
}
pub fn finish(self) -> Vec<Hunk> {
self.backtrack(self.old.len(), self.new.len())
}
}
#[cfg(test)]
mod tests {
use std::env;
use super::*;
use rand::prelude::*;
#[gpui::test(iterations = 100)]
fn test_random_diffs(mut rng: StdRng) {
let old_text_len = env::var("OLD_TEXT_LEN")
.map(|i| i.parse().expect("invalid `OLD_TEXT_LEN` variable"))
.unwrap_or(10);
let new_text_len = env::var("NEW_TEXT_LEN")
.map(|i| i.parse().expect("invalid `NEW_TEXT_LEN` variable"))
.unwrap_or(10);
let old = util::RandomCharIter::new(&mut rng)
.take(old_text_len)
.collect::<String>();
log::info!("old text: {:?}", old);
let mut diff = StreamingDiff::new(old.clone());
let mut hunks = Vec::new();
let mut new_len = 0;
let mut new = String::new();
while new_len < new_text_len {
let new_chunk_len = rng.gen_range(1..=new_text_len - new_len);
let new_chunk = util::RandomCharIter::new(&mut rng)
.take(new_len)
.collect::<String>();
log::info!("new chunk: {:?}", new_chunk);
new_len += new_chunk_len;
new.push_str(&new_chunk);
let new_hunks = diff.push_new(&new_chunk);
log::info!("hunks: {:?}", new_hunks);
hunks.extend(new_hunks);
}
let final_hunks = diff.finish();
log::info!("final hunks: {:?}", final_hunks);
hunks.extend(final_hunks);
log::info!("new text: {:?}", new);
let mut old_ix = 0;
let mut new_ix = 0;
let mut patched = String::new();
for hunk in hunks {
match hunk {
Hunk::Keep { len } => {
assert_eq!(&old[old_ix..old_ix + len], &new[new_ix..new_ix + len]);
patched.push_str(&old[old_ix..old_ix + len]);
old_ix += len;
new_ix += len;
}
Hunk::Remove { len } => {
old_ix += len;
}
Hunk::Insert { text } => {
assert_eq!(text, &new[new_ix..new_ix + text.len()]);
patched.push_str(&text);
new_ix += text.len();
}
}
}
assert_eq!(patched, new);
}
}

View file

@ -1,10 +1,10 @@
use gpui::{ use gpui::{
Component, Element, EventEmitter, IntoElement, ParentElement, Render, StyledText, Subscription, Div, Element, EventEmitter, IntoElement, ParentElement, Render, StyledText, Subscription,
ViewContext, WeakView, ViewContext, WeakView,
}; };
use itertools::Itertools; use itertools::Itertools;
use theme::ActiveTheme; use theme::ActiveTheme;
use ui::{ButtonCommon, ButtonLike, ButtonStyle, Clickable, Disableable, Label}; use ui::{prelude::*, ButtonLike, ButtonStyle, Label};
use workspace::{ use workspace::{
item::{ItemEvent, ItemHandle}, item::{ItemEvent, ItemHandle},
ToolbarItemEvent, ToolbarItemLocation, ToolbarItemView, Workspace, ToolbarItemEvent, ToolbarItemLocation, ToolbarItemView, Workspace,
@ -36,42 +36,39 @@ impl EventEmitter<Event> for Breadcrumbs {}
impl EventEmitter<ToolbarItemEvent> for Breadcrumbs {} impl EventEmitter<ToolbarItemEvent> for Breadcrumbs {}
impl Render for Breadcrumbs { impl Render for Breadcrumbs {
type Element = Component<ButtonLike>; type Element = Div;
fn render(&mut self, cx: &mut ViewContext<Self>) -> Self::Element { fn render(&mut self, cx: &mut ViewContext<Self>) -> Self::Element {
let button = ButtonLike::new("breadcrumbs") let element = h_stack().text_ui();
.style(ButtonStyle::Transparent)
.disabled(true);
let active_item = match &self.active_item { let Some(active_item) = &self
Some(active_item) => active_item, .active_item
None => return button.into_element(), .as_ref()
.filter(|item| item.downcast::<editor::Editor>().is_some())
else {
return element;
}; };
let not_editor = active_item.downcast::<editor::Editor>().is_none();
let breadcrumbs = match active_item.breadcrumbs(cx.theme(), cx) { let Some(segments) = active_item.breadcrumbs(cx.theme(), cx) else {
Some(breadcrumbs) => breadcrumbs, return element;
None => return button.into_element(), };
}
.into_iter() let highlighted_segments = segments.into_iter().map(|segment| {
.map(|breadcrumb| { StyledText::new(segment.text)
StyledText::new(breadcrumb.text) .with_highlights(&cx.text_style(), segment.highlights.unwrap_or_default())
.with_highlights(&cx.text_style(), breadcrumb.highlights.unwrap_or_default())
.into_any() .into_any()
}); });
let breadcrumbs = Itertools::intersperse_with(highlighted_segments, || {
Label::new("").into_any_element()
});
let button = button.children(Itertools::intersperse_with(breadcrumbs, || { element.child(
Label::new(" ").into_any_element() ButtonLike::new("toggle outline view")
})); .style(ButtonStyle::Subtle)
.child(h_stack().gap_1().children(breadcrumbs))
if not_editor || !self.pane_focused { // We disable the button when it is not focused
return button.into_element(); // due to ... @julia what was the reason again?
} .disabled(!self.pane_focused)
// let this = cx.view().downgrade();
button
.style(ButtonStyle::Filled)
.disabled(false)
.on_click(move |_, _cx| { .on_click(move |_, _cx| {
todo!("outline::toggle"); todo!("outline::toggle");
// this.update(cx, |this, cx| { // this.update(cx, |this, cx| {
@ -82,8 +79,8 @@ impl Render for Breadcrumbs {
// } // }
// }) // })
// .ok(); // .ok();
}) }),
.into_element() )
} }
} }

View file

@ -3,7 +3,7 @@ authors = ["Nathan Sobo <nathan@zed.dev>"]
default-run = "collab" default-run = "collab"
edition = "2021" edition = "2021"
name = "collab" name = "collab"
version = "0.29.1" version = "0.30.0"
publish = false publish = false
[[bin]] [[bin]]

View file

@ -81,7 +81,7 @@ settings = { package = "settings2", path = "../settings2", features = ["test-sup
theme = { package = "theme2", path = "../theme2" } theme = { package = "theme2", path = "../theme2" }
workspace = { package = "workspace2", path = "../workspace2", features = ["test-support"] } workspace = { package = "workspace2", path = "../workspace2", features = ["test-support"] }
collab_ui = { path = "../collab_ui", features = ["test-support"] } collab_ui = { path = "../collab_ui2", package = "collab_ui2", features = ["test-support"] }
async-trait.workspace = true async-trait.workspace = true
pretty_assertions.workspace = true pretty_assertions.workspace = true

File diff suppressed because it is too large Load diff

View file

@ -13,7 +13,7 @@ use client::{
use collections::{HashMap, HashSet}; use collections::{HashMap, HashSet};
use fs::FakeFs; use fs::FakeFs;
use futures::{channel::oneshot, StreamExt as _}; use futures::{channel::oneshot, StreamExt as _};
use gpui::{BackgroundExecutor, Context, Model, TestAppContext, WindowHandle}; use gpui::{BackgroundExecutor, Context, Model, TestAppContext, View, VisualTestContext};
use language::LanguageRegistry; use language::LanguageRegistry;
use node_runtime::FakeNodeRuntime; use node_runtime::FakeNodeRuntime;
@ -602,14 +602,12 @@ impl TestClient {
.unwrap() .unwrap()
} }
//todo(workspace) pub fn build_workspace<'a>(
#[allow(dead_code)] &'a self,
pub fn build_workspace(
&self,
project: &Model<Project>, project: &Model<Project>,
cx: &mut TestAppContext, cx: &'a mut TestAppContext,
) -> WindowHandle<Workspace> { ) -> (View<Workspace>, &'a mut VisualTestContext) {
cx.add_window(|cx| Workspace::new(0, project.clone(), self.app_state.clone(), cx)) cx.add_window_view(|cx| Workspace::new(0, project.clone(), self.app_state.clone(), cx))
} }
} }

View file

@ -41,7 +41,7 @@ notifications = { package = "notifications2", path = "../notifications2" }
rich_text = { package = "rich_text2", path = "../rich_text2" } rich_text = { package = "rich_text2", path = "../rich_text2" }
picker = { package = "picker2", path = "../picker2" } picker = { package = "picker2", path = "../picker2" }
project = { package = "project2", path = "../project2" } project = { package = "project2", path = "../project2" }
# recent_projects = { path = "../recent_projects" } recent_projects = { package = "recent_projects2", path = "../recent_projects2" }
rpc = { package ="rpc2", path = "../rpc2" } rpc = { package ="rpc2", path = "../rpc2" }
settings = { package = "settings2", path = "../settings2" } settings = { package = "settings2", path = "../settings2" }
feature_flags = { package = "feature_flags2", path = "../feature_flags2"} feature_flags = { package = "feature_flags2", path = "../feature_flags2"}

View file

@ -1,454 +1,444 @@
// use anyhow::{anyhow, Result}; use anyhow::Result;
// use call::report_call_event_for_channel; use call::report_call_event_for_channel;
// use channel::{Channel, ChannelBuffer, ChannelBufferEvent, ChannelId, ChannelStore}; use channel::{Channel, ChannelBuffer, ChannelBufferEvent, ChannelId, ChannelStore};
// use client::{ use client::{
// proto::{self, PeerId}, proto::{self, PeerId},
// Collaborator, ParticipantIndex, Collaborator, ParticipantIndex,
// }; };
// use collections::HashMap; use collections::HashMap;
// use editor::{CollaborationHub, Editor}; use editor::{CollaborationHub, Editor, EditorEvent};
// use gpui::{ use gpui::{
// actions, actions, AnyElement, AnyView, AppContext, Entity as _, EventEmitter, FocusableView,
// elements::{ChildView, Label}, IntoElement as _, Model, Pixels, Point, Render, Subscription, Task, View, ViewContext,
// geometry::vector::Vector2F, VisualContext as _, WindowContext,
// AnyElement, AnyViewHandle, AppContext, Element, Entity, ModelHandle, Subscription, Task, View, };
// ViewContext, ViewHandle, use project::Project;
// }; use std::{
// use project::Project; any::{Any, TypeId},
// use smallvec::SmallVec; sync::Arc,
// use std::{ };
// any::{Any, TypeId}, use ui::Label;
// sync::Arc, use util::ResultExt;
// }; use workspace::{
// use util::ResultExt; item::{FollowableItem, Item, ItemEvent, ItemHandle},
// use workspace::{ register_followable_item,
// item::{FollowableItem, Item, ItemEvent, ItemHandle}, searchable::SearchableItemHandle,
// register_followable_item, ItemNavHistory, Pane, SaveIntent, ViewId, Workspace, WorkspaceId,
// searchable::SearchableItemHandle, };
// ItemNavHistory, Pane, SaveIntent, ViewId, Workspace, WorkspaceId,
// };
// actions!(channel_view, [Deploy]); actions!(Deploy);
// pub fn init(cx: &mut AppContext) { pub fn init(cx: &mut AppContext) {
// register_followable_item::<ChannelView>(cx) register_followable_item::<ChannelView>(cx)
// } }
// pub struct ChannelView { pub struct ChannelView {
// pub editor: ViewHandle<Editor>, pub editor: View<Editor>,
// project: ModelHandle<Project>, project: Model<Project>,
// channel_store: ModelHandle<ChannelStore>, channel_store: Model<ChannelStore>,
// channel_buffer: ModelHandle<ChannelBuffer>, channel_buffer: Model<ChannelBuffer>,
// remote_id: Option<ViewId>, remote_id: Option<ViewId>,
// _editor_event_subscription: Subscription, _editor_event_subscription: Subscription,
// } }
// impl ChannelView { impl ChannelView {
// pub fn open( pub fn open(
// channel_id: ChannelId, channel_id: ChannelId,
// workspace: ViewHandle<Workspace>, workspace: View<Workspace>,
// cx: &mut AppContext, cx: &mut WindowContext,
// ) -> Task<Result<ViewHandle<Self>>> { ) -> Task<Result<View<Self>>> {
// let pane = workspace.read(cx).active_pane().clone(); let pane = workspace.read(cx).active_pane().clone();
// let channel_view = Self::open_in_pane(channel_id, pane.clone(), workspace.clone(), cx); let channel_view = Self::open_in_pane(channel_id, pane.clone(), workspace.clone(), cx);
// cx.spawn(|mut cx| async move { cx.spawn(|mut cx| async move {
// let channel_view = channel_view.await?; let channel_view = channel_view.await?;
// pane.update(&mut cx, |pane, cx| { pane.update(&mut cx, |pane, cx| {
// report_call_event_for_channel( report_call_event_for_channel(
// "open channel notes", "open channel notes",
// channel_id, channel_id,
// &workspace.read(cx).app_state().client, &workspace.read(cx).app_state().client,
// cx, cx,
// ); );
// pane.add_item(Box::new(channel_view.clone()), true, true, None, cx); pane.add_item(Box::new(channel_view.clone()), true, true, None, cx);
// }); })?;
// anyhow::Ok(channel_view) anyhow::Ok(channel_view)
// }) })
// } }
// pub fn open_in_pane( pub fn open_in_pane(
// channel_id: ChannelId, channel_id: ChannelId,
// pane: ViewHandle<Pane>, pane: View<Pane>,
// workspace: ViewHandle<Workspace>, workspace: View<Workspace>,
// cx: &mut AppContext, cx: &mut WindowContext,
// ) -> Task<Result<ViewHandle<Self>>> { ) -> Task<Result<View<Self>>> {
// let workspace = workspace.read(cx); let workspace = workspace.read(cx);
// let project = workspace.project().to_owned(); let project = workspace.project().to_owned();
// let channel_store = ChannelStore::global(cx); let channel_store = ChannelStore::global(cx);
// let language_registry = workspace.app_state().languages.clone(); let language_registry = workspace.app_state().languages.clone();
// let markdown = language_registry.language_for_name("Markdown"); let markdown = language_registry.language_for_name("Markdown");
// let channel_buffer = let channel_buffer =
// channel_store.update(cx, |store, cx| store.open_channel_buffer(channel_id, cx)); channel_store.update(cx, |store, cx| store.open_channel_buffer(channel_id, cx));
// cx.spawn(|mut cx| async move { cx.spawn(|mut cx| async move {
// let channel_buffer = channel_buffer.await?; let channel_buffer = channel_buffer.await?;
// let markdown = markdown.await.log_err(); let markdown = markdown.await.log_err();
// channel_buffer.update(&mut cx, |buffer, cx| { channel_buffer.update(&mut cx, |buffer, cx| {
// buffer.buffer().update(cx, |buffer, cx| { buffer.buffer().update(cx, |buffer, cx| {
// buffer.set_language_registry(language_registry); buffer.set_language_registry(language_registry);
// if let Some(markdown) = markdown { if let Some(markdown) = markdown {
// buffer.set_language(Some(markdown), cx); buffer.set_language(Some(markdown), cx);
// } }
// }) })
// }); })?;
// pane.update(&mut cx, |pane, cx| { pane.update(&mut cx, |pane, cx| {
// let buffer_id = channel_buffer.read(cx).remote_id(cx); let buffer_id = channel_buffer.read(cx).remote_id(cx);
// let existing_view = pane let existing_view = pane
// .items_of_type::<Self>() .items_of_type::<Self>()
// .find(|view| view.read(cx).channel_buffer.read(cx).remote_id(cx) == buffer_id); .find(|view| view.read(cx).channel_buffer.read(cx).remote_id(cx) == buffer_id);
// // If this channel buffer is already open in this pane, just return it. // If this channel buffer is already open in this pane, just return it.
// if let Some(existing_view) = existing_view.clone() { if let Some(existing_view) = existing_view.clone() {
// if existing_view.read(cx).channel_buffer == channel_buffer { if existing_view.read(cx).channel_buffer == channel_buffer {
// return existing_view; return existing_view;
// } }
// } }
// let view = cx.add_view(|cx| { let view = cx.build_view(|cx| {
// let mut this = Self::new(project, channel_store, channel_buffer, cx); let mut this = Self::new(project, channel_store, channel_buffer, cx);
// this.acknowledge_buffer_version(cx); this.acknowledge_buffer_version(cx);
// this this
// }); });
// // If the pane contained a disconnected view for this channel buffer, // If the pane contained a disconnected view for this channel buffer,
// // replace that. // replace that.
// if let Some(existing_item) = existing_view { if let Some(existing_item) = existing_view {
// if let Some(ix) = pane.index_for_item(&existing_item) { if let Some(ix) = pane.index_for_item(&existing_item) {
// pane.close_item_by_id(existing_item.id(), SaveIntent::Skip, cx) pane.close_item_by_id(existing_item.entity_id(), SaveIntent::Skip, cx)
// .detach(); .detach();
// pane.add_item(Box::new(view.clone()), true, true, Some(ix), cx); pane.add_item(Box::new(view.clone()), true, true, Some(ix), cx);
// } }
// } }
// view view
// }) })
// .ok_or_else(|| anyhow!("pane was dropped")) })
// }) }
// }
// pub fn new( pub fn new(
// project: ModelHandle<Project>, project: Model<Project>,
// channel_store: ModelHandle<ChannelStore>, channel_store: Model<ChannelStore>,
// channel_buffer: ModelHandle<ChannelBuffer>, channel_buffer: Model<ChannelBuffer>,
// cx: &mut ViewContext<Self>, cx: &mut ViewContext<Self>,
// ) -> Self { ) -> Self {
// let buffer = channel_buffer.read(cx).buffer(); let buffer = channel_buffer.read(cx).buffer();
// let editor = cx.add_view(|cx| { let editor = cx.build_view(|cx| {
// let mut editor = Editor::for_buffer(buffer, None, cx); let mut editor = Editor::for_buffer(buffer, None, cx);
// editor.set_collaboration_hub(Box::new(ChannelBufferCollaborationHub( editor.set_collaboration_hub(Box::new(ChannelBufferCollaborationHub(
// channel_buffer.clone(), channel_buffer.clone(),
// ))); )));
// editor.set_read_only( editor.set_read_only(
// !channel_buffer !channel_buffer
// .read(cx) .read(cx)
// .channel(cx) .channel(cx)
// .is_some_and(|c| c.can_edit_notes()), .is_some_and(|c| c.can_edit_notes()),
// ); );
// editor editor
// }); });
// let _editor_event_subscription = cx.subscribe(&editor, |_, _, e, cx| cx.emit(e.clone())); let _editor_event_subscription =
cx.subscribe(&editor, |_, _, e: &EditorEvent, cx| cx.emit(e.clone()));
// cx.subscribe(&channel_buffer, Self::handle_channel_buffer_event) cx.subscribe(&channel_buffer, Self::handle_channel_buffer_event)
// .detach(); .detach();
// Self { Self {
// editor, editor,
// project, project,
// channel_store, channel_store,
// channel_buffer, channel_buffer,
// remote_id: None, remote_id: None,
// _editor_event_subscription, _editor_event_subscription,
// } }
// } }
// pub fn channel(&self, cx: &AppContext) -> Option<Arc<Channel>> { pub fn channel(&self, cx: &AppContext) -> Option<Arc<Channel>> {
// self.channel_buffer.read(cx).channel(cx) self.channel_buffer.read(cx).channel(cx)
// } }
// fn handle_channel_buffer_event( fn handle_channel_buffer_event(
// &mut self, &mut self,
// _: ModelHandle<ChannelBuffer>, _: Model<ChannelBuffer>,
// event: &ChannelBufferEvent, event: &ChannelBufferEvent,
// cx: &mut ViewContext<Self>, cx: &mut ViewContext<Self>,
// ) { ) {
// match event { match event {
// ChannelBufferEvent::Disconnected => self.editor.update(cx, |editor, cx| { ChannelBufferEvent::Disconnected => self.editor.update(cx, |editor, cx| {
// editor.set_read_only(true); editor.set_read_only(true);
// cx.notify(); cx.notify();
// }), }),
// ChannelBufferEvent::ChannelChanged => { ChannelBufferEvent::ChannelChanged => {
// self.editor.update(cx, |editor, cx| { self.editor.update(cx, |editor, cx| {
// editor.set_read_only(!self.channel(cx).is_some_and(|c| c.can_edit_notes())); editor.set_read_only(!self.channel(cx).is_some_and(|c| c.can_edit_notes()));
// cx.emit(editor::Event::TitleChanged); cx.emit(editor::EditorEvent::TitleChanged);
// cx.notify() cx.notify()
// }); });
// } }
// ChannelBufferEvent::BufferEdited => { ChannelBufferEvent::BufferEdited => {
// if cx.is_self_focused() || self.editor.is_focused(cx) { if self.editor.read(cx).is_focused(cx) {
// self.acknowledge_buffer_version(cx); self.acknowledge_buffer_version(cx);
// } else { } else {
// self.channel_store.update(cx, |store, cx| { self.channel_store.update(cx, |store, cx| {
// let channel_buffer = self.channel_buffer.read(cx); let channel_buffer = self.channel_buffer.read(cx);
// store.notes_changed( store.notes_changed(
// channel_buffer.channel_id, channel_buffer.channel_id,
// channel_buffer.epoch(), channel_buffer.epoch(),
// &channel_buffer.buffer().read(cx).version(), &channel_buffer.buffer().read(cx).version(),
// cx, cx,
// ) )
// }); });
// } }
// } }
// ChannelBufferEvent::CollaboratorsChanged => {} ChannelBufferEvent::CollaboratorsChanged => {}
// } }
// } }
// fn acknowledge_buffer_version(&mut self, cx: &mut ViewContext<'_, '_, ChannelView>) { fn acknowledge_buffer_version(&mut self, cx: &mut ViewContext<ChannelView>) {
// self.channel_store.update(cx, |store, cx| { self.channel_store.update(cx, |store, cx| {
// let channel_buffer = self.channel_buffer.read(cx); let channel_buffer = self.channel_buffer.read(cx);
// store.acknowledge_notes_version( store.acknowledge_notes_version(
// channel_buffer.channel_id, channel_buffer.channel_id,
// channel_buffer.epoch(), channel_buffer.epoch(),
// &channel_buffer.buffer().read(cx).version(), &channel_buffer.buffer().read(cx).version(),
// cx, cx,
// ) )
// }); });
// self.channel_buffer.update(cx, |buffer, cx| { self.channel_buffer.update(cx, |buffer, cx| {
// buffer.acknowledge_buffer_version(cx); buffer.acknowledge_buffer_version(cx);
// }); });
// } }
// } }
// impl Entity for ChannelView { impl EventEmitter<EditorEvent> for ChannelView {}
// type Event = editor::Event;
// }
// impl View for ChannelView { impl Render for ChannelView {
// fn ui_name() -> &'static str { type Element = AnyView;
// "ChannelView"
// }
// fn render(&mut self, cx: &mut ViewContext<Self>) -> AnyElement<Self> { fn render(&mut self, _cx: &mut ViewContext<Self>) -> Self::Element {
// ChildView::new(self.editor.as_any(), cx).into_any() self.editor.clone().into()
// } }
}
// fn focus_in(&mut self, _: AnyViewHandle, cx: &mut ViewContext<Self>) { impl FocusableView for ChannelView {
// if cx.is_self_focused() { fn focus_handle(&self, cx: &AppContext) -> gpui::FocusHandle {
// self.acknowledge_buffer_version(cx); self.editor.read(cx).focus_handle(cx)
// cx.focus(self.editor.as_any()) }
// } }
// }
// }
// impl Item for ChannelView { impl Item for ChannelView {
// fn act_as_type<'a>( type Event = EditorEvent;
// &'a self,
// type_id: TypeId,
// self_handle: &'a ViewHandle<Self>,
// _: &'a AppContext,
// ) -> Option<&'a AnyViewHandle> {
// if type_id == TypeId::of::<Self>() {
// Some(self_handle)
// } else if type_id == TypeId::of::<Editor>() {
// Some(&self.editor)
// } else {
// None
// }
// }
// fn tab_content<V: 'static>( fn act_as_type<'a>(
// &self, &'a self,
// _: Option<usize>, type_id: TypeId,
// style: &theme::Tab, self_handle: &'a View<Self>,
// cx: &gpui::AppContext, _: &'a AppContext,
// ) -> AnyElement<V> { ) -> Option<AnyView> {
// let label = if let Some(channel) = self.channel(cx) { if type_id == TypeId::of::<Self>() {
// match ( Some(self_handle.to_any())
// channel.can_edit_notes(), } else if type_id == TypeId::of::<Editor>() {
// self.channel_buffer.read(cx).is_connected(), Some(self.editor.to_any())
// ) { } else {
// (true, true) => format!("#{}", channel.name), None
// (false, true) => format!("#{} (read-only)", channel.name), }
// (_, false) => format!("#{} (disconnected)", channel.name), }
// }
// } else {
// format!("channel notes (disconnected)")
// };
// Label::new(label, style.label.to_owned()).into_any()
// }
// fn clone_on_split(&self, _: WorkspaceId, cx: &mut ViewContext<Self>) -> Option<Self> { fn tab_content(&self, _: Option<usize>, cx: &WindowContext) -> AnyElement {
// Some(Self::new( let label = if let Some(channel) = self.channel(cx) {
// self.project.clone(), match (
// self.channel_store.clone(), channel.can_edit_notes(),
// self.channel_buffer.clone(), self.channel_buffer.read(cx).is_connected(),
// cx, ) {
// )) (true, true) => format!("#{}", channel.name),
// } (false, true) => format!("#{} (read-only)", channel.name),
(_, false) => format!("#{} (disconnected)", channel.name),
}
} else {
format!("channel notes (disconnected)")
};
Label::new(label).into_any_element()
}
// fn is_singleton(&self, _cx: &AppContext) -> bool { fn clone_on_split(&self, _: WorkspaceId, cx: &mut ViewContext<Self>) -> Option<View<Self>> {
// false Some(cx.build_view(|cx| {
// } Self::new(
self.project.clone(),
self.channel_store.clone(),
self.channel_buffer.clone(),
cx,
)
}))
}
// fn navigate(&mut self, data: Box<dyn Any>, cx: &mut ViewContext<Self>) -> bool { fn is_singleton(&self, _cx: &AppContext) -> bool {
// self.editor false
// .update(cx, |editor, cx| editor.navigate(data, cx)) }
// }
// fn deactivated(&mut self, cx: &mut ViewContext<Self>) { fn navigate(&mut self, data: Box<dyn Any>, cx: &mut ViewContext<Self>) -> bool {
// self.editor self.editor
// .update(cx, |editor, cx| Item::deactivated(editor, cx)) .update(cx, |editor, cx| editor.navigate(data, cx))
// } }
// fn set_nav_history(&mut self, history: ItemNavHistory, cx: &mut ViewContext<Self>) { fn deactivated(&mut self, cx: &mut ViewContext<Self>) {
// self.editor self.editor
// .update(cx, |editor, cx| Item::set_nav_history(editor, history, cx)) .update(cx, |editor, cx| Item::deactivated(editor, cx))
// } }
// fn as_searchable(&self, _: &ViewHandle<Self>) -> Option<Box<dyn SearchableItemHandle>> { fn set_nav_history(&mut self, history: ItemNavHistory, cx: &mut ViewContext<Self>) {
// Some(Box::new(self.editor.clone())) self.editor
// } .update(cx, |editor, cx| Item::set_nav_history(editor, history, cx))
}
// fn show_toolbar(&self) -> bool { fn as_searchable(&self, _: &View<Self>) -> Option<Box<dyn SearchableItemHandle>> {
// true Some(Box::new(self.editor.clone()))
// } }
// fn pixel_position_of_cursor(&self, cx: &AppContext) -> Option<Vector2F> { fn show_toolbar(&self) -> bool {
// self.editor.read(cx).pixel_position_of_cursor(cx) true
// } }
// fn to_item_events(event: &Self::Event) -> SmallVec<[ItemEvent; 2]> { fn pixel_position_of_cursor(&self, cx: &AppContext) -> Option<Point<Pixels>> {
// editor::Editor::to_item_events(event) self.editor.read(cx).pixel_position_of_cursor(cx)
// } }
// }
// impl FollowableItem for ChannelView { fn to_item_events(event: &EditorEvent, f: impl FnMut(ItemEvent)) {
// fn remote_id(&self) -> Option<workspace::ViewId> { Editor::to_item_events(event, f)
// self.remote_id }
// } }
// fn to_state_proto(&self, cx: &AppContext) -> Option<proto::view::Variant> { impl FollowableItem for ChannelView {
// let channel_buffer = self.channel_buffer.read(cx); fn remote_id(&self) -> Option<workspace::ViewId> {
// if !channel_buffer.is_connected() { self.remote_id
// return None; }
// }
// Some(proto::view::Variant::ChannelView( fn to_state_proto(&self, cx: &WindowContext) -> Option<proto::view::Variant> {
// proto::view::ChannelView { let channel_buffer = self.channel_buffer.read(cx);
// channel_id: channel_buffer.channel_id, if !channel_buffer.is_connected() {
// editor: if let Some(proto::view::Variant::Editor(proto)) = return None;
// self.editor.read(cx).to_state_proto(cx) }
// {
// Some(proto)
// } else {
// None
// },
// },
// ))
// }
// fn from_state_proto( Some(proto::view::Variant::ChannelView(
// pane: ViewHandle<workspace::Pane>, proto::view::ChannelView {
// workspace: ViewHandle<workspace::Workspace>, channel_id: channel_buffer.channel_id,
// remote_id: workspace::ViewId, editor: if let Some(proto::view::Variant::Editor(proto)) =
// state: &mut Option<proto::view::Variant>, self.editor.read(cx).to_state_proto(cx)
// cx: &mut AppContext, {
// ) -> Option<gpui::Task<anyhow::Result<ViewHandle<Self>>>> { Some(proto)
// let Some(proto::view::Variant::ChannelView(_)) = state else { } else {
// return None; None
// }; },
// let Some(proto::view::Variant::ChannelView(state)) = state.take() else { },
// unreachable!() ))
// }; }
// let open = ChannelView::open_in_pane(state.channel_id, pane, workspace, cx); fn from_state_proto(
pane: View<workspace::Pane>,
workspace: View<workspace::Workspace>,
remote_id: workspace::ViewId,
state: &mut Option<proto::view::Variant>,
cx: &mut WindowContext,
) -> Option<gpui::Task<anyhow::Result<View<Self>>>> {
let Some(proto::view::Variant::ChannelView(_)) = state else {
return None;
};
let Some(proto::view::Variant::ChannelView(state)) = state.take() else {
unreachable!()
};
// Some(cx.spawn(|mut cx| async move { let open = ChannelView::open_in_pane(state.channel_id, pane, workspace, cx);
// let this = open.await?;
// let task = this Some(cx.spawn(|mut cx| async move {
// .update(&mut cx, |this, cx| { let this = open.await?;
// this.remote_id = Some(remote_id);
// if let Some(state) = state.editor { let task = this.update(&mut cx, |this, cx| {
// Some(this.editor.update(cx, |editor, cx| { this.remote_id = Some(remote_id);
// editor.apply_update_proto(
// &this.project,
// proto::update_view::Variant::Editor(proto::update_view::Editor {
// selections: state.selections,
// pending_selection: state.pending_selection,
// scroll_top_anchor: state.scroll_top_anchor,
// scroll_x: state.scroll_x,
// scroll_y: state.scroll_y,
// ..Default::default()
// }),
// cx,
// )
// }))
// } else {
// None
// }
// })
// .ok_or_else(|| anyhow!("window was closed"))?;
// if let Some(task) = task { if let Some(state) = state.editor {
// task.await?; Some(this.editor.update(cx, |editor, cx| {
// } editor.apply_update_proto(
&this.project,
proto::update_view::Variant::Editor(proto::update_view::Editor {
selections: state.selections,
pending_selection: state.pending_selection,
scroll_top_anchor: state.scroll_top_anchor,
scroll_x: state.scroll_x,
scroll_y: state.scroll_y,
..Default::default()
}),
cx,
)
}))
} else {
None
}
})?;
// Ok(this) if let Some(task) = task {
// })) task.await?;
// } }
// fn add_event_to_update_proto( Ok(this)
// &self, }))
// event: &Self::Event, }
// update: &mut Option<proto::update_view::Variant>,
// cx: &AppContext,
// ) -> bool {
// self.editor
// .read(cx)
// .add_event_to_update_proto(event, update, cx)
// }
// fn apply_update_proto( fn add_event_to_update_proto(
// &mut self, &self,
// project: &ModelHandle<Project>, event: &EditorEvent,
// message: proto::update_view::Variant, update: &mut Option<proto::update_view::Variant>,
// cx: &mut ViewContext<Self>, cx: &WindowContext,
// ) -> gpui::Task<anyhow::Result<()>> { ) -> bool {
// self.editor.update(cx, |editor, cx| { self.editor
// editor.apply_update_proto(project, message, cx) .read(cx)
// }) .add_event_to_update_proto(event, update, cx)
// } }
// fn set_leader_peer_id(&mut self, leader_peer_id: Option<PeerId>, cx: &mut ViewContext<Self>) { fn apply_update_proto(
// self.editor.update(cx, |editor, cx| { &mut self,
// editor.set_leader_peer_id(leader_peer_id, cx) project: &Model<Project>,
// }) message: proto::update_view::Variant,
// } cx: &mut ViewContext<Self>,
) -> gpui::Task<anyhow::Result<()>> {
self.editor.update(cx, |editor, cx| {
editor.apply_update_proto(project, message, cx)
})
}
// fn should_unfollow_on_event(event: &Self::Event, cx: &AppContext) -> bool { fn set_leader_peer_id(&mut self, leader_peer_id: Option<PeerId>, cx: &mut ViewContext<Self>) {
// Editor::should_unfollow_on_event(event, cx) self.editor.update(cx, |editor, cx| {
// } editor.set_leader_peer_id(leader_peer_id, cx)
})
}
// fn is_project_item(&self, _cx: &AppContext) -> bool { fn is_project_item(&self, _cx: &WindowContext) -> bool {
// false false
// } }
// }
// struct ChannelBufferCollaborationHub(ModelHandle<ChannelBuffer>); fn to_follow_event(event: &Self::Event) -> Option<workspace::item::FollowEvent> {
Editor::to_follow_event(event)
}
}
// impl CollaborationHub for ChannelBufferCollaborationHub { struct ChannelBufferCollaborationHub(Model<ChannelBuffer>);
// fn collaborators<'a>(&self, cx: &'a AppContext) -> &'a HashMap<PeerId, Collaborator> {
// self.0.read(cx).collaborators()
// }
// fn user_participant_indices<'a>( impl CollaborationHub for ChannelBufferCollaborationHub {
// &self, fn collaborators<'a>(&self, cx: &'a AppContext) -> &'a HashMap<PeerId, Collaborator> {
// cx: &'a AppContext, self.0.read(cx).collaborators()
// ) -> &'a HashMap<u64, ParticipantIndex> { }
// self.0.read(cx).user_store().read(cx).participant_indices()
// } fn user_participant_indices<'a>(
// } &self,
cx: &'a AppContext,
) -> &'a HashMap<u64, ParticipantIndex> {
self.0.read(cx).user_store().read(cx).participant_indices()
}
}

View file

@ -169,7 +169,7 @@ use editor::Editor;
use feature_flags::{ChannelsAlpha, FeatureFlagAppExt, FeatureFlagViewExt}; use feature_flags::{ChannelsAlpha, FeatureFlagAppExt, FeatureFlagViewExt};
use fuzzy::{match_strings, StringMatchCandidate}; use fuzzy::{match_strings, StringMatchCandidate};
use gpui::{ use gpui::{
actions, canvas, div, img, overlay, point, prelude::*, px, rems, serde_json, Action, actions, canvas, div, img, overlay, point, prelude::*, px, rems, serde_json, size, Action,
AppContext, AsyncWindowContext, Bounds, ClipboardItem, DismissEvent, Div, EventEmitter, AppContext, AsyncWindowContext, Bounds, ClipboardItem, DismissEvent, Div, EventEmitter,
FocusHandle, Focusable, FocusableView, Hsla, InteractiveElement, IntoElement, Length, Model, FocusHandle, Focusable, FocusableView, Hsla, InteractiveElement, IntoElement, Length, Model,
MouseDownEvent, ParentElement, Pixels, Point, PromptLevel, Quad, Render, RenderOnce, MouseDownEvent, ParentElement, Pixels, Point, PromptLevel, Quad, Render, RenderOnce,
@ -191,6 +191,7 @@ use workspace::{
Workspace, Workspace,
}; };
use crate::channel_view::ChannelView;
use crate::{face_pile::FacePile, CollaborationPanelSettings}; use crate::{face_pile::FacePile, CollaborationPanelSettings};
use self::channel_modal::ChannelModal; use self::channel_modal::ChannelModal;
@ -1204,14 +1205,9 @@ impl CollabPanel {
.detach_and_log_err(cx); .detach_and_log_err(cx);
}); });
})) }))
.left_child(IconButton::new(0, Icon::Folder)) .left_child(render_tree_branch(is_last, cx))
.child( .child(IconButton::new(0, Icon::Folder))
h_stack() .child(Label::new(project_name.clone()))
.w_full()
.justify_between()
.child(render_tree_branch(is_last, cx))
.child(Label::new(project_name.clone())),
)
.tooltip(move |cx| Tooltip::text(format!("Open {}", project_name), cx)) .tooltip(move |cx| Tooltip::text(format!("Open {}", project_name), cx))
// enum JoinProject {} // enum JoinProject {}
@ -1299,70 +1295,20 @@ impl CollabPanel {
is_last: bool, is_last: bool,
cx: &mut ViewContext<Self>, cx: &mut ViewContext<Self>,
) -> impl IntoElement { ) -> impl IntoElement {
// enum OpenSharedScreen {} let id = peer_id.map_or(usize::MAX, |id| id.as_u64() as usize);
// let host_avatar_width = theme ListItem::new(("screen", id))
// .contact_avatar .left_child(render_tree_branch(is_last, cx))
// .width .child(IconButton::new(0, Icon::Screen))
// .or(theme.contact_avatar.height) .child(Label::new("Screen"))
// .unwrap_or(0.); .when_some(peer_id, |this, _| {
// let tree_branch = theme.tree_branch; this.on_click(cx.listener(move |this, _, cx| {
this.workspace.update(cx, |workspace, cx| {
// let handler = MouseEventHandler::new::<OpenSharedScreen, _>( workspace.open_shared_screen(peer_id.unwrap(), cx)
// peer_id.map(|id| id.as_u64()).unwrap_or(0) as usize, });
// cx, }))
// |mouse_state, cx| { .tooltip(move |cx| Tooltip::text(format!("Open shared screen"), cx))
// let tree_branch = *tree_branch.in_state(is_selected).style_for(mouse_state); })
// let row = theme
// .project_row
// .in_state(is_selected)
// .style_for(mouse_state);
// Flex::row()
// .with_child(render_tree_branch(
// tree_branch,
// &row.name.text,
// is_last,
// vec2f(host_avatar_width, theme.row_height),
// cx.font_cache(),
// ))
// .with_child(
// Svg::new("icons/desktop.svg")
// .with_color(theme.channel_hash.color)
// .constrained()
// .with_width(theme.channel_hash.width)
// .aligned()
// .left(),
// )
// .with_child(
// Label::new("Screen", row.name.text.clone())
// .aligned()
// .left()
// .contained()
// .with_style(row.name.container)
// .flex(1., false),
// )
// .constrained()
// .with_height(theme.row_height)
// .contained()
// .with_style(row.container)
// },
// );
// if peer_id.is_none() {
// return handler.into_any();
// }
// handler
// .with_cursor_style(CursorStyle::PointingHand)
// .on_click(MouseButton::Left, move |_, this, cx| {
// if let Some(workspace) = this.workspace.upgrade(cx) {
// workspace.update(cx, |workspace, cx| {
// workspace.open_shared_screen(peer_id.unwrap(), cx)
// });
// }
// })
// .into_any()
div()
} }
fn take_editing_state(&mut self, cx: &mut ViewContext<Self>) -> bool { fn take_editing_state(&mut self, cx: &mut ViewContext<Self>) -> bool {
@ -1415,54 +1361,14 @@ impl CollabPanel {
channel_id: ChannelId, channel_id: ChannelId,
cx: &mut ViewContext<Self>, cx: &mut ViewContext<Self>,
) -> impl IntoElement { ) -> impl IntoElement {
// enum ChannelNotes {} ListItem::new("channel-notes")
// let host_avatar_width = theme .on_click(cx.listener(move |this, _, cx| {
// .contact_avatar this.open_channel_notes(channel_id, cx);
// .width }))
// .or(theme.contact_avatar.height) .left_child(render_tree_branch(false, cx))
// .unwrap_or(0.); .child(IconButton::new(0, Icon::File))
.child(Label::new("notes"))
// MouseEventHandler::new::<ChannelNotes, _>(ix as usize, cx, |state, cx| { .tooltip(move |cx| Tooltip::text("Open Channel Notes", cx))
// let tree_branch = *theme.tree_branch.in_state(is_selected).style_for(state);
// let row = theme.project_row.in_state(is_selected).style_for(state);
// Flex::<Self>::row()
// .with_child(render_tree_branch(
// tree_branch,
// &row.name.text,
// false,
// vec2f(host_avatar_width, theme.row_height),
// cx.font_cache(),
// ))
// .with_child(
// Svg::new("icons/file.svg")
// .with_color(theme.channel_hash.color)
// .constrained()
// .with_width(theme.channel_hash.width)
// .aligned()
// .left(),
// )
// .with_child(
// Label::new("notes", theme.channel_name.text.clone())
// .contained()
// .with_style(theme.channel_name.container)
// .aligned()
// .left()
// .flex(1., true),
// )
// .constrained()
// .with_height(theme.row_height)
// .contained()
// .with_style(*theme.channel_row.style_for(is_selected, state))
// .with_padding_left(theme.channel_row.default_style().padding.left)
// })
// .on_click(MouseButton::Left, move |_, this, cx| {
// this.open_channel_notes(&OpenChannelNotes { channel_id }, cx);
// })
// .with_cursor_style(CursorStyle::PointingHand)
// .into_any()
div()
} }
fn render_channel_chat( fn render_channel_chat(
@ -1470,53 +1376,14 @@ impl CollabPanel {
channel_id: ChannelId, channel_id: ChannelId,
cx: &mut ViewContext<Self>, cx: &mut ViewContext<Self>,
) -> impl IntoElement { ) -> impl IntoElement {
// enum ChannelChat {} ListItem::new("channel-chat")
// let host_avatar_width = theme .on_click(cx.listener(move |this, _, cx| {
// .contact_avatar this.join_channel_chat(channel_id, cx);
// .width }))
// .or(theme.contact_avatar.height) .left_child(render_tree_branch(true, cx))
// .unwrap_or(0.); .child(IconButton::new(0, Icon::MessageBubbles))
.child(Label::new("chat"))
// MouseEventHandler::new::<ChannelChat, _>(ix as usize, cx, |state, cx| { .tooltip(move |cx| Tooltip::text("Open Chat", cx))
// let tree_branch = *theme.tree_branch.in_state(is_selected).style_for(state);
// let row = theme.project_row.in_state(is_selected).style_for(state);
// Flex::<Self>::row()
// .with_child(render_tree_branch(
// tree_branch,
// &row.name.text,
// true,
// vec2f(host_avatar_width, theme.row_height),
// cx.font_cache(),
// ))
// .with_child(
// Svg::new("icons/conversations.svg")
// .with_color(theme.channel_hash.color)
// .constrained()
// .with_width(theme.channel_hash.width)
// .aligned()
// .left(),
// )
// .with_child(
// Label::new("chat", theme.channel_name.text.clone())
// .contained()
// .with_style(theme.channel_name.container)
// .aligned()
// .left()
// .flex(1., true),
// )
// .constrained()
// .with_height(theme.row_height)
// .contained()
// .with_style(*theme.channel_row.style_for(is_selected, state))
// .with_padding_left(theme.channel_row.default_style().padding.left)
// })
// .on_click(MouseButton::Left, move |_, this, cx| {
// this.join_channel_chat(&JoinChannelChat { channel_id }, cx);
// })
// .with_cursor_style(CursorStyle::PointingHand)
// .into_any()
div()
} }
// fn render_channel_invite( // fn render_channel_invite(
@ -2069,8 +1936,7 @@ impl CollabPanel {
fn open_channel_notes(&mut self, channel_id: ChannelId, cx: &mut ViewContext<Self>) { fn open_channel_notes(&mut self, channel_id: ChannelId, cx: &mut ViewContext<Self>) {
if let Some(workspace) = self.workspace.upgrade() { if let Some(workspace) = self.workspace.upgrade() {
todo!(); ChannelView::open(channel_id, workspace, cx).detach();
// ChannelView::open(action.channel_id, workspace, cx).detach();
} }
} }
@ -2753,6 +2619,9 @@ impl CollabPanel {
} else { } else {
Color::Muted Color::Muted
}) })
.on_click(cx.listener(move |this, _, cx| {
this.open_channel_notes(channel_id, cx)
}))
.tooltip(|cx| { .tooltip(|cx| {
Tooltip::text("Open channel notes", cx) Tooltip::text("Open channel notes", cx)
}), }),
@ -3119,30 +2988,24 @@ impl CollabPanel {
} }
fn render_tree_branch(is_last: bool, cx: &mut WindowContext) -> impl IntoElement { fn render_tree_branch(is_last: bool, cx: &mut WindowContext) -> impl IntoElement {
let text_style = cx.text_style();
let rem_size = cx.rem_size(); let rem_size = cx.rem_size();
let text_system = cx.text_system(); let line_height = cx.text_style().line_height_in_pixels(rem_size);
let font_id = text_system.font_id(&text_style.font()).unwrap(); let width = rem_size * 1.5;
let font_size = text_style.font_size.to_pixels(rem_size);
let line_height = text_style.line_height_in_pixels(rem_size);
let cap_height = text_system.cap_height(font_id, font_size);
let baseline_offset = text_system.baseline_offset(font_id, font_size, line_height);
let width = cx.rem_size() * 2.5;
let thickness = px(2.); let thickness = px(2.);
let color = cx.theme().colors().text; let color = cx.theme().colors().text;
canvas(move |bounds, cx| { canvas(move |bounds, cx| {
let start_x = bounds.left() + (bounds.size.width / 2.) - (width / 2.); let start_x = (bounds.left() + bounds.right() - thickness) / 2.;
let end_x = bounds.right(); let start_y = (bounds.top() + bounds.bottom() - thickness) / 2.;
let start_y = bounds.top(); let right = bounds.right();
let end_y = bounds.top() + baseline_offset - (cap_height / 2.); let top = bounds.top();
cx.paint_quad( cx.paint_quad(
Bounds::from_corners( Bounds::from_corners(
point(start_x, start_y), point(start_x, top),
point( point(
start_x + thickness, start_x + thickness,
if is_last { end_y } else { bounds.bottom() }, if is_last { start_y } else { bounds.bottom() },
), ),
), ),
Default::default(), Default::default(),
@ -3151,7 +3014,7 @@ fn render_tree_branch(is_last: bool, cx: &mut WindowContext) -> impl IntoElement
Hsla::transparent_black(), Hsla::transparent_black(),
); );
cx.paint_quad( cx.paint_quad(
Bounds::from_corners(point(start_x, end_y), point(end_x, end_y + thickness)), Bounds::from_corners(point(start_x, start_y), point(right, start_y + thickness)),
Default::default(), Default::default(),
color, color,
Default::default(), Default::default(),
@ -3344,10 +3207,6 @@ impl Panel for CollabPanel {
Box::new(ToggleFocus) Box::new(ToggleFocus)
} }
fn has_focus(&self, cx: &gpui::WindowContext) -> bool {
self.focus_handle.contains_focused(cx)
}
fn persistent_name() -> &'static str { fn persistent_name() -> &'static str {
"CollabPanel" "CollabPanel"
} }

View file

@ -33,6 +33,7 @@ pub fn init(app_state: &Arc<AppState>, cx: &mut AppContext) {
// vcs_menu::init(cx); // vcs_menu::init(cx);
collab_titlebar_item::init(cx); collab_titlebar_item::init(cx);
collab_panel::init(cx); collab_panel::init(cx);
channel_view::init(cx);
// chat_panel::init(cx); // chat_panel::init(cx);
notifications::init(&app_state, cx); notifications::init(&app_state, cx);

View file

@ -23,11 +23,13 @@ pub type HashMap<K, V> = std::collections::HashMap<K, V>;
#[cfg(not(feature = "test-support"))] #[cfg(not(feature = "test-support"))]
pub type HashSet<T> = std::collections::HashSet<T>; pub type HashSet<T> = std::collections::HashSet<T>;
use std::any::TypeId;
pub use std::collections::*; pub use std::collections::*;
// NEW TYPES // NEW TYPES
#[derive(Default)] #[derive(Default)]
pub struct CommandPaletteFilter { pub struct CommandPaletteFilter {
pub filtered_namespaces: HashSet<&'static str>, pub hidden_namespaces: HashSet<&'static str>,
pub hidden_action_types: HashSet<TypeId>,
} }

View file

@ -109,7 +109,7 @@ impl PickerDelegate for CommandPaletteDelegate {
let filtered = cx.read(|cx| { let filtered = cx.read(|cx| {
if cx.has_global::<CommandPaletteFilter>() { if cx.has_global::<CommandPaletteFilter>() {
let filter = cx.global::<CommandPaletteFilter>(); let filter = cx.global::<CommandPaletteFilter>();
filter.filtered_namespaces.contains(action.namespace()) filter.hidden_namespaces.contains(action.namespace())
} else { } else {
false false
} }
@ -430,7 +430,7 @@ mod tests {
// Add namespace filter, and redeploy the palette // Add namespace filter, and redeploy the palette
cx.update(|cx| { cx.update(|cx| {
cx.update_default_global::<CommandPaletteFilter, _, _>(|filter, _| { cx.update_default_global::<CommandPaletteFilter, _, _>(|filter, _| {
filter.filtered_namespaces.insert("editor"); filter.hidden_namespaces.insert("editor");
}) })
}); });

View file

@ -49,7 +49,10 @@ impl CommandPalette {
.filter_map(|action| { .filter_map(|action| {
let name = gpui::remove_the_2(action.name()); let name = gpui::remove_the_2(action.name());
let namespace = name.split("::").next().unwrap_or("malformed action name"); let namespace = name.split("::").next().unwrap_or("malformed action name");
if filter.is_some_and(|f| f.filtered_namespaces.contains(namespace)) { if filter.is_some_and(|f| {
f.hidden_namespaces.contains(namespace)
|| f.hidden_action_types.contains(&action.type_id())
}) {
return None; return None;
} }
@ -433,7 +436,7 @@ mod tests {
cx.update(|cx| { cx.update(|cx| {
cx.set_global(CommandPaletteFilter::default()); cx.set_global(CommandPaletteFilter::default());
cx.update_global::<CommandPaletteFilter, _>(|filter, _| { cx.update_global::<CommandPaletteFilter, _>(|filter, _| {
filter.filtered_namespaces.insert("editor"); filter.hidden_namespaces.insert("editor");
}) })
}); });

View file

@ -28,7 +28,7 @@ theme = { path = "../theme" }
lsp = { path = "../lsp" } lsp = { path = "../lsp" }
node_runtime = { path = "../node_runtime"} node_runtime = { path = "../node_runtime"}
util = { path = "../util" } util = { path = "../util" }
async-compression = { version = "0.3", features = ["gzip", "futures-bufread"] } async-compression.workspace = true
async-tar = "0.4.2" async-tar = "0.4.2"
anyhow.workspace = true anyhow.workspace = true
log.workspace = true log.workspace = true

View file

@ -58,16 +58,16 @@ pub fn init(
cx.update_default_global::<collections::CommandPaletteFilter, _, _>(move |filter, _cx| { cx.update_default_global::<collections::CommandPaletteFilter, _, _>(move |filter, _cx| {
match status { match status {
Status::Disabled => { Status::Disabled => {
filter.filtered_namespaces.insert(COPILOT_NAMESPACE); filter.hidden_namespaces.insert(COPILOT_NAMESPACE);
filter.filtered_namespaces.insert(COPILOT_AUTH_NAMESPACE); filter.hidden_namespaces.insert(COPILOT_AUTH_NAMESPACE);
} }
Status::Authorized => { Status::Authorized => {
filter.filtered_namespaces.remove(COPILOT_NAMESPACE); filter.hidden_namespaces.remove(COPILOT_NAMESPACE);
filter.filtered_namespaces.remove(COPILOT_AUTH_NAMESPACE); filter.hidden_namespaces.remove(COPILOT_AUTH_NAMESPACE);
} }
_ => { _ => {
filter.filtered_namespaces.insert(COPILOT_NAMESPACE); filter.hidden_namespaces.insert(COPILOT_NAMESPACE);
filter.filtered_namespaces.remove(COPILOT_AUTH_NAMESPACE); filter.hidden_namespaces.remove(COPILOT_AUTH_NAMESPACE);
} }
} }
}); });

View file

@ -28,7 +28,8 @@ theme = { package = "theme2", path = "../theme2" }
lsp = { package = "lsp2", path = "../lsp2" } lsp = { package = "lsp2", path = "../lsp2" }
node_runtime = { path = "../node_runtime"} node_runtime = { path = "../node_runtime"}
util = { path = "../util" } util = { path = "../util" }
async-compression = { version = "0.3", features = ["gzip", "futures-bufread"] } ui = { package = "ui2", path = "../ui2" }
async-compression.workspace = true
async-tar = "0.4.2" async-tar = "0.4.2"
anyhow.workspace = true anyhow.workspace = true
log.workspace = true log.workspace = true

View file

@ -22,6 +22,7 @@ use request::StatusNotification;
use settings::SettingsStore; use settings::SettingsStore;
use smol::{fs, io::BufReader, stream::StreamExt}; use smol::{fs, io::BufReader, stream::StreamExt};
use std::{ use std::{
any::TypeId,
ffi::OsString, ffi::OsString,
mem, mem,
ops::Range, ops::Range,
@ -32,13 +33,14 @@ use util::{
fs::remove_matching, github::latest_github_release, http::HttpClient, paths, ResultExt, fs::remove_matching, github::latest_github_release, http::HttpClient, paths, ResultExt,
}; };
// todo!() actions!(
// const COPILOT_AUTH_NAMESPACE: &'static str = "copilot_auth"; Suggest,
actions!(SignIn, SignOut); NextSuggestion,
PreviousSuggestion,
// todo!() Reinstall,
// const COPILOT_NAMESPACE: &'static str = "copilot"; SignIn,
actions!(Suggest, NextSuggestion, PreviousSuggestion, Reinstall); SignOut
);
pub fn init( pub fn init(
new_server_id: LanguageServerId, new_server_id: LanguageServerId,
@ -51,52 +53,70 @@ pub fn init(
move |cx| Copilot::start(new_server_id, http, node_runtime, cx) move |cx| Copilot::start(new_server_id, http, node_runtime, cx)
}); });
cx.set_global(copilot.clone()); cx.set_global(copilot.clone());
cx.observe(&copilot, |handle, cx| {
let copilot_action_types = [
TypeId::of::<Suggest>(),
TypeId::of::<NextSuggestion>(),
TypeId::of::<PreviousSuggestion>(),
TypeId::of::<Reinstall>(),
];
let copilot_auth_action_types = [TypeId::of::<SignOut>()];
let copilot_no_auth_action_types = [TypeId::of::<SignIn>()];
let status = handle.read(cx).status();
let filter = cx.default_global::<collections::CommandPaletteFilter>();
// TODO match status {
// cx.observe(&copilot, |handle, cx| { Status::Disabled => {
// let status = handle.read(cx).status(); filter.hidden_action_types.extend(copilot_action_types);
// cx.update_default_global::<collections::CommandPaletteFilter, _, _>(move |filter, _cx| { filter.hidden_action_types.extend(copilot_auth_action_types);
// match status { filter
// Status::Disabled => { .hidden_action_types
// filter.filtered_namespaces.insert(COPILOT_NAMESPACE); .extend(copilot_no_auth_action_types);
// filter.filtered_namespaces.insert(COPILOT_AUTH_NAMESPACE); }
// } Status::Authorized => {
// Status::Authorized => { filter
// filter.filtered_namespaces.remove(COPILOT_NAMESPACE); .hidden_action_types
// filter.filtered_namespaces.remove(COPILOT_AUTH_NAMESPACE); .extend(copilot_no_auth_action_types);
// } for type_id in copilot_action_types
// _ => { .iter()
// filter.filtered_namespaces.insert(COPILOT_NAMESPACE); .chain(&copilot_auth_action_types)
// filter.filtered_namespaces.remove(COPILOT_AUTH_NAMESPACE); {
// } filter.hidden_action_types.remove(type_id);
// } }
// }); }
// }) _ => {
// .detach(); filter.hidden_action_types.extend(copilot_action_types);
filter.hidden_action_types.extend(copilot_auth_action_types);
for type_id in &copilot_no_auth_action_types {
filter.hidden_action_types.remove(type_id);
}
}
}
})
.detach();
// sign_in::init(cx); sign_in::init(cx);
// cx.add_global_action(|_: &SignIn, cx| { cx.on_action(|_: &SignIn, cx| {
// if let Some(copilot) = Copilot::global(cx) { if let Some(copilot) = Copilot::global(cx) {
// copilot copilot
// .update(cx, |copilot, cx| copilot.sign_in(cx)) .update(cx, |copilot, cx| copilot.sign_in(cx))
// .detach_and_log_err(cx); .detach_and_log_err(cx);
// } }
// }); });
// cx.add_global_action(|_: &SignOut, cx| { cx.on_action(|_: &SignOut, cx| {
// if let Some(copilot) = Copilot::global(cx) { if let Some(copilot) = Copilot::global(cx) {
// copilot copilot
// .update(cx, |copilot, cx| copilot.sign_out(cx)) .update(cx, |copilot, cx| copilot.sign_out(cx))
// .detach_and_log_err(cx); .detach_and_log_err(cx);
// } }
// }); });
cx.on_action(|_: &Reinstall, cx| {
// cx.add_global_action(|_: &Reinstall, cx| { if let Some(copilot) = Copilot::global(cx) {
// if let Some(copilot) = Copilot::global(cx) { copilot
// copilot .update(cx, |copilot, cx| copilot.reinstall(cx))
// .update(cx, |copilot, cx| copilot.reinstall(cx)) .detach();
// .detach(); }
// } });
// });
} }
enum CopilotServer { enum CopilotServer {

View file

@ -1,376 +1,213 @@
// TODO add logging in use crate::{request::PromptUserDeviceFlow, Copilot, Status};
// use crate::{request::PromptUserDeviceFlow, Copilot, Status}; use gpui::{
// use gpui::{ div, size, AppContext, Bounds, ClipboardItem, Div, Element, GlobalPixels, InteractiveElement,
// elements::*, IntoElement, ParentElement, Point, Render, Stateful, Styled, ViewContext, VisualContext,
// geometry::rect::RectF, WindowBounds, WindowHandle, WindowKind, WindowOptions,
// platform::{WindowBounds, WindowKind, WindowOptions}, };
// AnyElement, AnyViewHandle, AppContext, ClipboardItem, Element, Entity, View, ViewContext, use theme::ActiveTheme;
// WindowHandle, use ui::{prelude::*, Button, Icon, IconElement, Label};
// };
// use theme::ui::modal;
// #[derive(PartialEq, Eq, Debug, Clone)] const COPILOT_SIGN_UP_URL: &'static str = "https://github.com/features/copilot";
// struct CopyUserCode;
// #[derive(PartialEq, Eq, Debug, Clone)] pub fn init(cx: &mut AppContext) {
// struct OpenGithub; if let Some(copilot) = Copilot::global(cx) {
let mut verification_window: Option<WindowHandle<CopilotCodeVerification>> = None;
cx.observe(&copilot, move |copilot, cx| {
let status = copilot.read(cx).status();
// const COPILOT_SIGN_UP_URL: &'static str = "https://github.com/features/copilot"; match &status {
crate::Status::SigningIn { prompt } => {
if let Some(window) = verification_window.as_mut() {
let updated = window
.update(cx, |verification, cx| {
verification.set_status(status.clone(), cx);
cx.activate_window();
})
.is_ok();
if !updated {
verification_window = Some(create_copilot_auth_window(cx, &status));
}
} else if let Some(_prompt) = prompt {
verification_window = Some(create_copilot_auth_window(cx, &status));
}
}
Status::Authorized | Status::Unauthorized => {
if let Some(window) = verification_window.as_ref() {
window
.update(cx, |verification, cx| {
verification.set_status(status, cx);
cx.activate(true);
cx.activate_window();
})
.ok();
}
}
_ => {
if let Some(code_verification) = verification_window.take() {
code_verification
.update(cx, |_, cx| cx.remove_window())
.ok();
}
}
}
})
.detach();
}
}
// pub fn init(cx: &mut AppContext) { fn create_copilot_auth_window(
// if let Some(copilot) = Copilot::global(cx) { cx: &mut AppContext,
// let mut verification_window: Option<WindowHandle<CopilotCodeVerification>> = None; status: &Status,
// cx.observe(&copilot, move |copilot, cx| { ) -> WindowHandle<CopilotCodeVerification> {
// let status = copilot.read(cx).status(); let window_size = size(GlobalPixels::from(280.), GlobalPixels::from(280.));
let window_options = WindowOptions {
bounds: WindowBounds::Fixed(Bounds::new(Point::default(), window_size)),
titlebar: None,
center: true,
focus: true,
show: true,
kind: WindowKind::PopUp,
is_movable: true,
display_id: None,
};
let window = cx.open_window(window_options, |cx| {
cx.build_view(|_| CopilotCodeVerification::new(status.clone()))
});
window
}
// match &status { pub struct CopilotCodeVerification {
// crate::Status::SigningIn { prompt } => { status: Status,
// if let Some(window) = verification_window.as_mut() { connect_clicked: bool,
// let updated = window }
// .root(cx)
// .map(|root| {
// root.update(cx, |verification, cx| {
// verification.set_status(status.clone(), cx);
// cx.activate_window();
// })
// })
// .is_some();
// if !updated {
// verification_window = Some(create_copilot_auth_window(cx, &status));
// }
// } else if let Some(_prompt) = prompt {
// verification_window = Some(create_copilot_auth_window(cx, &status));
// }
// }
// Status::Authorized | Status::Unauthorized => {
// if let Some(window) = verification_window.as_ref() {
// if let Some(verification) = window.root(cx) {
// verification.update(cx, |verification, cx| {
// verification.set_status(status, cx);
// cx.platform().activate(true);
// cx.activate_window();
// });
// }
// }
// }
// _ => {
// if let Some(code_verification) = verification_window.take() {
// code_verification.update(cx, |cx| cx.remove_window());
// }
// }
// }
// })
// .detach();
// }
// }
// fn create_copilot_auth_window( impl CopilotCodeVerification {
// cx: &mut AppContext, pub fn new(status: Status) -> Self {
// status: &Status, Self {
// ) -> WindowHandle<CopilotCodeVerification> { status,
// let window_size = theme::current(cx).copilot.modal.dimensions(); connect_clicked: false,
// let window_options = WindowOptions { }
// bounds: WindowBounds::Fixed(RectF::new(Default::default(), window_size)), }
// titlebar: None,
// center: true,
// focus: true,
// show: true,
// kind: WindowKind::Normal,
// is_movable: true,
// screen: None,
// };
// cx.add_window(window_options, |_cx| {
// CopilotCodeVerification::new(status.clone())
// })
// }
// pub struct CopilotCodeVerification { pub fn set_status(&mut self, status: Status, cx: &mut ViewContext<Self>) {
// status: Status, self.status = status;
// connect_clicked: bool, cx.notify();
// } }
// impl CopilotCodeVerification { fn render_device_code(
// pub fn new(status: Status) -> Self { data: &PromptUserDeviceFlow,
// Self { cx: &mut ViewContext<Self>,
// status, ) -> impl IntoElement {
// connect_clicked: false, let copied = cx
// } .read_from_clipboard()
// } .map(|item| item.text() == &data.user_code)
.unwrap_or(false);
h_stack()
.cursor_pointer()
.justify_between()
.on_mouse_down(gpui::MouseButton::Left, {
let user_code = data.user_code.clone();
move |_, cx| {
cx.write_to_clipboard(ClipboardItem::new(user_code.clone()));
cx.notify();
}
})
.child(Label::new(data.user_code.clone()))
.child(div())
.child(Label::new(if copied { "Copied!" } else { "Copy" }))
}
// pub fn set_status(&mut self, status: Status, cx: &mut ViewContext<Self>) { fn render_prompting_modal(
// self.status = status; connect_clicked: bool,
// cx.notify(); data: &PromptUserDeviceFlow,
// } cx: &mut ViewContext<Self>,
) -> impl Element {
let connect_button_label = if connect_clicked {
"Waiting for connection..."
} else {
"Connect to Github"
};
v_stack()
.flex_1()
.items_center()
.justify_between()
.w_full()
.child(Label::new(
"Enable Copilot by connecting your existing license",
))
.child(Self::render_device_code(data, cx))
.child(
Label::new("Paste this code into GitHub after clicking the button below.")
.size(ui::LabelSize::Small),
)
.child(
Button::new("connect-button", connect_button_label).on_click({
let verification_uri = data.verification_uri.clone();
cx.listener(move |this, _, cx| {
cx.open_url(&verification_uri);
this.connect_clicked = true;
})
}),
)
}
fn render_enabled_modal() -> impl Element {
v_stack()
.child(Label::new("Copilot Enabled!"))
.child(Label::new(
"You can update your settings or sign out from the Copilot menu in the status bar.",
))
.child(
Button::new("copilot-enabled-done-button", "Done")
.on_click(|_, cx| cx.remove_window()),
)
}
// fn render_device_code( fn render_unauthorized_modal() -> impl Element {
// data: &PromptUserDeviceFlow, v_stack()
// style: &theme::Copilot, .child(Label::new(
// cx: &mut ViewContext<Self>, "Enable Copilot by connecting your existing license.",
// ) -> impl IntoAnyElement<Self> { ))
// let copied = cx .child(
// .read_from_clipboard() Label::new("You must have an active Copilot license to use it in Zed.")
// .map(|item| item.text() == &data.user_code) .color(Color::Warning),
// .unwrap_or(false); )
.child(
Button::new("copilot-subscribe-button", "Subscibe on Github").on_click(|_, cx| {
cx.remove_window();
cx.open_url(COPILOT_SIGN_UP_URL)
}),
)
}
}
// let device_code_style = &style.auth.prompting.device_code; impl Render for CopilotCodeVerification {
type Element = Stateful<Div>;
// MouseEventHandler::new::<Self, _>(0, cx, |state, _cx| { fn render(&mut self, cx: &mut ViewContext<Self>) -> Self::Element {
// Flex::row() let prompt = match &self.status {
// .with_child( Status::SigningIn {
// Label::new(data.user_code.clone(), device_code_style.text.clone()) prompt: Some(prompt),
// .aligned() } => Self::render_prompting_modal(self.connect_clicked, &prompt, cx).into_any_element(),
// .contained() Status::Unauthorized => {
// .with_style(device_code_style.left_container) self.connect_clicked = false;
// .constrained() Self::render_unauthorized_modal().into_any_element()
// .with_width(device_code_style.left), }
// ) Status::Authorized => {
// .with_child( self.connect_clicked = false;
// Label::new( Self::render_enabled_modal().into_any_element()
// if copied { "Copied!" } else { "Copy" }, }
// device_code_style.cta.style_for(state).text.clone(), _ => div().into_any_element(),
// ) };
// .aligned() div()
// .contained() .id("copilot code verification")
// .with_style(*device_code_style.right_container.style_for(state)) .flex()
// .constrained() .flex_col()
// .with_width(device_code_style.right), .size_full()
// ) .items_center()
// .contained() .p_10()
// .with_style(device_code_style.cta.style_for(state).container) .bg(cx.theme().colors().element_background)
// }) .child(ui::Label::new("Connect Copilot to Zed"))
// .on_click(gpui::platform::MouseButton::Left, { .child(IconElement::new(Icon::ZedXCopilot))
// let user_code = data.user_code.clone(); .child(prompt)
// move |_, _, cx| { }
// cx.platform() }
// .write_to_clipboard(ClipboardItem::new(user_code.clone()));
// cx.notify();
// }
// })
// .with_cursor_style(gpui::platform::CursorStyle::PointingHand)
// }
// fn render_prompting_modal(
// connect_clicked: bool,
// data: &PromptUserDeviceFlow,
// style: &theme::Copilot,
// cx: &mut ViewContext<Self>,
// ) -> AnyElement<Self> {
// enum ConnectButton {}
// Flex::column()
// .with_child(
// Flex::column()
// .with_children([
// Label::new(
// "Enable Copilot by connecting",
// style.auth.prompting.subheading.text.clone(),
// )
// .aligned(),
// Label::new(
// "your existing license.",
// style.auth.prompting.subheading.text.clone(),
// )
// .aligned(),
// ])
// .align_children_center()
// .contained()
// .with_style(style.auth.prompting.subheading.container),
// )
// .with_child(Self::render_device_code(data, &style, cx))
// .with_child(
// Flex::column()
// .with_children([
// Label::new(
// "Paste this code into GitHub after",
// style.auth.prompting.hint.text.clone(),
// )
// .aligned(),
// Label::new(
// "clicking the button below.",
// style.auth.prompting.hint.text.clone(),
// )
// .aligned(),
// ])
// .align_children_center()
// .contained()
// .with_style(style.auth.prompting.hint.container.clone()),
// )
// .with_child(theme::ui::cta_button::<ConnectButton, _, _, _>(
// if connect_clicked {
// "Waiting for connection..."
// } else {
// "Connect to GitHub"
// },
// style.auth.content_width,
// &style.auth.cta_button,
// cx,
// {
// let verification_uri = data.verification_uri.clone();
// move |_, verification, cx| {
// cx.platform().open_url(&verification_uri);
// verification.connect_clicked = true;
// }
// },
// ))
// .align_children_center()
// .into_any()
// }
// fn render_enabled_modal(
// style: &theme::Copilot,
// cx: &mut ViewContext<Self>,
// ) -> AnyElement<Self> {
// enum DoneButton {}
// let enabled_style = &style.auth.authorized;
// Flex::column()
// .with_child(
// Label::new("Copilot Enabled!", enabled_style.subheading.text.clone())
// .contained()
// .with_style(enabled_style.subheading.container)
// .aligned(),
// )
// .with_child(
// Flex::column()
// .with_children([
// Label::new(
// "You can update your settings or",
// enabled_style.hint.text.clone(),
// )
// .aligned(),
// Label::new(
// "sign out from the Copilot menu in",
// enabled_style.hint.text.clone(),
// )
// .aligned(),
// Label::new("the status bar.", enabled_style.hint.text.clone()).aligned(),
// ])
// .align_children_center()
// .contained()
// .with_style(enabled_style.hint.container),
// )
// .with_child(theme::ui::cta_button::<DoneButton, _, _, _>(
// "Done",
// style.auth.content_width,
// &style.auth.cta_button,
// cx,
// |_, _, cx| cx.remove_window(),
// ))
// .align_children_center()
// .into_any()
// }
// fn render_unauthorized_modal(
// style: &theme::Copilot,
// cx: &mut ViewContext<Self>,
// ) -> AnyElement<Self> {
// let unauthorized_style = &style.auth.not_authorized;
// Flex::column()
// .with_child(
// Flex::column()
// .with_children([
// Label::new(
// "Enable Copilot by connecting",
// unauthorized_style.subheading.text.clone(),
// )
// .aligned(),
// Label::new(
// "your existing license.",
// unauthorized_style.subheading.text.clone(),
// )
// .aligned(),
// ])
// .align_children_center()
// .contained()
// .with_style(unauthorized_style.subheading.container),
// )
// .with_child(
// Flex::column()
// .with_children([
// Label::new(
// "You must have an active copilot",
// unauthorized_style.warning.text.clone(),
// )
// .aligned(),
// Label::new(
// "license to use it in Zed.",
// unauthorized_style.warning.text.clone(),
// )
// .aligned(),
// ])
// .align_children_center()
// .contained()
// .with_style(unauthorized_style.warning.container),
// )
// .with_child(theme::ui::cta_button::<Self, _, _, _>(
// "Subscribe on GitHub",
// style.auth.content_width,
// &style.auth.cta_button,
// cx,
// |_, _, cx| {
// cx.remove_window();
// cx.platform().open_url(COPILOT_SIGN_UP_URL)
// },
// ))
// .align_children_center()
// .into_any()
// }
// }
// impl Entity for CopilotCodeVerification {
// type Event = ();
// }
// impl View for CopilotCodeVerification {
// fn ui_name() -> &'static str {
// "CopilotCodeVerification"
// }
// fn focus_in(&mut self, _: AnyViewHandle, cx: &mut ViewContext<Self>) {
// cx.notify()
// }
// fn focus_out(&mut self, _: AnyViewHandle, cx: &mut ViewContext<Self>) {
// cx.notify()
// }
// fn render(&mut self, cx: &mut ViewContext<Self>) -> AnyElement<Self> {
// enum ConnectModal {}
// let style = theme::current(cx).clone();
// modal::<ConnectModal, _, _, _, _>(
// "Connect Copilot to Zed",
// &style.copilot.modal,
// cx,
// |cx| {
// Flex::column()
// .with_children([
// theme::ui::icon(&style.copilot.auth.header).into_any(),
// match &self.status {
// Status::SigningIn {
// prompt: Some(prompt),
// } => Self::render_prompting_modal(
// self.connect_clicked,
// &prompt,
// &style.copilot,
// cx,
// ),
// Status::Unauthorized => {
// self.connect_clicked = false;
// Self::render_unauthorized_modal(&style.copilot, cx)
// }
// Status::Authorized => {
// self.connect_clicked = false;
// Self::render_enabled_modal(&style.copilot, cx)
// }
// _ => Empty::new().into_any(),
// },
// ])
// .align_children_center()
// },
// )
// .into_any()
// }
// }

View file

@ -36,7 +36,7 @@ use std::{
}; };
use theme::ActiveTheme; use theme::ActiveTheme;
pub use toolbar_controls::ToolbarControls; pub use toolbar_controls::ToolbarControls;
use ui::{h_stack, Color, HighlightedLabel, Icon, IconElement, Label}; use ui::{h_stack, prelude::*, HighlightedLabel, Icon, IconElement, Label};
use util::TryFutureExt; use util::TryFutureExt;
use workspace::{ use workspace::{
item::{BreadcrumbText, Item, ItemEvent, ItemHandle}, item::{BreadcrumbText, Item, ItemEvent, ItemHandle},
@ -88,7 +88,7 @@ struct DiagnosticGroupState {
block_count: usize, block_count: usize,
} }
impl EventEmitter<ItemEvent> for ProjectDiagnosticsEditor {} impl EventEmitter<EditorEvent> for ProjectDiagnosticsEditor {}
impl Render for ProjectDiagnosticsEditor { impl Render for ProjectDiagnosticsEditor {
type Element = Focusable<Div>; type Element = Focusable<Div>;
@ -158,7 +158,7 @@ impl ProjectDiagnosticsEditor {
}); });
let editor_event_subscription = let editor_event_subscription =
cx.subscribe(&editor, |this, _editor, event: &EditorEvent, cx| { cx.subscribe(&editor, |this, _editor, event: &EditorEvent, cx| {
Self::emit_item_event_for_editor_event(event, cx); cx.emit(event.clone());
if event == &EditorEvent::Focused && this.path_states.is_empty() { if event == &EditorEvent::Focused && this.path_states.is_empty() {
cx.focus(&this.focus_handle); cx.focus(&this.focus_handle);
} }
@ -183,40 +183,6 @@ impl ProjectDiagnosticsEditor {
this this
} }
fn emit_item_event_for_editor_event(event: &EditorEvent, cx: &mut ViewContext<Self>) {
match event {
EditorEvent::Closed => cx.emit(ItemEvent::CloseItem),
EditorEvent::Saved | EditorEvent::TitleChanged => {
cx.emit(ItemEvent::UpdateTab);
cx.emit(ItemEvent::UpdateBreadcrumbs);
}
EditorEvent::Reparsed => {
cx.emit(ItemEvent::UpdateBreadcrumbs);
}
EditorEvent::SelectionsChanged { local } if *local => {
cx.emit(ItemEvent::UpdateBreadcrumbs);
}
EditorEvent::DirtyChanged => {
cx.emit(ItemEvent::UpdateTab);
}
EditorEvent::BufferEdited => {
cx.emit(ItemEvent::Edit);
cx.emit(ItemEvent::UpdateBreadcrumbs);
}
EditorEvent::ExcerptsAdded { .. } | EditorEvent::ExcerptsRemoved { .. } => {
cx.emit(ItemEvent::Edit);
}
_ => {}
}
}
fn deploy(workspace: &mut Workspace, _: &Deploy, cx: &mut ViewContext<Workspace>) { fn deploy(workspace: &mut Workspace, _: &Deploy, cx: &mut ViewContext<Workspace>) {
if let Some(existing) = workspace.item_of_type::<ProjectDiagnosticsEditor>(cx) { if let Some(existing) = workspace.item_of_type::<ProjectDiagnosticsEditor>(cx) {
workspace.activate_item(&existing, cx); workspace.activate_item(&existing, cx);
@ -333,8 +299,7 @@ impl ProjectDiagnosticsEditor {
this.update(&mut cx, |this, cx| { this.update(&mut cx, |this, cx| {
this.summary = this.project.read(cx).diagnostic_summary(false, cx); this.summary = this.project.read(cx).diagnostic_summary(false, cx);
cx.emit(ItemEvent::UpdateTab); cx.emit(EditorEvent::TitleChanged);
cx.emit(ItemEvent::UpdateBreadcrumbs);
})?; })?;
anyhow::Ok(()) anyhow::Ok(())
} }
@ -649,6 +614,12 @@ impl FocusableView for ProjectDiagnosticsEditor {
} }
impl Item for ProjectDiagnosticsEditor { impl Item for ProjectDiagnosticsEditor {
type Event = EditorEvent;
fn to_item_events(event: &EditorEvent, f: impl FnMut(ItemEvent)) {
Editor::to_item_events(event, f)
}
fn deactivated(&mut self, cx: &mut ViewContext<Self>) { fn deactivated(&mut self, cx: &mut ViewContext<Self>) {
self.editor.update(cx, |editor, cx| editor.deactivated(cx)); self.editor.update(cx, |editor, cx| editor.deactivated(cx));
} }

View file

@ -24,7 +24,7 @@ use lsp::DiagnosticSeverity;
use std::{any::TypeId, borrow::Cow, fmt::Debug, num::NonZeroU32, ops::Range, sync::Arc}; use std::{any::TypeId, borrow::Cow, fmt::Debug, num::NonZeroU32, ops::Range, sync::Arc};
use sum_tree::{Bias, TreeMap}; use sum_tree::{Bias, TreeMap};
use tab_map::TabMap; use tab_map::TabMap;
use theme::{SyntaxTheme, Theme}; use theme::{StatusColors, SyntaxTheme, Theme};
use wrap_map::WrapMap; use wrap_map::WrapMap;
pub use block_map::{ pub use block_map::{
@ -513,8 +513,8 @@ impl DisplaySnapshot {
self.chunks( self.chunks(
display_rows, display_rows,
language_aware, language_aware,
Some(editor_style.syntax.inlay_style), Some(editor_style.inlays_style),
Some(editor_style.syntax.suggestion_style), Some(editor_style.suggestions_style),
) )
.map(|chunk| { .map(|chunk| {
let mut highlight_style = chunk let mut highlight_style = chunk

View file

@ -993,7 +993,7 @@ mod tests {
use super::*; use super::*;
use crate::display_map::inlay_map::InlayMap; use crate::display_map::inlay_map::InlayMap;
use crate::display_map::{fold_map::FoldMap, tab_map::TabMap, wrap_map::WrapMap}; use crate::display_map::{fold_map::FoldMap, tab_map::TabMap, wrap_map::WrapMap};
use gpui::{div, font, px, Element, Platform as _}; use gpui::{div, font, px, Element};
use multi_buffer::MultiBuffer; use multi_buffer::MultiBuffer;
use rand::prelude::*; use rand::prelude::*;
use settings::SettingsStore; use settings::SettingsStore;
@ -1185,11 +1185,7 @@ mod tests {
fn test_blocks_on_wrapped_lines(cx: &mut gpui::TestAppContext) { fn test_blocks_on_wrapped_lines(cx: &mut gpui::TestAppContext) {
cx.update(|cx| init_test(cx)); cx.update(|cx| init_test(cx));
let font_id = cx let font_id = cx.text_system().font_id(&font("Helvetica")).unwrap();
.test_platform
.text_system()
.font_id(&font("Helvetica"))
.unwrap();
let text = "one two three\nfour five six\nseven eight"; let text = "one two three\nfour five six\nseven eight";

View file

@ -1032,7 +1032,7 @@ mod tests {
display_map::{fold_map::FoldMap, inlay_map::InlayMap, tab_map::TabMap}, display_map::{fold_map::FoldMap, inlay_map::InlayMap, tab_map::TabMap},
MultiBuffer, MultiBuffer,
}; };
use gpui::{font, px, test::observe, Platform}; use gpui::{font, px, test::observe};
use rand::prelude::*; use rand::prelude::*;
use settings::SettingsStore; use settings::SettingsStore;
use smol::stream::StreamExt; use smol::stream::StreamExt;

View file

@ -92,6 +92,7 @@ use std::{
ops::{ControlFlow, Deref, DerefMut, Range, RangeInclusive}, ops::{ControlFlow, Deref, DerefMut, Range, RangeInclusive},
path::Path, path::Path,
sync::Arc, sync::Arc,
sync::Weak,
time::{Duration, Instant}, time::{Duration, Instant},
}; };
pub use sum_tree::Bias; pub use sum_tree::Bias;
@ -420,6 +421,25 @@ pub fn init(cx: &mut AppContext) {
}, },
) )
.detach(); .detach();
cx.on_action(move |_: &workspace::NewFile, cx| {
let app_state = cx.global::<Weak<workspace::AppState>>();
if let Some(app_state) = app_state.upgrade() {
workspace::open_new(&app_state, cx, |workspace, cx| {
Editor::new_file(workspace, &Default::default(), cx)
})
.detach();
}
});
cx.on_action(move |_: &workspace::NewWindow, cx| {
let app_state = cx.global::<Weak<workspace::AppState>>();
if let Some(app_state) = app_state.upgrade() {
workspace::open_new(&app_state, cx, |workspace, cx| {
Editor::new_file(workspace, &Default::default(), cx)
})
.detach();
}
});
} }
trait InvalidationRegion { trait InvalidationRegion {
@ -479,6 +499,8 @@ pub struct EditorStyle {
pub scrollbar_width: Pixels, pub scrollbar_width: Pixels,
pub syntax: Arc<SyntaxTheme>, pub syntax: Arc<SyntaxTheme>,
pub diagnostic_style: DiagnosticStyle, pub diagnostic_style: DiagnosticStyle,
pub inlays_style: HighlightStyle,
pub suggestions_style: HighlightStyle,
} }
type CompletionId = usize; type CompletionId = usize;
@ -1675,8 +1697,7 @@ impl Editor {
if let Some(project) = project.as_ref() { if let Some(project) = project.as_ref() {
if buffer.read(cx).is_singleton() { if buffer.read(cx).is_singleton() {
project_subscriptions.push(cx.observe(project, |_, _, cx| { project_subscriptions.push(cx.observe(project, |_, _, cx| {
cx.emit(ItemEvent::UpdateTab); cx.emit(EditorEvent::TitleChanged);
cx.emit(ItemEvent::UpdateBreadcrumbs);
})); }));
} }
project_subscriptions.push(cx.subscribe(project, |editor, _, event, cx| { project_subscriptions.push(cx.subscribe(project, |editor, _, event, cx| {
@ -1966,14 +1987,14 @@ impl Editor {
cx.notify(); cx.notify();
} }
// pub fn set_cursor_shape(&mut self, cursor_shape: CursorShape, cx: &mut ViewContext<Self>) { pub fn set_cursor_shape(&mut self, cursor_shape: CursorShape, cx: &mut ViewContext<Self>) {
// self.cursor_shape = cursor_shape; self.cursor_shape = cursor_shape;
// cx.notify(); cx.notify();
// } }
// pub fn set_collapse_matches(&mut self, collapse_matches: bool) { pub fn set_collapse_matches(&mut self, collapse_matches: bool) {
// self.collapse_matches = collapse_matches; self.collapse_matches = collapse_matches;
// } }
pub fn range_for_match<T: std::marker::Copy>(&self, range: &Range<T>) -> Range<T> { pub fn range_for_match<T: std::marker::Copy>(&self, range: &Range<T>) -> Range<T> {
if self.collapse_matches { if self.collapse_matches {
@ -1982,56 +2003,47 @@ impl Editor {
range.clone() range.clone()
} }
// pub fn set_clip_at_line_ends(&mut self, clip: bool, cx: &mut ViewContext<Self>) { pub fn set_clip_at_line_ends(&mut self, clip: bool, cx: &mut ViewContext<Self>) {
// if self.display_map.read(cx).clip_at_line_ends != clip { if self.display_map.read(cx).clip_at_line_ends != clip {
// self.display_map self.display_map
// .update(cx, |map, _| map.clip_at_line_ends = clip); .update(cx, |map, _| map.clip_at_line_ends = clip);
// } }
// } }
// pub fn set_keymap_context_layer<Tag: 'static>( pub fn set_keymap_context_layer<Tag: 'static>(
// &mut self, &mut self,
// context: KeymapContext, context: KeyContext,
// cx: &mut ViewContext<Self>, cx: &mut ViewContext<Self>,
// ) { ) {
// self.keymap_context_layers self.keymap_context_layers
// .insert(TypeId::of::<Tag>(), context); .insert(TypeId::of::<Tag>(), context);
// cx.notify(); cx.notify();
// } }
// pub fn remove_keymap_context_layer<Tag: 'static>(&mut self, cx: &mut ViewContext<Self>) { pub fn remove_keymap_context_layer<Tag: 'static>(&mut self, cx: &mut ViewContext<Self>) {
// self.keymap_context_layers.remove(&TypeId::of::<Tag>()); self.keymap_context_layers.remove(&TypeId::of::<Tag>());
// cx.notify(); cx.notify();
// } }
// pub fn set_input_enabled(&mut self, input_enabled: bool) { pub fn set_input_enabled(&mut self, input_enabled: bool) {
// self.input_enabled = input_enabled; self.input_enabled = input_enabled;
// } }
// pub fn set_autoindent(&mut self, autoindent: bool) { pub fn set_autoindent(&mut self, autoindent: bool) {
// if autoindent { if autoindent {
// self.autoindent_mode = Some(AutoindentMode::EachLine); self.autoindent_mode = Some(AutoindentMode::EachLine);
// } else { } else {
// self.autoindent_mode = None; self.autoindent_mode = None;
// } }
// } }
// pub fn read_only(&self) -> bool { pub fn read_only(&self) -> bool {
// self.read_only self.read_only
// } }
// pub fn set_read_only(&mut self, read_only: bool) { pub fn set_read_only(&mut self, read_only: bool) {
// self.read_only = read_only; self.read_only = read_only;
// } }
// pub fn set_field_editor_style(
// &mut self,
// style: Option<Arc<GetFieldEditorTheme>>,
// cx: &mut ViewContext<Self>,
// ) {
// self.get_field_editor_theme = style;
// cx.notify();
// }
fn selections_did_change( fn selections_did_change(
&mut self, &mut self,
@ -2146,10 +2158,6 @@ impl Editor {
cx.emit(SearchEvent::ActiveMatchChanged) cx.emit(SearchEvent::ActiveMatchChanged)
} }
if local {
cx.emit(ItemEvent::UpdateBreadcrumbs);
}
cx.notify(); cx.notify();
} }
@ -7639,6 +7647,18 @@ impl Editor {
.editor_style .editor_style
.diagnostic_style .diagnostic_style
.clone(), .clone(),
// todo!("what about the rest of the highlight style parts for inlays and suggestions?")
inlays_style: HighlightStyle {
color: Some(cx.theme().status().hint),
font_weight: Some(FontWeight::BOLD),
fade_out: Some(0.6),
..HighlightStyle::default()
},
suggestions_style: HighlightStyle {
color: Some(cx.theme().status().predictive),
fade_out: Some(0.6),
..HighlightStyle::default()
},
}, },
)) ))
.into_any_element() .into_any_element()
@ -8589,8 +8609,6 @@ impl Editor {
self.update_visible_copilot_suggestion(cx); self.update_visible_copilot_suggestion(cx);
} }
cx.emit(EditorEvent::BufferEdited); cx.emit(EditorEvent::BufferEdited);
cx.emit(ItemEvent::Edit);
cx.emit(ItemEvent::UpdateBreadcrumbs);
cx.emit(SearchEvent::MatchesInvalidated); cx.emit(SearchEvent::MatchesInvalidated);
if *sigleton_buffer_edited { if *sigleton_buffer_edited {
@ -8638,20 +8656,14 @@ impl Editor {
self.refresh_inlay_hints(InlayHintRefreshReason::ExcerptsRemoved(ids.clone()), cx); self.refresh_inlay_hints(InlayHintRefreshReason::ExcerptsRemoved(ids.clone()), cx);
cx.emit(EditorEvent::ExcerptsRemoved { ids: ids.clone() }) cx.emit(EditorEvent::ExcerptsRemoved { ids: ids.clone() })
} }
multi_buffer::Event::Reparsed => { multi_buffer::Event::Reparsed => cx.emit(EditorEvent::Reparsed),
cx.emit(ItemEvent::UpdateBreadcrumbs); multi_buffer::Event::DirtyChanged => cx.emit(EditorEvent::DirtyChanged),
} multi_buffer::Event::Saved => cx.emit(EditorEvent::Saved),
multi_buffer::Event::DirtyChanged => { multi_buffer::Event::FileHandleChanged | multi_buffer::Event::Reloaded => {
cx.emit(ItemEvent::UpdateTab); cx.emit(EditorEvent::TitleChanged)
}
multi_buffer::Event::Saved
| multi_buffer::Event::FileHandleChanged
| multi_buffer::Event::Reloaded => {
cx.emit(ItemEvent::UpdateTab);
cx.emit(ItemEvent::UpdateBreadcrumbs);
} }
multi_buffer::Event::DiffBaseChanged => cx.emit(EditorEvent::DiffBaseChanged), multi_buffer::Event::DiffBaseChanged => cx.emit(EditorEvent::DiffBaseChanged),
multi_buffer::Event::Closed => cx.emit(ItemEvent::CloseItem), multi_buffer::Event::Closed => cx.emit(EditorEvent::Closed),
multi_buffer::Event::DiagnosticsUpdated => { multi_buffer::Event::DiagnosticsUpdated => {
self.refresh_active_diagnostics(cx); self.refresh_active_diagnostics(cx);
} }
@ -9287,7 +9299,7 @@ impl Render for Editor {
color: cx.theme().colors().text, color: cx.theme().colors().text,
font_family: settings.buffer_font.family.clone(), font_family: settings.buffer_font.family.clone(),
font_features: settings.buffer_font.features, font_features: settings.buffer_font.features,
font_size: settings.buffer_font_size.into(), font_size: settings.buffer_font_size(cx).into(),
font_weight: FontWeight::NORMAL, font_weight: FontWeight::NORMAL,
font_style: FontStyle::Normal, font_style: FontStyle::Normal,
line_height: relative(settings.buffer_line_height.value()), line_height: relative(settings.buffer_line_height.value()),
@ -9312,6 +9324,19 @@ impl Render for Editor {
scrollbar_width: px(12.), scrollbar_width: px(12.),
syntax: cx.theme().syntax().clone(), syntax: cx.theme().syntax().clone(),
diagnostic_style: cx.theme().diagnostic_style(), diagnostic_style: cx.theme().diagnostic_style(),
// TODO kb find `HighlightStyle` usages
// todo!("what about the rest of the highlight style parts?")
inlays_style: HighlightStyle {
color: Some(cx.theme().status().hint),
font_weight: Some(FontWeight::BOLD),
fade_out: Some(0.6),
..HighlightStyle::default()
},
suggestions_style: HighlightStyle {
color: Some(cx.theme().status().predictive),
fade_out: Some(0.6),
..HighlightStyle::default()
},
}, },
) )
} }

View file

@ -12,7 +12,7 @@ use futures::StreamExt;
use gpui::{ use gpui::{
div, div,
serde_json::{self, json}, serde_json::{self, json},
Div, Flatten, Platform, TestAppContext, VisualTestContext, WindowBounds, WindowOptions, Div, Flatten, TestAppContext, VisualTestContext, WindowBounds, WindowOptions,
}; };
use indoc::indoc; use indoc::indoc;
use language::{ use language::{
@ -32,7 +32,7 @@ use util::{
test::{marked_text_ranges, marked_text_ranges_by, sample_text, TextRangeMarker}, test::{marked_text_ranges, marked_text_ranges_by, sample_text, TextRangeMarker},
}; };
use workspace::{ use workspace::{
item::{FollowEvent, FollowableEvents, FollowableItem, Item, ItemHandle}, item::{FollowEvent, FollowableItem, Item, ItemHandle},
NavigationEntry, ViewId, NavigationEntry, ViewId,
}; };
@ -345,7 +345,12 @@ fn test_selection_with_mouse(cx: &mut TestAppContext) {
); );
editor.update(cx, |view, cx| { editor.update(cx, |view, cx| {
view.update_selection(DisplayPoint::new(3, 3), 0, gpui::Point::<f32>::zero(), cx); view.update_selection(
DisplayPoint::new(3, 3),
0,
gpui::Point::<f32>::default(),
cx,
);
}); });
assert_eq!( assert_eq!(
@ -356,7 +361,12 @@ fn test_selection_with_mouse(cx: &mut TestAppContext) {
); );
editor.update(cx, |view, cx| { editor.update(cx, |view, cx| {
view.update_selection(DisplayPoint::new(1, 1), 0, gpui::Point::<f32>::zero(), cx); view.update_selection(
DisplayPoint::new(1, 1),
0,
gpui::Point::<f32>::default(),
cx,
);
}); });
assert_eq!( assert_eq!(
@ -368,7 +378,12 @@ fn test_selection_with_mouse(cx: &mut TestAppContext) {
editor.update(cx, |view, cx| { editor.update(cx, |view, cx| {
view.end_selection(cx); view.end_selection(cx);
view.update_selection(DisplayPoint::new(3, 3), 0, gpui::Point::<f32>::zero(), cx); view.update_selection(
DisplayPoint::new(3, 3),
0,
gpui::Point::<f32>::default(),
cx,
);
}); });
assert_eq!( assert_eq!(
@ -380,7 +395,12 @@ fn test_selection_with_mouse(cx: &mut TestAppContext) {
editor.update(cx, |view, cx| { editor.update(cx, |view, cx| {
view.begin_selection(DisplayPoint::new(3, 3), true, 1, cx); view.begin_selection(DisplayPoint::new(3, 3), true, 1, cx);
view.update_selection(DisplayPoint::new(0, 0), 0, gpui::Point::<f32>::zero(), cx); view.update_selection(
DisplayPoint::new(0, 0),
0,
gpui::Point::<f32>::default(),
cx,
);
}); });
assert_eq!( assert_eq!(
@ -423,7 +443,12 @@ fn test_canceling_pending_selection(cx: &mut TestAppContext) {
}); });
view.update(cx, |view, cx| { view.update(cx, |view, cx| {
view.update_selection(DisplayPoint::new(3, 3), 0, gpui::Point::<f32>::zero(), cx); view.update_selection(
DisplayPoint::new(3, 3),
0,
gpui::Point::<f32>::default(),
cx,
);
assert_eq!( assert_eq!(
view.selections.display_ranges(cx), view.selections.display_ranges(cx),
[DisplayPoint::new(2, 2)..DisplayPoint::new(3, 3)] [DisplayPoint::new(2, 2)..DisplayPoint::new(3, 3)]
@ -432,7 +457,12 @@ fn test_canceling_pending_selection(cx: &mut TestAppContext) {
view.update(cx, |view, cx| { view.update(cx, |view, cx| {
view.cancel(&Cancel, cx); view.cancel(&Cancel, cx);
view.update_selection(DisplayPoint::new(1, 1), 0, gpui::Point::<f32>::zero(), cx); view.update_selection(
DisplayPoint::new(1, 1),
0,
gpui::Point::<f32>::default(),
cx,
);
assert_eq!( assert_eq!(
view.selections.display_ranges(cx), view.selections.display_ranges(cx),
[DisplayPoint::new(2, 2)..DisplayPoint::new(3, 3)] [DisplayPoint::new(2, 2)..DisplayPoint::new(3, 3)]
@ -643,11 +673,21 @@ fn test_cancel(cx: &mut TestAppContext) {
view.update(cx, |view, cx| { view.update(cx, |view, cx| {
view.begin_selection(DisplayPoint::new(3, 4), false, 1, cx); view.begin_selection(DisplayPoint::new(3, 4), false, 1, cx);
view.update_selection(DisplayPoint::new(1, 1), 0, gpui::Point::<f32>::zero(), cx); view.update_selection(
DisplayPoint::new(1, 1),
0,
gpui::Point::<f32>::default(),
cx,
);
view.end_selection(cx); view.end_selection(cx);
view.begin_selection(DisplayPoint::new(0, 1), true, 1, cx); view.begin_selection(DisplayPoint::new(0, 1), true, 1, cx);
view.update_selection(DisplayPoint::new(0, 3), 0, gpui::Point::<f32>::zero(), cx); view.update_selection(
DisplayPoint::new(0, 3),
0,
gpui::Point::<f32>::default(),
cx,
);
view.end_selection(cx); view.end_selection(cx);
assert_eq!( assert_eq!(
view.selections.display_ranges(cx), view.selections.display_ranges(cx),
@ -3238,9 +3278,7 @@ async fn test_clipboard(cx: &mut gpui::TestAppContext) {
the lazy dog"}); the lazy dog"});
cx.update_editor(|e, cx| e.copy(&Copy, cx)); cx.update_editor(|e, cx| e.copy(&Copy, cx));
assert_eq!( assert_eq!(
cx.test_platform cx.read_from_clipboard().map(|item| item.text().to_owned()),
.read_from_clipboard()
.map(|item| item.text().to_owned()),
Some("fox jumps over\n".to_owned()) Some("fox jumps over\n".to_owned())
); );
@ -6478,7 +6516,7 @@ async fn test_following(cx: &mut gpui::TestAppContext) {
cx.subscribe( cx.subscribe(
&follower.root_view(cx).unwrap(), &follower.root_view(cx).unwrap(),
move |_, _, event: &EditorEvent, cx| { move |_, _, event: &EditorEvent, cx| {
if matches!(event.to_follow_event(), Some(FollowEvent::Unfollow)) { if matches!(Editor::to_follow_event(event), Some(FollowEvent::Unfollow)) {
*is_still_following.borrow_mut() = false; *is_still_following.borrow_mut() = false;
} }

View file

@ -485,7 +485,7 @@ impl EditorElement {
let modifiers = event.modifiers; let modifiers = event.modifiers;
if editor.has_pending_selection() && event.pressed_button == Some(MouseButton::Left) { if editor.has_pending_selection() && event.pressed_button == Some(MouseButton::Left) {
let point_for_position = position_map.point_for_position(text_bounds, event.position); let point_for_position = position_map.point_for_position(text_bounds, event.position);
let mut scroll_delta = gpui::Point::<f32>::zero(); let mut scroll_delta = gpui::Point::<f32>::default();
let vertical_margin = position_map.line_height.min(text_bounds.size.height / 3.0); let vertical_margin = position_map.line_height.min(text_bounds.size.height / 3.0);
let top = text_bounds.origin.y + vertical_margin; let top = text_bounds.origin.y + vertical_margin;
let bottom = text_bounds.lower_left().y - vertical_margin; let bottom = text_bounds.lower_left().y - vertical_margin;
@ -511,7 +511,7 @@ impl EditorElement {
position: point_for_position.previous_valid, position: point_for_position.previous_valid,
goal_column: point_for_position.exact_unclipped.column(), goal_column: point_for_position.exact_unclipped.column(),
scroll_position: (position_map.snapshot.scroll_position() + scroll_delta) scroll_position: (position_map.snapshot.scroll_position() + scroll_delta)
.clamp(&gpui::Point::zero(), &position_map.scroll_max), .clamp(&gpui::Point::default(), &position_map.scroll_max),
}, },
cx, cx,
); );
@ -2803,7 +2803,10 @@ impl Element for EditorElement {
let focus_handle = editor.focus_handle(cx); let focus_handle = editor.focus_handle(cx);
let dispatch_context = self.editor.read(cx).dispatch_context(cx); let dispatch_context = self.editor.read(cx).dispatch_context(cx);
cx.with_key_dispatch(dispatch_context, Some(focus_handle.clone()), |_, cx| { cx.with_key_dispatch(
Some(dispatch_context),
Some(focus_handle.clone()),
|_, cx| {
self.register_actions(cx); self.register_actions(cx);
self.register_key_listeners(cx); self.register_key_listeners(cx);
@ -2813,9 +2816,16 @@ impl Element for EditorElement {
// Paint mouse listeners at z-index 0 so any elements we paint on top of the editor // Paint mouse listeners at z-index 0 so any elements we paint on top of the editor
// take precedence. // take precedence.
cx.with_z_index(0, |cx| { cx.with_z_index(0, |cx| {
self.paint_mouse_listeners(bounds, gutter_bounds, text_bounds, &layout, cx); self.paint_mouse_listeners(
bounds,
gutter_bounds,
text_bounds,
&layout,
cx,
);
}); });
let input_handler = ElementInputHandler::new(bounds, self.editor.clone(), cx); let input_handler =
ElementInputHandler::new(bounds, self.editor.clone(), cx);
cx.handle_input(&focus_handle, input_handler); cx.handle_input(&focus_handle, input_handler);
self.paint_background(gutter_bounds, text_bounds, &layout, cx); self.paint_background(gutter_bounds, text_bounds, &layout, cx);
@ -2825,13 +2835,16 @@ impl Element for EditorElement {
self.paint_text(text_bounds, &mut layout, cx); self.paint_text(text_bounds, &mut layout, cx);
if !layout.blocks.is_empty() { if !layout.blocks.is_empty() {
cx.with_z_index(1, |cx| {
cx.with_element_id(Some("editor_blocks"), |cx| { cx.with_element_id(Some("editor_blocks"), |cx| {
self.paint_blocks(bounds, &mut layout, cx); self.paint_blocks(bounds, &mut layout, cx);
}) })
})
} }
}); });
}); });
}) },
)
} }
} }
@ -3448,7 +3461,6 @@ mod tests {
DisplayPoint::new(4, 0)..DisplayPoint::new(6, 0) DisplayPoint::new(4, 0)..DisplayPoint::new(6, 0)
); );
assert_eq!(local_selections[0].head, DisplayPoint::new(5, 0)); assert_eq!(local_selections[0].head, DisplayPoint::new(5, 0));
dbg!("Hi");
// moves cursor on buffer boundary back two lines // moves cursor on buffer boundary back two lines
// and doesn't allow selection to bleed through // and doesn't allow selection to bleed through
assert_eq!( assert_eq!(

View file

@ -32,10 +32,10 @@ use std::{
}; };
use text::Selection; use text::Selection;
use theme::{ActiveTheme, Theme}; use theme::{ActiveTheme, Theme};
use ui::{Color, Label}; use ui::{h_stack, prelude::*, Label};
use util::{paths::PathExt, paths::FILE_ROW_COLUMN_DELIMITER, ResultExt, TryFutureExt}; use util::{paths::PathExt, paths::FILE_ROW_COLUMN_DELIMITER, ResultExt, TryFutureExt};
use workspace::{ use workspace::{
item::{BreadcrumbText, FollowEvent, FollowableEvents, FollowableItemHandle}, item::{BreadcrumbText, FollowEvent, FollowableItemHandle},
StatusItemView, StatusItemView,
}; };
use workspace::{ use workspace::{
@ -46,27 +46,7 @@ use workspace::{
pub const MAX_TAB_TITLE_LEN: usize = 24; pub const MAX_TAB_TITLE_LEN: usize = 24;
impl FollowableEvents for EditorEvent {
fn to_follow_event(&self) -> Option<workspace::item::FollowEvent> {
match self {
EditorEvent::Edited => Some(FollowEvent::Unfollow),
EditorEvent::SelectionsChanged { local }
| EditorEvent::ScrollPositionChanged { local, .. } => {
if *local {
Some(FollowEvent::Unfollow)
} else {
None
}
}
_ => None,
}
}
}
impl EventEmitter<ItemEvent> for Editor {}
impl FollowableItem for Editor { impl FollowableItem for Editor {
type FollowableEvent = EditorEvent;
fn remote_id(&self) -> Option<ViewId> { fn remote_id(&self) -> Option<ViewId> {
self.remote_id self.remote_id
} }
@ -241,9 +221,24 @@ impl FollowableItem for Editor {
})) }))
} }
fn to_follow_event(event: &EditorEvent) -> Option<workspace::item::FollowEvent> {
match event {
EditorEvent::Edited => Some(FollowEvent::Unfollow),
EditorEvent::SelectionsChanged { local }
| EditorEvent::ScrollPositionChanged { local, .. } => {
if *local {
Some(FollowEvent::Unfollow)
} else {
None
}
}
_ => None,
}
}
fn add_event_to_update_proto( fn add_event_to_update_proto(
&self, &self,
event: &Self::FollowableEvent, event: &EditorEvent,
update: &mut Option<proto::update_view::Variant>, update: &mut Option<proto::update_view::Variant>,
cx: &WindowContext, cx: &WindowContext,
) -> bool { ) -> bool {
@ -528,6 +523,8 @@ fn deserialize_anchor(buffer: &MultiBufferSnapshot, anchor: proto::EditorAnchor)
} }
impl Item for Editor { impl Item for Editor {
type Event = EditorEvent;
fn navigate(&mut self, data: Box<dyn std::any::Any>, cx: &mut ViewContext<Self>) -> bool { fn navigate(&mut self, data: Box<dyn std::any::Any>, cx: &mut ViewContext<Self>) -> bool {
if let Ok(data) = data.downcast::<NavigationData>() { if let Ok(data) = data.downcast::<NavigationData>() {
let newest_selection = self.selections.newest::<Point>(cx); let newest_selection = self.selections.newest::<Point>(cx);
@ -586,28 +583,25 @@ impl Item for Editor {
fn tab_content(&self, detail: Option<usize>, cx: &WindowContext) -> AnyElement { fn tab_content(&self, detail: Option<usize>, cx: &WindowContext) -> AnyElement {
let theme = cx.theme(); let theme = cx.theme();
AnyElement::new( let description = detail.and_then(|detail| {
div()
.flex()
.flex_row()
.items_center()
.gap_2()
.child(Label::new(self.title(cx).to_string()))
.children(detail.and_then(|detail| {
let path = path_for_buffer(&self.buffer, detail, false, cx)?; let path = path_for_buffer(&self.buffer, detail, false, cx)?;
let description = path.to_string_lossy(); let description = path.to_string_lossy();
let description = description.trim();
Some( if description.is_empty() {
div().child( return None;
Label::new(util::truncate_and_trailoff( }
&description,
MAX_TAB_TITLE_LEN, Some(util::truncate_and_trailoff(&description, MAX_TAB_TITLE_LEN))
)) });
.color(Color::Muted),
), h_stack()
) .gap_2()
})), .child(Label::new(self.title(cx).to_string()))
) .when_some(description, |this, description| {
this.child(Label::new(description).color(Color::Muted))
})
.into_any_element()
} }
fn for_each_project_item( fn for_each_project_item(
@ -841,6 +835,40 @@ impl Item for Editor {
Some("Editor") Some("Editor")
} }
fn to_item_events(event: &EditorEvent, mut f: impl FnMut(ItemEvent)) {
match event {
EditorEvent::Closed => f(ItemEvent::CloseItem),
EditorEvent::Saved | EditorEvent::TitleChanged => {
f(ItemEvent::UpdateTab);
f(ItemEvent::UpdateBreadcrumbs);
}
EditorEvent::Reparsed => {
f(ItemEvent::UpdateBreadcrumbs);
}
EditorEvent::SelectionsChanged { local } if *local => {
f(ItemEvent::UpdateBreadcrumbs);
}
EditorEvent::DirtyChanged => {
f(ItemEvent::UpdateTab);
}
EditorEvent::BufferEdited => {
f(ItemEvent::Edit);
f(ItemEvent::UpdateBreadcrumbs);
}
EditorEvent::ExcerptsAdded { .. } | EditorEvent::ExcerptsRemoved { .. } => {
f(ItemEvent::Edit);
}
_ => {}
}
}
fn deserialize( fn deserialize(
project: Model<Project>, project: Model<Project>,
_workspace: WeakView<Workspace>, _workspace: WeakView<Workspace>,
@ -911,7 +939,7 @@ impl SearchableItem for Editor {
fn update_matches(&mut self, matches: Vec<Range<Anchor>>, cx: &mut ViewContext<Self>) { fn update_matches(&mut self, matches: Vec<Range<Anchor>>, cx: &mut ViewContext<Self>) {
self.highlight_background::<BufferSearchHighlights>( self.highlight_background::<BufferSearchHighlights>(
matches, matches,
|theme| theme.title_bar_background, // todo: update theme |theme| theme.search_match_background,
cx, cx,
); );
} }

View file

@ -6,7 +6,7 @@ use gpui::{
}; };
use text::{Bias, Point}; use text::{Bias, Point};
use theme::ActiveTheme; use theme::ActiveTheme;
use ui::{h_stack, v_stack, Color, Label, StyledExt}; use ui::{h_stack, prelude::*, v_stack, Label};
use util::paths::FILE_ROW_COLUMN_DELIMITER; use util::paths::FILE_ROW_COLUMN_DELIMITER;
actions!(Toggle); actions!(Toggle);

View file

@ -15,10 +15,10 @@ use smol::future::FutureExt;
pub use test_context::*; pub use test_context::*;
use crate::{ use crate::{
current_platform, image_cache::ImageCache, Action, ActionRegistry, Any, AnyView, current_platform, image_cache::ImageCache, init_app_menus, Action, ActionRegistry, Any,
AnyWindowHandle, AppMetadata, AssetSource, BackgroundExecutor, ClipboardItem, Context, AnyView, AnyWindowHandle, AppMetadata, AssetSource, BackgroundExecutor, ClipboardItem, Context,
DispatchPhase, DisplayId, Entity, EventEmitter, FocusEvent, FocusHandle, FocusId, DispatchPhase, DisplayId, Entity, EventEmitter, FocusEvent, FocusHandle, FocusId,
ForegroundExecutor, KeyBinding, Keymap, LayoutId, PathPromptOptions, Pixels, Platform, ForegroundExecutor, KeyBinding, Keymap, LayoutId, Menu, PathPromptOptions, Pixels, Platform,
PlatformDisplay, Point, Render, SharedString, SubscriberSet, Subscription, SvgRenderer, Task, PlatformDisplay, Point, Render, SharedString, SubscriberSet, Subscription, SvgRenderer, Task,
TextStyle, TextStyleRefinement, TextSystem, View, ViewContext, Window, WindowContext, TextStyle, TextStyleRefinement, TextSystem, View, ViewContext, Window, WindowContext,
WindowHandle, WindowId, WindowHandle, WindowId,
@ -39,7 +39,10 @@ use std::{
sync::{atomic::Ordering::SeqCst, Arc}, sync::{atomic::Ordering::SeqCst, Arc},
time::Duration, time::Duration,
}; };
use util::http::{self, HttpClient}; use util::{
http::{self, HttpClient},
ResultExt,
};
/// Temporary(?) wrapper around RefCell<AppContext> to help us debug any double borrows. /// Temporary(?) wrapper around RefCell<AppContext> to help us debug any double borrows.
/// Strongly consider removing after stabilization. /// Strongly consider removing after stabilization.
@ -201,7 +204,7 @@ pub struct AppContext {
pub(crate) windows: SlotMap<WindowId, Option<Window>>, pub(crate) windows: SlotMap<WindowId, Option<Window>>,
pub(crate) keymap: Arc<Mutex<Keymap>>, pub(crate) keymap: Arc<Mutex<Keymap>>,
pub(crate) global_action_listeners: pub(crate) global_action_listeners:
HashMap<TypeId, Vec<Box<dyn Fn(&dyn Action, DispatchPhase, &mut Self)>>>, HashMap<TypeId, Vec<Rc<dyn Fn(&dyn Any, DispatchPhase, &mut Self)>>>,
pending_effects: VecDeque<Effect>, pending_effects: VecDeque<Effect>,
pub(crate) pending_notifications: HashSet<EntityId>, pub(crate) pending_notifications: HashSet<EntityId>,
pub(crate) pending_global_notifications: HashSet<TypeId>, pub(crate) pending_global_notifications: HashSet<TypeId>,
@ -275,6 +278,8 @@ impl AppContext {
}), }),
}); });
init_app_menus(platform.as_ref(), &mut *app.borrow_mut());
platform.on_quit(Box::new({ platform.on_quit(Box::new({
let cx = app.clone(); let cx = app.clone();
move || { move || {
@ -425,6 +430,10 @@ impl AppContext {
.collect() .collect()
} }
pub fn active_window(&self) -> Option<AnyWindowHandle> {
self.platform.active_window()
}
/// Opens a new window with the given option and the root view returned by the given function. /// Opens a new window with the given option and the root view returned by the given function.
/// The function is invoked with a `WindowContext`, which can be used to interact with window-specific /// The function is invoked with a `WindowContext`, which can be used to interact with window-specific
/// functionality. /// functionality.
@ -851,7 +860,6 @@ impl AppContext {
} }
/// Remove the global of the given type from the app context. Does not notify global observers. /// Remove the global of the given type from the app context. Does not notify global observers.
#[cfg(any(test, feature = "test-support"))]
pub fn remove_global<G: Any>(&mut self) -> G { pub fn remove_global<G: Any>(&mut self) -> G {
let global_type = TypeId::of::<G>(); let global_type = TypeId::of::<G>();
*self *self
@ -962,9 +970,9 @@ impl AppContext {
self.global_action_listeners self.global_action_listeners
.entry(TypeId::of::<A>()) .entry(TypeId::of::<A>())
.or_default() .or_default()
.push(Box::new(move |action, phase, cx| { .push(Rc::new(move |action, phase, cx| {
if phase == DispatchPhase::Bubble { if phase == DispatchPhase::Bubble {
let action = action.as_any().downcast_ref().unwrap(); let action = action.downcast_ref().unwrap();
listener(action, cx) listener(action, cx)
} }
})); }));
@ -1015,6 +1023,90 @@ impl AppContext {
activate(); activate();
subscription subscription
} }
pub(crate) fn clear_pending_keystrokes(&mut self) {
for window in self.windows() {
window
.update(self, |_, cx| {
cx.window
.current_frame
.dispatch_tree
.clear_pending_keystrokes()
})
.ok();
}
}
pub fn is_action_available(&mut self, action: &dyn Action) -> bool {
if let Some(window) = self.active_window() {
if let Ok(window_action_available) =
window.update(self, |_, cx| cx.is_action_available(action))
{
return window_action_available;
}
}
self.global_action_listeners
.contains_key(&action.as_any().type_id())
}
pub fn set_menus(&mut self, menus: Vec<Menu>) {
self.platform.set_menus(menus, &self.keymap.lock());
}
pub fn dispatch_action(&mut self, action: &dyn Action) {
if let Some(active_window) = self.active_window() {
active_window
.update(self, |_, cx| cx.dispatch_action(action.boxed_clone()))
.log_err();
} else {
self.propagate_event = true;
if let Some(mut global_listeners) = self
.global_action_listeners
.remove(&action.as_any().type_id())
{
for listener in &global_listeners {
listener(action.as_any(), DispatchPhase::Capture, self);
if !self.propagate_event {
break;
}
}
global_listeners.extend(
self.global_action_listeners
.remove(&action.as_any().type_id())
.unwrap_or_default(),
);
self.global_action_listeners
.insert(action.as_any().type_id(), global_listeners);
}
if self.propagate_event {
if let Some(mut global_listeners) = self
.global_action_listeners
.remove(&action.as_any().type_id())
{
for listener in global_listeners.iter().rev() {
listener(action.as_any(), DispatchPhase::Bubble, self);
if !self.propagate_event {
break;
}
}
global_listeners.extend(
self.global_action_listeners
.remove(&action.as_any().type_id())
.unwrap_or_default(),
);
self.global_action_listeners
.insert(action.as_any().type_id(), global_listeners);
}
}
}
}
} }
impl Context for AppContext { impl Context for AppContext {

View file

@ -1,9 +1,10 @@
use crate::{ use crate::{
div, Action, AnyView, AnyWindowHandle, AppCell, AppContext, AsyncAppContext, div, Action, AnyView, AnyWindowHandle, AppCell, AppContext, AsyncAppContext,
BackgroundExecutor, Bounds, Context, Div, Entity, EventEmitter, ForegroundExecutor, InputEvent, BackgroundExecutor, Bounds, ClipboardItem, Context, Div, Entity, EventEmitter,
KeyDownEvent, Keystroke, Model, ModelContext, Pixels, PlatformWindow, Point, Render, Result, ForegroundExecutor, InputEvent, KeyDownEvent, Keystroke, Model, ModelContext, Pixels, Platform,
Size, Task, TestDispatcher, TestPlatform, TestWindow, TestWindowHandlers, View, ViewContext, PlatformWindow, Point, Render, Result, Size, Task, TestDispatcher, TestPlatform, TestWindow,
VisualContext, WindowBounds, WindowContext, WindowHandle, WindowOptions, TestWindowHandlers, TextSystem, View, ViewContext, VisualContext, WindowBounds, WindowContext,
WindowHandle, WindowOptions,
}; };
use anyhow::{anyhow, bail}; use anyhow::{anyhow, bail};
use futures::{Stream, StreamExt}; use futures::{Stream, StreamExt};
@ -16,6 +17,7 @@ pub struct TestAppContext {
pub foreground_executor: ForegroundExecutor, pub foreground_executor: ForegroundExecutor,
pub dispatcher: TestDispatcher, pub dispatcher: TestDispatcher,
pub test_platform: Rc<TestPlatform>, pub test_platform: Rc<TestPlatform>,
text_system: Arc<TextSystem>,
} }
impl Context for TestAppContext { impl Context for TestAppContext {
@ -82,6 +84,7 @@ impl TestAppContext {
let platform = TestPlatform::new(background_executor.clone(), foreground_executor.clone()); let platform = TestPlatform::new(background_executor.clone(), foreground_executor.clone());
let asset_source = Arc::new(()); let asset_source = Arc::new(());
let http_client = util::http::FakeHttpClient::with_404_response(); let http_client = util::http::FakeHttpClient::with_404_response();
let text_system = Arc::new(TextSystem::new(platform.text_system()));
Self { Self {
app: AppContext::new(platform.clone(), asset_source, http_client), app: AppContext::new(platform.clone(), asset_source, http_client),
@ -89,6 +92,7 @@ impl TestAppContext {
foreground_executor, foreground_executor,
dispatcher: dispatcher.clone(), dispatcher: dispatcher.clone(),
test_platform: platform, test_platform: platform,
text_system,
} }
} }
@ -155,6 +159,18 @@ impl TestAppContext {
(view, Box::leak(cx)) (view, Box::leak(cx))
} }
pub fn text_system(&self) -> &Arc<TextSystem> {
&self.text_system
}
pub fn write_to_clipboard(&self, item: ClipboardItem) {
self.test_platform.write_to_clipboard(item)
}
pub fn read_from_clipboard(&self) -> Option<ClipboardItem> {
self.test_platform.read_from_clipboard()
}
pub fn simulate_new_path_selection( pub fn simulate_new_path_selection(
&self, &self,
select_path: impl FnOnce(&std::path::Path) -> Option<std::path::PathBuf>, select_path: impl FnOnce(&std::path::Path) -> Option<std::path::PathBuf>,
@ -529,6 +545,10 @@ pub struct VisualTestContext<'a> {
} }
impl<'a> VisualTestContext<'a> { impl<'a> VisualTestContext<'a> {
pub fn update<R>(&mut self, f: impl FnOnce(&mut WindowContext) -> R) -> R {
self.cx.update_window(self.window, |_, cx| f(cx)).unwrap()
}
pub fn from_window(window: AnyWindowHandle, cx: &'a mut TestAppContext) -> Self { pub fn from_window(window: AnyWindowHandle, cx: &'a mut TestAppContext) -> Self {
Self { cx, window } Self { cx, window }
} }

View file

@ -388,39 +388,6 @@ impl<E: Element> DrawableElement<E> {
} }
} }
// impl<V: 'static, E: Element> Element for DrawableElement<V, E> {
// type State = <E::Element as Element>::State;
// fn layout(
// &mut self,
// element_state: Option<Self::State>,
// cx: &mut WindowContext,
// ) -> (LayoutId, Self::State) {
// }
// fn paint(
// self,
// bounds: Bounds<Pixels>,
// element_state: &mut Self::State,
// cx: &mut WindowContext,
// ) {
// todo!()
// }
// }
// impl<V: 'static, E: 'static + Element> RenderOnce for DrawableElement<V, E> {
// type Element = Self;
// fn element_id(&self) -> Option<ElementId> {
// self.element.as_ref()?.element_id()
// }
// fn render_once(self) -> Self::Element {
// self
// }
// }
impl<E> ElementObject for Option<DrawableElement<E>> impl<E> ElementObject for Option<DrawableElement<E>>
where where
E: Element, E: Element,

View file

@ -1,9 +1,11 @@
use crate::{Bounds, Element, IntoElement, Pixels, StyleRefinement, Styled, WindowContext}; use refineable::Refineable as _;
use crate::{Bounds, Element, IntoElement, Pixels, Style, StyleRefinement, Styled, WindowContext};
pub fn canvas(callback: impl 'static + FnOnce(Bounds<Pixels>, &mut WindowContext)) -> Canvas { pub fn canvas(callback: impl 'static + FnOnce(Bounds<Pixels>, &mut WindowContext)) -> Canvas {
Canvas { Canvas {
paint_callback: Box::new(callback), paint_callback: Box::new(callback),
style: Default::default(), style: StyleRefinement::default(),
} }
} }
@ -32,7 +34,9 @@ impl Element for Canvas {
_: Option<Self::State>, _: Option<Self::State>,
cx: &mut WindowContext, cx: &mut WindowContext,
) -> (crate::LayoutId, Self::State) { ) -> (crate::LayoutId, Self::State) {
let layout_id = cx.request_layout(&self.style.clone().into(), []); let mut style = Style::default();
style.refine(&self.style);
let layout_id = cx.request_layout(&style, []);
(layout_id, ()) (layout_id, ())
} }

View file

@ -55,7 +55,7 @@ pub trait InteractiveElement: Sized + Element {
E: Debug, E: Debug,
{ {
if let Some(key_context) = key_context.try_into().log_err() { if let Some(key_context) = key_context.try_into().log_err() {
self.interactivity().key_context = key_context; self.interactivity().key_context = Some(key_context);
} }
self self
} }
@ -559,6 +559,8 @@ pub type KeyDownListener = Box<dyn Fn(&KeyDownEvent, DispatchPhase, &mut WindowC
pub type KeyUpListener = Box<dyn Fn(&KeyUpEvent, DispatchPhase, &mut WindowContext) + 'static>; pub type KeyUpListener = Box<dyn Fn(&KeyUpEvent, DispatchPhase, &mut WindowContext) + 'static>;
pub type DragEventListener = Box<dyn Fn(&MouseMoveEvent, &mut WindowContext) + 'static>;
pub type ActionListener = Box<dyn Fn(&dyn Any, DispatchPhase, &mut WindowContext) + 'static>; pub type ActionListener = Box<dyn Fn(&dyn Any, DispatchPhase, &mut WindowContext) + 'static>;
pub fn div() -> Div { pub fn div() -> Div {
@ -722,7 +724,7 @@ impl DivState {
pub struct Interactivity { pub struct Interactivity {
pub element_id: Option<ElementId>, pub element_id: Option<ElementId>,
pub key_context: KeyContext, pub key_context: Option<KeyContext>,
pub focusable: bool, pub focusable: bool,
pub tracked_focus_handle: Option<FocusHandle>, pub tracked_focus_handle: Option<FocusHandle>,
pub scroll_handle: Option<ScrollHandle>, pub scroll_handle: Option<ScrollHandle>,
@ -751,7 +753,7 @@ pub struct Interactivity {
pub tooltip_builder: Option<TooltipBuilder>, pub tooltip_builder: Option<TooltipBuilder>,
} }
#[derive(Clone)] #[derive(Clone, Debug)]
pub struct InteractiveBounds { pub struct InteractiveBounds {
pub bounds: Bounds<Pixels>, pub bounds: Bounds<Pixels>,
pub stacking_order: StackingOrder, pub stacking_order: StackingOrder,
@ -899,11 +901,14 @@ impl Interactivity {
.active_drag .active_drag
.take() .take()
.expect("checked for type drag state type above"); .expect("checked for type drag state type above");
listener(drag.view.clone(), cx); listener(drag.view.clone(), cx);
cx.notify(); cx.notify();
cx.stop_propagation(); cx.stop_propagation();
} }
} }
} else {
cx.active_drag = None;
} }
} }
}); });
@ -1238,7 +1243,7 @@ impl Default for Interactivity {
fn default() -> Self { fn default() -> Self {
Self { Self {
element_id: None, element_id: None,
key_context: KeyContext::default(), key_context: None,
focusable: false, focusable: false,
tracked_focus_handle: None, tracked_focus_handle: None,
scroll_handle: None, scroll_handle: None,
@ -1324,7 +1329,7 @@ impl GroupBounds {
} }
pub struct Focusable<E> { pub struct Focusable<E> {
element: E, pub element: E,
} }
impl<E: InteractiveElement> FocusableElement for Focusable<E> {} impl<E: InteractiveElement> FocusableElement for Focusable<E> {}

View file

@ -102,7 +102,7 @@ impl Element for Overlay {
let mut desired = self.anchor_corner.get_bounds(origin, size); let mut desired = self.anchor_corner.get_bounds(origin, size);
let limits = Bounds { let limits = Bounds {
origin: Point::zero(), origin: Point::default(),
size: cx.viewport_size(), size: cx.viewport_size(),
}; };

File diff suppressed because it is too large Load diff

View file

@ -28,7 +28,7 @@ pub(crate) struct DispatchTree {
pub(crate) struct DispatchNode { pub(crate) struct DispatchNode {
pub key_listeners: SmallVec<[KeyListener; 2]>, pub key_listeners: SmallVec<[KeyListener; 2]>,
pub action_listeners: SmallVec<[DispatchActionListener; 16]>, pub action_listeners: SmallVec<[DispatchActionListener; 16]>,
pub context: KeyContext, pub context: Option<KeyContext>,
parent: Option<DispatchNodeId>, parent: Option<DispatchNodeId>,
} }
@ -61,7 +61,7 @@ impl DispatchTree {
self.keystroke_matchers.clear(); self.keystroke_matchers.clear();
} }
pub fn push_node(&mut self, context: KeyContext) { pub fn push_node(&mut self, context: Option<KeyContext>) {
let parent = self.node_stack.last().copied(); let parent = self.node_stack.last().copied();
let node_id = DispatchNodeId(self.nodes.len()); let node_id = DispatchNodeId(self.nodes.len());
self.nodes.push(DispatchNode { self.nodes.push(DispatchNode {
@ -69,34 +69,34 @@ impl DispatchTree {
..Default::default() ..Default::default()
}); });
self.node_stack.push(node_id); self.node_stack.push(node_id);
if !context.is_empty() { if let Some(context) = context {
self.active_node().context = context.clone(); self.active_node().context = Some(context.clone());
self.context_stack.push(context); self.context_stack.push(context);
} }
} }
pub fn pop_node(&mut self) { pub fn pop_node(&mut self) {
let node_id = self.node_stack.pop().unwrap(); let node_id = self.node_stack.pop().unwrap();
if !self.nodes[node_id.0].context.is_empty() { if self.nodes[node_id.0].context.is_some() {
self.context_stack.pop(); self.context_stack.pop();
} }
} }
pub fn clear_keystroke_matchers(&mut self) { pub fn clear_pending_keystrokes(&mut self) {
self.keystroke_matchers.clear(); self.keystroke_matchers.clear();
} }
/// Preserve keystroke matchers from previous frames to support multi-stroke /// Preserve keystroke matchers from previous frames to support multi-stroke
/// bindings across multiple frames. /// bindings across multiple frames.
pub fn preserve_keystroke_matchers(&mut self, old_tree: &mut Self, focus_id: Option<FocusId>) { pub fn preserve_pending_keystrokes(&mut self, old_tree: &mut Self, focus_id: Option<FocusId>) {
if let Some(node_id) = focus_id.and_then(|focus_id| self.focusable_node_id(focus_id)) { if let Some(node_id) = focus_id.and_then(|focus_id| self.focusable_node_id(focus_id)) {
let dispatch_path = self.dispatch_path(node_id); let dispatch_path = self.dispatch_path(node_id);
self.context_stack.clear(); self.context_stack.clear();
for node_id in dispatch_path { for node_id in dispatch_path {
let node = self.node(node_id); let node = self.node(node_id);
if !node.context.is_empty() { if let Some(context) = node.context.clone() {
self.context_stack.push(node.context.clone()); self.context_stack.push(context);
} }
if let Some((context_stack, matcher)) = old_tree if let Some((context_stack, matcher)) = old_tree
@ -148,10 +148,9 @@ impl DispatchTree {
false false
} }
pub fn available_actions(&self, target: FocusId) -> Vec<Box<dyn Action>> { pub fn available_actions(&self, target: DispatchNodeId) -> Vec<Box<dyn Action>> {
let mut actions = Vec::new(); let mut actions = Vec::new();
if let Some(node) = self.focusable_node_ids.get(&target) { for node_id in self.dispatch_path(target) {
for node_id in self.dispatch_path(*node) {
let node = &self.nodes[node_id.0]; let node = &self.nodes[node_id.0];
for DispatchActionListener { action_type, .. } in &node.action_listeners { for DispatchActionListener { action_type, .. } in &node.action_listeners {
// Intentionally silence these errors without logging. // Intentionally silence these errors without logging.
@ -159,10 +158,23 @@ impl DispatchTree {
actions.extend(self.action_registry.build_action_type(action_type).ok()); actions.extend(self.action_registry.build_action_type(action_type).ok());
} }
} }
}
actions actions
} }
pub fn is_action_available(&self, action: &dyn Action, target: DispatchNodeId) -> bool {
for node_id in self.dispatch_path(target) {
let node = &self.nodes[node_id.0];
if node
.action_listeners
.iter()
.any(|listener| listener.action_type == action.as_any().type_id())
{
return true;
}
}
false
}
pub fn bindings_for_action( pub fn bindings_for_action(
&self, &self,
action: &dyn Action, action: &dyn Action,
@ -236,6 +248,11 @@ impl DispatchTree {
self.focusable_node_ids.get(&target).copied() self.focusable_node_ids.get(&target).copied()
} }
pub fn root_node_id(&self) -> DispatchNodeId {
debug_assert!(!self.nodes.is_empty());
DispatchNodeId(0)
}
fn active_node_id(&self) -> DispatchNodeId { fn active_node_id(&self) -> DispatchNodeId {
*self.node_stack.last().unwrap() *self.node_stack.last().unwrap()
} }

View file

@ -1,3 +1,4 @@
mod app_menu;
mod keystroke; mod keystroke;
#[cfg(target_os = "macos")] #[cfg(target_os = "macos")]
mod mac; mod mac;
@ -5,10 +6,10 @@ mod mac;
mod test; mod test;
use crate::{ use crate::{
point, size, AnyWindowHandle, BackgroundExecutor, Bounds, DevicePixels, Font, FontId, point, size, Action, AnyWindowHandle, BackgroundExecutor, Bounds, DevicePixels, Font, FontId,
FontMetrics, FontRun, ForegroundExecutor, GlobalPixels, GlyphId, InputEvent, LineLayout, FontMetrics, FontRun, ForegroundExecutor, GlobalPixels, GlyphId, InputEvent, Keymap,
Pixels, Point, RenderGlyphParams, RenderImageParams, RenderSvgParams, Result, Scene, LineLayout, Pixels, Point, RenderGlyphParams, RenderImageParams, RenderSvgParams, Result,
SharedString, Size, TaskLabel, Scene, SharedString, Size, TaskLabel,
}; };
use anyhow::{anyhow, bail}; use anyhow::{anyhow, bail};
use async_task::Runnable; use async_task::Runnable;
@ -32,6 +33,7 @@ use std::{
}; };
use uuid::Uuid; use uuid::Uuid;
pub use app_menu::*;
pub use keystroke::*; pub use keystroke::*;
#[cfg(target_os = "macos")] #[cfg(target_os = "macos")]
pub use mac::*; pub use mac::*;
@ -44,7 +46,7 @@ pub(crate) fn current_platform() -> Rc<dyn Platform> {
Rc::new(MacPlatform::new()) Rc::new(MacPlatform::new())
} }
pub trait Platform: 'static { pub(crate) trait Platform: 'static {
fn background_executor(&self) -> BackgroundExecutor; fn background_executor(&self) -> BackgroundExecutor;
fn foreground_executor(&self) -> ForegroundExecutor; fn foreground_executor(&self) -> ForegroundExecutor;
fn text_system(&self) -> Arc<dyn PlatformTextSystem>; fn text_system(&self) -> Arc<dyn PlatformTextSystem>;
@ -59,7 +61,7 @@ pub trait Platform: 'static {
fn displays(&self) -> Vec<Rc<dyn PlatformDisplay>>; fn displays(&self) -> Vec<Rc<dyn PlatformDisplay>>;
fn display(&self, id: DisplayId) -> Option<Rc<dyn PlatformDisplay>>; fn display(&self, id: DisplayId) -> Option<Rc<dyn PlatformDisplay>>;
fn main_window(&self) -> Option<AnyWindowHandle>; fn active_window(&self) -> Option<AnyWindowHandle>;
fn open_window( fn open_window(
&self, &self,
handle: AnyWindowHandle, handle: AnyWindowHandle,
@ -90,6 +92,11 @@ pub trait Platform: 'static {
fn on_reopen(&self, callback: Box<dyn FnMut()>); fn on_reopen(&self, callback: Box<dyn FnMut()>);
fn on_event(&self, callback: Box<dyn FnMut(InputEvent) -> bool>); fn on_event(&self, callback: Box<dyn FnMut(InputEvent) -> bool>);
fn set_menus(&self, menus: Vec<Menu>, keymap: &Keymap);
fn on_app_menu_action(&self, callback: Box<dyn FnMut(&dyn Action)>);
fn on_will_open_app_menu(&self, callback: Box<dyn FnMut()>);
fn on_validate_app_menu_command(&self, callback: Box<dyn FnMut(&dyn Action) -> bool>);
fn os_name(&self) -> &'static str; fn os_name(&self) -> &'static str;
fn os_version(&self) -> Result<SemanticVersion>; fn os_version(&self) -> Result<SemanticVersion>;
fn app_version(&self) -> Result<SemanticVersion>; fn app_version(&self) -> Result<SemanticVersion>;
@ -138,6 +145,7 @@ pub trait PlatformWindow {
fn mouse_position(&self) -> Point<Pixels>; fn mouse_position(&self) -> Point<Pixels>;
fn as_any_mut(&mut self) -> &mut dyn Any; fn as_any_mut(&mut self) -> &mut dyn Any;
fn set_input_handler(&mut self, input_handler: Box<dyn PlatformInputHandler>); fn set_input_handler(&mut self, input_handler: Box<dyn PlatformInputHandler>);
fn clear_input_handler(&mut self);
fn prompt(&self, level: PromptLevel, msg: &str, answers: &[&str]) -> oneshot::Receiver<usize>; fn prompt(&self, level: PromptLevel, msg: &str, answers: &[&str]) -> oneshot::Receiver<usize>;
fn activate(&self); fn activate(&self);
fn set_title(&mut self, title: &str); fn set_title(&mut self, title: &str);

View file

@ -0,0 +1,77 @@
use crate::{Action, AppContext, Platform};
use util::ResultExt;
pub struct Menu<'a> {
pub name: &'a str,
pub items: Vec<MenuItem<'a>>,
}
pub enum MenuItem<'a> {
Separator,
Submenu(Menu<'a>),
Action {
name: &'a str,
action: Box<dyn Action>,
os_action: Option<OsAction>,
},
}
impl<'a> MenuItem<'a> {
pub fn separator() -> Self {
Self::Separator
}
pub fn submenu(menu: Menu<'a>) -> Self {
Self::Submenu(menu)
}
pub fn action(name: &'a str, action: impl Action) -> Self {
Self::Action {
name,
action: Box::new(action),
os_action: None,
}
}
pub fn os_action(name: &'a str, action: impl Action, os_action: OsAction) -> Self {
Self::Action {
name,
action: Box::new(action),
os_action: Some(os_action),
}
}
}
#[derive(Copy, Clone, Eq, PartialEq)]
pub enum OsAction {
Cut,
Copy,
Paste,
SelectAll,
Undo,
Redo,
}
pub(crate) fn init_app_menus(platform: &dyn Platform, cx: &mut AppContext) {
platform.on_will_open_app_menu(Box::new({
let cx = cx.to_async();
move || {
cx.update(|cx| cx.clear_pending_keystrokes()).ok();
}
}));
platform.on_validate_app_menu_command(Box::new({
let cx = cx.to_async();
move |action| {
cx.update(|cx| cx.is_action_available(action))
.unwrap_or(false)
}
}));
platform.on_app_menu_action(Box::new({
let cx = cx.to_async();
move |action| {
cx.update(|cx| cx.dispatch_action(action)).log_err();
}
}));
}

View file

@ -7,6 +7,7 @@ use std::{
use crate::DisplayId; use crate::DisplayId;
use collections::HashMap; use collections::HashMap;
use parking_lot::Mutex; use parking_lot::Mutex;
pub use sys::CVSMPTETime as SmtpeTime;
pub use sys::CVTimeStamp as VideoTimestamp; pub use sys::CVTimeStamp as VideoTimestamp;
pub(crate) struct MacDisplayLinker { pub(crate) struct MacDisplayLinker {
@ -153,7 +154,7 @@ mod sys {
kCVTimeStampTopField | kCVTimeStampBottomField; kCVTimeStampTopField | kCVTimeStampBottomField;
#[repr(C)] #[repr(C)]
#[derive(Clone, Copy)] #[derive(Clone, Copy, Default)]
pub struct CVSMPTETime { pub struct CVSMPTETime {
pub subframes: i16, pub subframes: i16,
pub subframe_divisor: i16, pub subframe_divisor: i16,

View file

@ -1,18 +1,19 @@
use super::BoolExt; use super::{events::key_to_native, BoolExt};
use crate::{ use crate::{
AnyWindowHandle, BackgroundExecutor, ClipboardItem, CursorStyle, DisplayId, ForegroundExecutor, Action, AnyWindowHandle, BackgroundExecutor, ClipboardItem, CursorStyle, DisplayId,
InputEvent, MacDispatcher, MacDisplay, MacDisplayLinker, MacTextSystem, MacWindow, ForegroundExecutor, InputEvent, Keymap, MacDispatcher, MacDisplay, MacDisplayLinker,
PathPromptOptions, Platform, PlatformDisplay, PlatformTextSystem, PlatformWindow, Result, MacTextSystem, MacWindow, Menu, MenuItem, PathPromptOptions, Platform, PlatformDisplay,
SemanticVersion, VideoTimestamp, WindowOptions, PlatformTextSystem, PlatformWindow, Result, SemanticVersion, VideoTimestamp, WindowOptions,
}; };
use anyhow::anyhow; use anyhow::anyhow;
use block::ConcreteBlock; use block::ConcreteBlock;
use cocoa::{ use cocoa::{
appkit::{ appkit::{
NSApplication, NSApplicationActivationPolicy::NSApplicationActivationPolicyRegular, NSApplication, NSApplicationActivationPolicy::NSApplicationActivationPolicyRegular,
NSModalResponse, NSOpenPanel, NSPasteboard, NSPasteboardTypeString, NSSavePanel, NSWindow, NSEventModifierFlags, NSMenu, NSMenuItem, NSModalResponse, NSOpenPanel, NSPasteboard,
NSPasteboardTypeString, NSSavePanel, NSWindow,
}, },
base::{id, nil, BOOL, YES}, base::{id, nil, selector, BOOL, YES},
foundation::{ foundation::{
NSArray, NSAutoreleasePool, NSBundle, NSData, NSInteger, NSProcessInfo, NSString, NSArray, NSAutoreleasePool, NSBundle, NSData, NSInteger, NSProcessInfo, NSString,
NSUInteger, NSURL, NSUInteger, NSURL,
@ -155,12 +156,12 @@ pub struct MacPlatformState {
reopen: Option<Box<dyn FnMut()>>, reopen: Option<Box<dyn FnMut()>>,
quit: Option<Box<dyn FnMut()>>, quit: Option<Box<dyn FnMut()>>,
event: Option<Box<dyn FnMut(InputEvent) -> bool>>, event: Option<Box<dyn FnMut(InputEvent) -> bool>>,
// menu_command: Option<Box<dyn FnMut(&dyn Action)>>, menu_command: Option<Box<dyn FnMut(&dyn Action)>>,
// validate_menu_command: Option<Box<dyn FnMut(&dyn Action) -> bool>>, validate_menu_command: Option<Box<dyn FnMut(&dyn Action) -> bool>>,
will_open_menu: Option<Box<dyn FnMut()>>, will_open_menu: Option<Box<dyn FnMut()>>,
menu_actions: Vec<Box<dyn Action>>,
open_urls: Option<Box<dyn FnMut(Vec<String>)>>, open_urls: Option<Box<dyn FnMut(Vec<String>)>>,
finish_launching: Option<Box<dyn FnOnce()>>, finish_launching: Option<Box<dyn FnOnce()>>,
// menu_actions: Vec<Box<dyn Action>>,
} }
impl MacPlatform { impl MacPlatform {
@ -179,12 +180,12 @@ impl MacPlatform {
reopen: None, reopen: None,
quit: None, quit: None,
event: None, event: None,
menu_command: None,
validate_menu_command: None,
will_open_menu: None, will_open_menu: None,
menu_actions: Default::default(),
open_urls: None, open_urls: None,
finish_launching: None, finish_launching: None,
// menu_command: None,
// validate_menu_command: None,
// menu_actions: Default::default(),
})) }))
} }
@ -200,151 +201,153 @@ impl MacPlatform {
} }
} }
// unsafe fn create_menu_bar( unsafe fn create_menu_bar(
// &self, &self,
// menus: Vec<Menu>, menus: Vec<Menu>,
// delegate: id, delegate: id,
// actions: &mut Vec<Box<dyn Action>>, actions: &mut Vec<Box<dyn Action>>,
// keystroke_matcher: &KeymapMatcher, keymap: &Keymap,
// ) -> id { ) -> id {
// let application_menu = NSMenu::new(nil).autorelease(); let application_menu = NSMenu::new(nil).autorelease();
// application_menu.setDelegate_(delegate); application_menu.setDelegate_(delegate);
// for menu_config in menus { for menu_config in menus {
// let menu = NSMenu::new(nil).autorelease(); let menu = NSMenu::new(nil).autorelease();
// menu.setTitle_(ns_string(menu_config.name)); menu.setTitle_(ns_string(menu_config.name));
// menu.setDelegate_(delegate); menu.setDelegate_(delegate);
// for item_config in menu_config.items { for item_config in menu_config.items {
// menu.addItem_(self.create_menu_item( menu.addItem_(self.create_menu_item(item_config, delegate, actions, keymap));
// item_config, }
// delegate,
// actions,
// keystroke_matcher,
// ));
// }
// let menu_item = NSMenuItem::new(nil).autorelease(); let menu_item = NSMenuItem::new(nil).autorelease();
// menu_item.setSubmenu_(menu); menu_item.setSubmenu_(menu);
// application_menu.addItem_(menu_item); application_menu.addItem_(menu_item);
// if menu_config.name == "Window" { if menu_config.name == "Window" {
// let app: id = msg_send![APP_CLASS, sharedApplication]; let app: id = msg_send![APP_CLASS, sharedApplication];
// app.setWindowsMenu_(menu); app.setWindowsMenu_(menu);
// } }
// } }
// application_menu application_menu
// } }
// unsafe fn create_menu_item( unsafe fn create_menu_item(
// &self, &self,
// item: MenuItem, item: MenuItem,
// delegate: id, delegate: id,
// actions: &mut Vec<Box<dyn Action>>, actions: &mut Vec<Box<dyn Action>>,
// keystroke_matcher: &KeymapMatcher, keymap: &Keymap,
// ) -> id { ) -> id {
// match item { match item {
// MenuItem::Separator => NSMenuItem::separatorItem(nil), MenuItem::Separator => NSMenuItem::separatorItem(nil),
// MenuItem::Action { MenuItem::Action {
// name, name,
// action, action,
// os_action, os_action,
// } => { } => {
// // TODO let keystrokes = keymap
// let keystrokes = keystroke_matcher .bindings_for_action(action.type_id())
// .bindings_for_action(action.id()) .find(|binding| binding.action().partial_eq(action.as_ref()))
// .find(|binding| binding.action().eq(action.as_ref())) .map(|binding| binding.keystrokes());
// .map(|binding| binding.keystrokes());
// let selector = match os_action {
// Some(crate::OsAction::Cut) => selector("cut:"),
// Some(crate::OsAction::Copy) => selector("copy:"),
// Some(crate::OsAction::Paste) => selector("paste:"),
// Some(crate::OsAction::SelectAll) => selector("selectAll:"),
// Some(crate::OsAction::Undo) => selector("undo:"),
// Some(crate::OsAction::Redo) => selector("redo:"),
// None => selector("handleGPUIMenuItem:"),
// };
// let item; let selector = match os_action {
// if let Some(keystrokes) = keystrokes { Some(crate::OsAction::Cut) => selector("cut:"),
// if keystrokes.len() == 1 { Some(crate::OsAction::Copy) => selector("copy:"),
// let keystroke = &keystrokes[0]; Some(crate::OsAction::Paste) => selector("paste:"),
// let mut mask = NSEventModifierFlags::empty(); Some(crate::OsAction::SelectAll) => selector("selectAll:"),
// for (modifier, flag) in &[ Some(crate::OsAction::Undo) => selector("undo:"),
// (keystroke.cmd, NSEventModifierFlags::NSCommandKeyMask), Some(crate::OsAction::Redo) => selector("redo:"),
// (keystroke.ctrl, NSEventModifierFlags::NSControlKeyMask), None => selector("handleGPUIMenuItem:"),
// (keystroke.alt, NSEventModifierFlags::NSAlternateKeyMask), };
// (keystroke.shift, NSEventModifierFlags::NSShiftKeyMask),
// ] {
// if *modifier {
// mask |= *flag;
// }
// }
// item = NSMenuItem::alloc(nil) let item;
// .initWithTitle_action_keyEquivalent_( if let Some(keystrokes) = keystrokes {
// ns_string(name), if keystrokes.len() == 1 {
// selector, let keystroke = &keystrokes[0];
// ns_string(key_to_native(&keystroke.key).as_ref()), let mut mask = NSEventModifierFlags::empty();
// ) for (modifier, flag) in &[
// .autorelease(); (
// item.setKeyEquivalentModifierMask_(mask); keystroke.modifiers.command,
// } NSEventModifierFlags::NSCommandKeyMask,
// // For multi-keystroke bindings, render the keystroke as part of the title. ),
// else { (
// use std::fmt::Write; keystroke.modifiers.control,
NSEventModifierFlags::NSControlKeyMask,
),
(
keystroke.modifiers.alt,
NSEventModifierFlags::NSAlternateKeyMask,
),
(
keystroke.modifiers.shift,
NSEventModifierFlags::NSShiftKeyMask,
),
] {
if *modifier {
mask |= *flag;
}
}
// let mut name = format!("{name} ["); item = NSMenuItem::alloc(nil)
// for (i, keystroke) in keystrokes.iter().enumerate() { .initWithTitle_action_keyEquivalent_(
// if i > 0 { ns_string(name),
// name.push(' '); selector,
// } ns_string(key_to_native(&keystroke.key).as_ref()),
// write!(&mut name, "{}", keystroke).unwrap(); )
// } .autorelease();
// name.push(']'); item.setKeyEquivalentModifierMask_(mask);
}
// For multi-keystroke bindings, render the keystroke as part of the title.
else {
use std::fmt::Write;
// item = NSMenuItem::alloc(nil) let mut name = format!("{name} [");
// .initWithTitle_action_keyEquivalent_( for (i, keystroke) in keystrokes.iter().enumerate() {
// ns_string(&name), if i > 0 {
// selector, name.push(' ');
// ns_string(""), }
// ) write!(&mut name, "{}", keystroke).unwrap();
// .autorelease(); }
// } name.push(']');
// } else {
// item = NSMenuItem::alloc(nil)
// .initWithTitle_action_keyEquivalent_(
// ns_string(name),
// selector,
// ns_string(""),
// )
// .autorelease();
// }
// let tag = actions.len() as NSInteger; item = NSMenuItem::alloc(nil)
// let _: () = msg_send![item, setTag: tag]; .initWithTitle_action_keyEquivalent_(
// actions.push(action); ns_string(&name),
// item selector,
// } ns_string(""),
// MenuItem::Submenu(Menu { name, items }) => { )
// let item = NSMenuItem::new(nil).autorelease(); .autorelease();
// let submenu = NSMenu::new(nil).autorelease(); }
// submenu.setDelegate_(delegate); } else {
// for item in items { item = NSMenuItem::alloc(nil)
// submenu.addItem_(self.create_menu_item( .initWithTitle_action_keyEquivalent_(
// item, ns_string(name),
// delegate, selector,
// actions, ns_string(""),
// keystroke_matcher, )
// )); .autorelease();
// } }
// item.setSubmenu_(submenu);
// item.setTitle_(ns_string(name)); let tag = actions.len() as NSInteger;
// item let _: () = msg_send![item, setTag: tag];
// } actions.push(action);
// } item
// } }
MenuItem::Submenu(Menu { name, items }) => {
let item = NSMenuItem::new(nil).autorelease();
let submenu = NSMenu::new(nil).autorelease();
submenu.setDelegate_(delegate);
for item in items {
submenu.addItem_(self.create_menu_item(item, delegate, actions, keymap));
}
item.setSubmenu_(submenu);
item.setTitle_(ns_string(name));
item
}
}
}
} }
impl Platform for MacPlatform { impl Platform for MacPlatform {
@ -479,8 +482,8 @@ impl Platform for MacPlatform {
MacDisplay::find_by_id(id).map(|screen| Rc::new(screen) as Rc<_>) MacDisplay::find_by_id(id).map(|screen| Rc::new(screen) as Rc<_>)
} }
fn main_window(&self) -> Option<AnyWindowHandle> { fn active_window(&self) -> Option<AnyWindowHandle> {
MacWindow::main_window() MacWindow::active_window()
} }
fn open_window( fn open_window(
@ -631,6 +634,18 @@ impl Platform for MacPlatform {
self.0.lock().event = Some(callback); self.0.lock().event = Some(callback);
} }
fn on_app_menu_action(&self, callback: Box<dyn FnMut(&dyn Action)>) {
self.0.lock().menu_command = Some(callback);
}
fn on_will_open_app_menu(&self, callback: Box<dyn FnMut()>) {
self.0.lock().will_open_menu = Some(callback);
}
fn on_validate_app_menu_command(&self, callback: Box<dyn FnMut(&dyn Action) -> bool>) {
self.0.lock().validate_menu_command = Some(callback);
}
fn os_name(&self) -> &'static str { fn os_name(&self) -> &'static str {
"macOS" "macOS"
} }
@ -673,6 +688,15 @@ impl Platform for MacPlatform {
} }
} }
fn set_menus(&self, menus: Vec<Menu>, keymap: &Keymap) {
unsafe {
let app: id = msg_send![APP_CLASS, sharedApplication];
let mut state = self.0.lock();
let actions = &mut state.menu_actions;
app.setMainMenu_(self.create_menu_bar(menus, app.delegate(), actions, keymap));
}
}
fn local_timezone(&self) -> UtcOffset { fn local_timezone(&self) -> UtcOffset {
unsafe { unsafe {
let local_timezone: id = msg_send![class!(NSTimeZone), localTimeZone]; let local_timezone: id = msg_send![class!(NSTimeZone), localTimeZone];
@ -681,32 +705,6 @@ impl Platform for MacPlatform {
} }
} }
// fn on_menu_command(&self, callback: Box<dyn FnMut(&dyn Action)>) {
// self.0.lock().menu_command = Some(callback);
// }
// fn on_will_open_menu(&self, callback: Box<dyn FnMut()>) {
// self.0.lock().will_open_menu = Some(callback);
// }
// fn on_validate_menu_command(&self, callback: Box<dyn FnMut(&dyn Action) -> bool>) {
// self.0.lock().validate_menu_command = Some(callback);
// }
// fn set_menus(&self, menus: Vec<Menu>, keystroke_matcher: &KeymapMatcher) {
// unsafe {
// let app: id = msg_send![APP_CLASS, sharedApplication];
// let mut state = self.0.lock();
// let actions = &mut state.menu_actions;
// app.setMainMenu_(self.create_menu_bar(
// menus,
// app.delegate(),
// actions,
// keystroke_matcher,
// ));
// }
// }
fn path_for_auxiliary_executable(&self, name: &str) -> Result<PathBuf> { fn path_for_auxiliary_executable(&self, name: &str) -> Result<PathBuf> {
unsafe { unsafe {
let bundle: id = NSBundle::mainBundle(); let bundle: id = NSBundle::mainBundle();
@ -956,7 +954,7 @@ unsafe fn path_from_objc(path: id) -> PathBuf {
PathBuf::from(path) PathBuf::from(path)
} }
unsafe fn get_foreground_platform(object: &mut Object) -> &MacPlatform { unsafe fn get_mac_platform(object: &mut Object) -> &MacPlatform {
let platform_ptr: *mut c_void = *object.get_ivar(MAC_PLATFORM_IVAR); let platform_ptr: *mut c_void = *object.get_ivar(MAC_PLATFORM_IVAR);
assert!(!platform_ptr.is_null()); assert!(!platform_ptr.is_null());
&*(platform_ptr as *const MacPlatform) &*(platform_ptr as *const MacPlatform)
@ -965,7 +963,7 @@ unsafe fn get_foreground_platform(object: &mut Object) -> &MacPlatform {
extern "C" fn send_event(this: &mut Object, _sel: Sel, native_event: id) { extern "C" fn send_event(this: &mut Object, _sel: Sel, native_event: id) {
unsafe { unsafe {
if let Some(event) = InputEvent::from_native(native_event, None) { if let Some(event) = InputEvent::from_native(native_event, None) {
let platform = get_foreground_platform(this); let platform = get_mac_platform(this);
if let Some(callback) = platform.0.lock().event.as_mut() { if let Some(callback) = platform.0.lock().event.as_mut() {
if !callback(event) { if !callback(event) {
return; return;
@ -981,7 +979,7 @@ extern "C" fn did_finish_launching(this: &mut Object, _: Sel, _: id) {
let app: id = msg_send![APP_CLASS, sharedApplication]; let app: id = msg_send![APP_CLASS, sharedApplication];
app.setActivationPolicy_(NSApplicationActivationPolicyRegular); app.setActivationPolicy_(NSApplicationActivationPolicyRegular);
let platform = get_foreground_platform(this); let platform = get_mac_platform(this);
let callback = platform.0.lock().finish_launching.take(); let callback = platform.0.lock().finish_launching.take();
if let Some(callback) = callback { if let Some(callback) = callback {
callback(); callback();
@ -991,7 +989,7 @@ extern "C" fn did_finish_launching(this: &mut Object, _: Sel, _: id) {
extern "C" fn should_handle_reopen(this: &mut Object, _: Sel, _: id, has_open_windows: bool) { extern "C" fn should_handle_reopen(this: &mut Object, _: Sel, _: id, has_open_windows: bool) {
if !has_open_windows { if !has_open_windows {
let platform = unsafe { get_foreground_platform(this) }; let platform = unsafe { get_mac_platform(this) };
if let Some(callback) = platform.0.lock().reopen.as_mut() { if let Some(callback) = platform.0.lock().reopen.as_mut() {
callback(); callback();
} }
@ -999,21 +997,21 @@ extern "C" fn should_handle_reopen(this: &mut Object, _: Sel, _: id, has_open_wi
} }
extern "C" fn did_become_active(this: &mut Object, _: Sel, _: id) { extern "C" fn did_become_active(this: &mut Object, _: Sel, _: id) {
let platform = unsafe { get_foreground_platform(this) }; let platform = unsafe { get_mac_platform(this) };
if let Some(callback) = platform.0.lock().become_active.as_mut() { if let Some(callback) = platform.0.lock().become_active.as_mut() {
callback(); callback();
} }
} }
extern "C" fn did_resign_active(this: &mut Object, _: Sel, _: id) { extern "C" fn did_resign_active(this: &mut Object, _: Sel, _: id) {
let platform = unsafe { get_foreground_platform(this) }; let platform = unsafe { get_mac_platform(this) };
if let Some(callback) = platform.0.lock().resign_active.as_mut() { if let Some(callback) = platform.0.lock().resign_active.as_mut() {
callback(); callback();
} }
} }
extern "C" fn will_terminate(this: &mut Object, _: Sel, _: id) { extern "C" fn will_terminate(this: &mut Object, _: Sel, _: id) {
let platform = unsafe { get_foreground_platform(this) }; let platform = unsafe { get_mac_platform(this) };
if let Some(callback) = platform.0.lock().quit.as_mut() { if let Some(callback) = platform.0.lock().quit.as_mut() {
callback(); callback();
} }
@ -1035,49 +1033,47 @@ extern "C" fn open_urls(this: &mut Object, _: Sel, _: id, urls: id) {
}) })
.collect::<Vec<_>>() .collect::<Vec<_>>()
}; };
let platform = unsafe { get_foreground_platform(this) }; let platform = unsafe { get_mac_platform(this) };
if let Some(callback) = platform.0.lock().open_urls.as_mut() { if let Some(callback) = platform.0.lock().open_urls.as_mut() {
callback(urls); callback(urls);
} }
} }
extern "C" fn handle_menu_item(__this: &mut Object, _: Sel, __item: id) { extern "C" fn handle_menu_item(this: &mut Object, _: Sel, item: id) {
todo!() unsafe {
// unsafe { let platform = get_mac_platform(this);
// let platform = get_foreground_platform(this); let mut platform = platform.0.lock();
// let mut platform = platform.0.lock(); if let Some(mut callback) = platform.menu_command.take() {
// if let Some(mut callback) = platform.menu_command.take() { let tag: NSInteger = msg_send![item, tag];
// let tag: NSInteger = msg_send![item, tag]; let index = tag as usize;
// let index = tag as usize; if let Some(action) = platform.menu_actions.get(index) {
// if let Some(action) = platform.menu_actions.get(index) { callback(action.as_ref());
// callback(action.as_ref()); }
// } platform.menu_command = Some(callback);
// platform.menu_command = Some(callback); }
// } }
// }
} }
extern "C" fn validate_menu_item(__this: &mut Object, _: Sel, __item: id) -> bool { extern "C" fn validate_menu_item(this: &mut Object, _: Sel, item: id) -> bool {
todo!() unsafe {
// unsafe { let mut result = false;
// let mut result = false; let platform = get_mac_platform(this);
// let platform = get_foreground_platform(this); let mut platform = platform.0.lock();
// let mut platform = platform.0.lock(); if let Some(mut callback) = platform.validate_menu_command.take() {
// if let Some(mut callback) = platform.validate_menu_command.take() { let tag: NSInteger = msg_send![item, tag];
// let tag: NSInteger = msg_send![item, tag]; let index = tag as usize;
// let index = tag as usize; if let Some(action) = platform.menu_actions.get(index) {
// if let Some(action) = platform.menu_actions.get(index) { result = callback(action.as_ref());
// result = callback(action.as_ref()); }
// } platform.validate_menu_command = Some(callback);
// platform.validate_menu_command = Some(callback); }
// } result
// result }
// }
} }
extern "C" fn menu_will_open(this: &mut Object, _: Sel, _: id) { extern "C" fn menu_will_open(this: &mut Object, _: Sel, _: id) {
unsafe { unsafe {
let platform = get_foreground_platform(this); let platform = get_mac_platform(this);
let mut platform = platform.0.lock(); let mut platform = platform.0.lock();
if let Some(mut callback) = platform.will_open_menu.take() { if let Some(mut callback) = platform.will_open_menu.take() {
callback(); callback();

View file

@ -662,7 +662,7 @@ impl MacWindow {
} }
} }
pub fn main_window() -> Option<AnyWindowHandle> { pub fn active_window() -> Option<AnyWindowHandle> {
unsafe { unsafe {
let app = NSApplication::sharedApplication(nil); let app = NSApplication::sharedApplication(nil);
let main_window: id = msg_send![app, mainWindow]; let main_window: id = msg_send![app, mainWindow];
@ -750,6 +750,10 @@ impl PlatformWindow for MacWindow {
self.0.as_ref().lock().input_handler = Some(input_handler); self.0.as_ref().lock().input_handler = Some(input_handler);
} }
fn clear_input_handler(&mut self) {
self.0.as_ref().lock().input_handler = None;
}
fn prompt(&self, level: PromptLevel, msg: &str, answers: &[&str]) -> oneshot::Receiver<usize> { fn prompt(&self, level: PromptLevel, msg: &str, answers: &[&str]) -> oneshot::Receiver<usize> {
// macOs applies overrides to modal window buttons after they are added. // macOs applies overrides to modal window buttons after they are added.
// Two most important for this logic are: // Two most important for this logic are:

View file

@ -15,7 +15,7 @@ impl TestDisplay {
id: DisplayId(1), id: DisplayId(1),
uuid: uuid::Uuid::new_v4(), uuid: uuid::Uuid::new_v4(),
bounds: Bounds::from_corners( bounds: Bounds::from_corners(
Point::zero(), Point::default(),
Point::new(GlobalPixels(1920.), GlobalPixels(1080.)), Point::new(GlobalPixels(1920.), GlobalPixels(1080.)),
), ),
} }

View file

@ -1,6 +1,6 @@
use crate::{ use crate::{
AnyWindowHandle, BackgroundExecutor, ClipboardItem, CursorStyle, DisplayId, ForegroundExecutor, AnyWindowHandle, BackgroundExecutor, ClipboardItem, CursorStyle, DisplayId, ForegroundExecutor,
Platform, PlatformDisplay, PlatformTextSystem, TestDisplay, TestWindow, WindowOptions, Keymap, Platform, PlatformDisplay, PlatformTextSystem, TestDisplay, TestWindow, WindowOptions,
}; };
use anyhow::{anyhow, Result}; use anyhow::{anyhow, Result};
use collections::VecDeque; use collections::VecDeque;
@ -127,7 +127,7 @@ impl Platform for TestPlatform {
self.displays().iter().find(|d| d.id() == id).cloned() self.displays().iter().find(|d| d.id() == id).cloned()
} }
fn main_window(&self) -> Option<crate::AnyWindowHandle> { fn active_window(&self) -> Option<crate::AnyWindowHandle> {
unimplemented!() unimplemented!()
} }
@ -147,18 +147,25 @@ impl Platform for TestPlatform {
fn set_display_link_output_callback( fn set_display_link_output_callback(
&self, &self,
_display_id: DisplayId, _display_id: DisplayId,
_callback: Box<dyn FnMut(&crate::VideoTimestamp, &crate::VideoTimestamp) + Send>, mut callback: Box<dyn FnMut(&crate::VideoTimestamp, &crate::VideoTimestamp) + Send>,
) { ) {
unimplemented!() let timestamp = crate::VideoTimestamp {
version: 0,
video_time_scale: 0,
video_time: 0,
host_time: 0,
rate_scalar: 0.0,
video_refresh_period: 0,
smpte_time: crate::SmtpeTime::default(),
flags: 0,
reserved: 0,
};
callback(&timestamp, &timestamp)
} }
fn start_display_link(&self, _display_id: DisplayId) { fn start_display_link(&self, _display_id: DisplayId) {}
unimplemented!()
}
fn stop_display_link(&self, _display_id: DisplayId) { fn stop_display_link(&self, _display_id: DisplayId) {}
unimplemented!()
}
fn open_url(&self, _url: &str) { fn open_url(&self, _url: &str) {
unimplemented!() unimplemented!()
@ -205,6 +212,14 @@ impl Platform for TestPlatform {
unimplemented!() unimplemented!()
} }
fn set_menus(&self, _menus: Vec<crate::Menu>, _keymap: &Keymap) {}
fn on_app_menu_action(&self, _callback: Box<dyn FnMut(&dyn crate::Action)>) {}
fn on_will_open_app_menu(&self, _callback: Box<dyn FnMut()>) {}
fn on_validate_app_menu_command(&self, _callback: Box<dyn FnMut(&dyn crate::Action) -> bool>) {}
fn os_name(&self) -> &'static str { fn os_name(&self) -> &'static str {
"test" "test"
} }

View file

@ -66,11 +66,11 @@ impl PlatformWindow for TestWindow {
} }
fn titlebar_height(&self) -> Pixels { fn titlebar_height(&self) -> Pixels {
todo!() unimplemented!()
} }
fn appearance(&self) -> WindowAppearance { fn appearance(&self) -> WindowAppearance {
todo!() unimplemented!()
} }
fn display(&self) -> std::rc::Rc<dyn crate::PlatformDisplay> { fn display(&self) -> std::rc::Rc<dyn crate::PlatformDisplay> {
@ -78,7 +78,7 @@ impl PlatformWindow for TestWindow {
} }
fn mouse_position(&self) -> Point<Pixels> { fn mouse_position(&self) -> Point<Pixels> {
Point::zero() Point::default()
} }
fn as_any_mut(&mut self) -> &mut dyn std::any::Any { fn as_any_mut(&mut self) -> &mut dyn std::any::Any {
@ -89,6 +89,10 @@ impl PlatformWindow for TestWindow {
self.input_handler = Some(Arc::new(Mutex::new(input_handler))); self.input_handler = Some(Arc::new(Mutex::new(input_handler)));
} }
fn clear_input_handler(&mut self) {
self.input_handler = None;
}
fn prompt( fn prompt(
&self, &self,
_level: crate::PromptLevel, _level: crate::PromptLevel,
@ -99,7 +103,7 @@ impl PlatformWindow for TestWindow {
} }
fn activate(&self) { fn activate(&self) {
todo!() unimplemented!()
} }
fn set_title(&mut self, title: &str) { fn set_title(&mut self, title: &str) {
@ -107,23 +111,23 @@ impl PlatformWindow for TestWindow {
} }
fn set_edited(&mut self, _edited: bool) { fn set_edited(&mut self, _edited: bool) {
todo!() unimplemented!()
} }
fn show_character_palette(&self) { fn show_character_palette(&self) {
todo!() unimplemented!()
} }
fn minimize(&self) { fn minimize(&self) {
todo!() unimplemented!()
} }
fn zoom(&self) { fn zoom(&self) {
todo!() unimplemented!()
} }
fn toggle_full_screen(&self) { fn toggle_full_screen(&self) {
todo!() unimplemented!()
} }
fn on_input(&self, callback: Box<dyn FnMut(crate::InputEvent) -> bool>) { fn on_input(&self, callback: Box<dyn FnMut(crate::InputEvent) -> bool>) {
@ -139,7 +143,7 @@ impl PlatformWindow for TestWindow {
} }
fn on_fullscreen(&self, _callback: Box<dyn FnMut(bool)>) { fn on_fullscreen(&self, _callback: Box<dyn FnMut(bool)>) {
todo!() unimplemented!()
} }
fn on_moved(&self, callback: Box<dyn FnMut()>) { fn on_moved(&self, callback: Box<dyn FnMut()>) {
@ -147,19 +151,19 @@ impl PlatformWindow for TestWindow {
} }
fn on_should_close(&self, _callback: Box<dyn FnMut() -> bool>) { fn on_should_close(&self, _callback: Box<dyn FnMut() -> bool>) {
todo!() unimplemented!()
} }
fn on_close(&self, _callback: Box<dyn FnOnce()>) { fn on_close(&self, _callback: Box<dyn FnOnce()>) {
todo!() unimplemented!()
} }
fn on_appearance_changed(&self, _callback: Box<dyn FnMut()>) { fn on_appearance_changed(&self, _callback: Box<dyn FnMut()>) {
todo!() unimplemented!()
} }
fn is_topmost_for_position(&self, _position: crate::Point<Pixels>) -> bool { fn is_topmost_for_position(&self, _position: crate::Point<Pixels>) -> bool {
todo!() unimplemented!()
} }
fn draw(&self, scene: crate::Scene) { fn draw(&self, scene: crate::Scene) {
@ -223,7 +227,7 @@ impl PlatformAtlas for TestAtlas {
}, },
tile_id: TileId(tile_id), tile_id: TileId(tile_id),
bounds: crate::Bounds { bounds: crate::Bounds {
origin: Point::zero(), origin: Point::default(),
size, size,
}, },
}, },

View file

@ -385,7 +385,7 @@ impl Default for Style {
min_size: Size::auto(), min_size: Size::auto(),
max_size: Size::auto(), max_size: Size::auto(),
aspect_ratio: None, aspect_ratio: None,
gap: Size::zero(), gap: Size::default(),
// Aligment // Aligment
align_items: None, align_items: None,
align_self: None, align_self: None,

View file

@ -430,7 +430,7 @@ impl<'a> WindowContext<'a> {
self.window self.window
.current_frame .current_frame
.dispatch_tree .dispatch_tree
.clear_keystroke_matchers(); .clear_pending_keystrokes();
self.app.push_effect(Effect::FocusChanged { self.app.push_effect(Effect::FocusChanged {
window_handle: self.window.handle, window_handle: self.window.handle,
focused: Some(focus_id), focused: Some(focus_id),
@ -453,20 +453,22 @@ impl<'a> WindowContext<'a> {
} }
pub fn dispatch_action(&mut self, action: Box<dyn Action>) { pub fn dispatch_action(&mut self, action: Box<dyn Action>) {
if let Some(focus_handle) = self.focused() { let focus_handle = self.focused();
self.defer(move |cx| { self.defer(move |cx| {
if let Some(node_id) = cx let node_id = focus_handle
.window .and_then(|handle| {
cx.window
.current_frame .current_frame
.dispatch_tree .dispatch_tree
.focusable_node_id(focus_handle.id) .focusable_node_id(handle.id)
{ })
.unwrap_or_else(|| cx.window.current_frame.dispatch_tree.root_node_id());
cx.propagate_event = true; cx.propagate_event = true;
cx.dispatch_action_on_node(node_id, action); cx.dispatch_action_on_node(node_id, action);
}
}) })
} }
}
/// Schedules the given function to be run at the end of the current effect cycle, allowing entities /// Schedules the given function to be run at the end of the current effect cycle, allowing entities
/// that are currently on the stack to be returned to the app. /// that are currently on the stack to be returned to the app.
@ -802,6 +804,22 @@ impl<'a> WindowContext<'a> {
); );
} }
pub fn is_action_available(&self, action: &dyn Action) -> bool {
let target = self
.focused()
.and_then(|focused_handle| {
self.window
.current_frame
.dispatch_tree
.focusable_node_id(focused_handle.id)
})
.unwrap_or_else(|| self.window.current_frame.dispatch_tree.root_node_id());
self.window
.current_frame
.dispatch_tree
.is_action_available(action, target)
}
/// The position of the mouse relative to the window. /// The position of the mouse relative to the window.
pub fn mouse_position(&self) -> Point<Pixels> { pub fn mouse_position(&self) -> Point<Pixels> {
self.window.mouse_position self.window.mouse_position
@ -1154,8 +1172,19 @@ impl<'a> WindowContext<'a> {
self.start_frame(); self.start_frame();
self.with_z_index(0, |cx| { self.with_z_index(0, |cx| {
cx.with_key_dispatch(Some(KeyContext::default()), None, |_, cx| {
for (action_type, action_listeners) in &cx.app.global_action_listeners {
for action_listener in action_listeners.iter().cloned() {
cx.window.current_frame.dispatch_tree.on_action(
*action_type,
Rc::new(move |action, phase, cx| action_listener(action, phase, cx)),
)
}
}
let available_space = cx.window.viewport_size.map(Into::into); let available_space = cx.window.viewport_size.map(Into::into);
root_view.draw(Point::zero(), available_space, cx); root_view.draw(Point::default(), available_space, cx);
})
}); });
if let Some(active_drag) = self.app.active_drag.take() { if let Some(active_drag) = self.app.active_drag.take() {
@ -1163,8 +1192,8 @@ impl<'a> WindowContext<'a> {
let offset = cx.mouse_position() - active_drag.cursor_offset; let offset = cx.mouse_position() - active_drag.cursor_offset;
let available_space = size(AvailableSpace::MinContent, AvailableSpace::MinContent); let available_space = size(AvailableSpace::MinContent, AvailableSpace::MinContent);
active_drag.view.draw(offset, available_space, cx); active_drag.view.draw(offset, available_space, cx);
cx.active_drag = Some(active_drag);
}); });
self.active_drag = Some(active_drag);
} else if let Some(active_tooltip) = self.app.active_tooltip.take() { } else if let Some(active_tooltip) = self.app.active_tooltip.take() {
self.with_z_index(1, |cx| { self.with_z_index(1, |cx| {
let available_space = size(AvailableSpace::MinContent, AvailableSpace::MinContent); let available_space = size(AvailableSpace::MinContent, AvailableSpace::MinContent);
@ -1177,7 +1206,7 @@ impl<'a> WindowContext<'a> {
self.window self.window
.current_frame .current_frame
.dispatch_tree .dispatch_tree
.preserve_keystroke_matchers( .preserve_pending_keystrokes(
&mut self.window.previous_frame.dispatch_tree, &mut self.window.previous_frame.dispatch_tree,
self.window.focus, self.window.focus,
); );
@ -1199,6 +1228,7 @@ impl<'a> WindowContext<'a> {
/// Rotate the current frame and the previous frame, then clear the current frame. /// Rotate the current frame and the previous frame, then clear the current frame.
/// We repopulate all state in the current frame during each paint. /// We repopulate all state in the current frame during each paint.
fn start_frame(&mut self) { fn start_frame(&mut self) {
self.window.platform_window.clear_input_handler();
self.text_system().start_frame(); self.text_system().start_frame();
let window = &mut *self.window; let window = &mut *self.window;
@ -1338,12 +1368,17 @@ impl<'a> WindowContext<'a> {
} }
fn dispatch_key_event(&mut self, event: &dyn Any) { fn dispatch_key_event(&mut self, event: &dyn Any) {
if let Some(node_id) = self.window.focus.and_then(|focus_id| { let node_id = self
.window
.focus
.and_then(|focus_id| {
self.window self.window
.current_frame .current_frame
.dispatch_tree .dispatch_tree
.focusable_node_id(focus_id) .focusable_node_id(focus_id)
}) { })
.unwrap_or_else(|| self.window.current_frame.dispatch_tree.root_node_id());
let dispatch_path = self let dispatch_path = self
.window .window
.current_frame .current_frame
@ -1359,8 +1394,8 @@ impl<'a> WindowContext<'a> {
for node_id in &dispatch_path { for node_id in &dispatch_path {
let node = self.window.current_frame.dispatch_tree.node(*node_id); let node = self.window.current_frame.dispatch_tree.node(*node_id);
if !node.context.is_empty() { if let Some(context) = node.context.clone() {
context_stack.push(node.context.clone()); context_stack.push(context);
} }
for key_listener in node.key_listeners.clone() { for key_listener in node.key_listeners.clone() {
@ -1384,7 +1419,7 @@ impl<'a> WindowContext<'a> {
// Match keystrokes // Match keystrokes
let node = self.window.current_frame.dispatch_tree.node(*node_id); let node = self.window.current_frame.dispatch_tree.node(*node_id);
if !node.context.is_empty() { if node.context.is_some() {
if let Some(key_down_event) = event.downcast_ref::<KeyDownEvent>() { if let Some(key_down_event) = event.downcast_ref::<KeyDownEvent>() {
if let Some(found) = self if let Some(found) = self
.window .window
@ -1407,7 +1442,6 @@ impl<'a> WindowContext<'a> {
} }
} }
} }
}
fn dispatch_action_on_node(&mut self, node_id: DispatchNodeId, action: Box<dyn Action>) { fn dispatch_action_on_node(&mut self, node_id: DispatchNodeId, action: Box<dyn Action>) {
let dispatch_path = self let dispatch_path = self
@ -1490,14 +1524,21 @@ impl<'a> WindowContext<'a> {
} }
pub fn available_actions(&self) -> Vec<Box<dyn Action>> { pub fn available_actions(&self) -> Vec<Box<dyn Action>> {
if let Some(focus_id) = self.window.focus { let node_id = self
.window
.focus
.and_then(|focus_id| {
self.window self.window
.current_frame .current_frame
.dispatch_tree .dispatch_tree
.available_actions(focus_id) .focusable_node_id(focus_id)
} else { })
Vec::new() .unwrap_or_else(|| self.window.current_frame.dispatch_tree.root_node_id());
}
self.window
.current_frame
.dispatch_tree
.available_actions(node_id)
} }
pub fn bindings_for_action(&self, action: &dyn Action) -> Vec<KeyBinding> { pub fn bindings_for_action(&self, action: &dyn Action) -> Vec<KeyBinding> {
@ -1523,7 +1564,7 @@ impl<'a> WindowContext<'a> {
let context_stack = dispatch_tree let context_stack = dispatch_tree
.dispatch_path(node_id) .dispatch_path(node_id)
.into_iter() .into_iter()
.map(|node_id| dispatch_tree.node(node_id).context.clone()) .filter_map(|node_id| dispatch_tree.node(node_id).context.clone())
.collect(); .collect();
dispatch_tree.bindings_for_action(action, &context_stack) dispatch_tree.bindings_for_action(action, &context_stack)
} }
@ -1553,7 +1594,7 @@ impl<'a> WindowContext<'a> {
//========== ELEMENT RELATED FUNCTIONS =========== //========== ELEMENT RELATED FUNCTIONS ===========
pub fn with_key_dispatch<R>( pub fn with_key_dispatch<R>(
&mut self, &mut self,
context: KeyContext, context: Option<KeyContext>,
focus_handle: Option<FocusHandle>, focus_handle: Option<FocusHandle>,
f: impl FnOnce(Option<FocusHandle>, &mut Self) -> R, f: impl FnOnce(Option<FocusHandle>, &mut Self) -> R,
) -> R { ) -> R {
@ -2816,3 +2857,9 @@ impl From<(&'static str, EntityId)> for ElementId {
ElementId::NamedInteger(name.into(), id.as_u64() as usize) ElementId::NamedInteger(name.into(), id.as_u64() as usize)
} }
} }
impl From<(&'static str, usize)> for ElementId {
fn from((name, id): (&'static str, usize)) -> Self {
ElementId::NamedInteger(name.into(), id)
}
}

View file

@ -95,8 +95,6 @@ mod tests {
.iter() .iter()
.map(|(name, color)| (name.to_string(), (*color).into())) .map(|(name, color)| (name.to_string(), (*color).into()))
.collect(), .collect(),
inlay_style: HighlightStyle::default(),
suggestion_style: HighlightStyle::default(),
}; };
let capture_names = &[ let capture_names = &[

View file

@ -10,7 +10,7 @@ doctest = false
[dependencies] [dependencies]
util = { path = "../util" } util = { path = "../util" }
async-compression = { version = "0.3", features = ["gzip", "futures-bufread"] } async-compression.workspace = true
async-tar = "0.4.2" async-tar = "0.4.2"
futures.workspace = true futures.workspace = true
async-trait.workspace = true async-trait.workspace = true

View file

@ -55,7 +55,6 @@ pub struct ProjectPanel {
clipboard_entry: Option<ClipboardEntry>, clipboard_entry: Option<ClipboardEntry>,
_dragged_entry_destination: Option<Arc<Path>>, _dragged_entry_destination: Option<Arc<Path>>,
_workspace: WeakView<Workspace>, _workspace: WeakView<Workspace>,
has_focus: bool,
width: Option<f32>, width: Option<f32>,
pending_serialization: Task<Option<()>>, pending_serialization: Task<Option<()>>,
} }
@ -172,7 +171,6 @@ impl ProjectPanel {
let focus_handle = cx.focus_handle(); let focus_handle = cx.focus_handle();
cx.on_focus(&focus_handle, Self::focus_in).detach(); cx.on_focus(&focus_handle, Self::focus_in).detach();
cx.on_blur(&focus_handle, Self::focus_out).detach();
cx.subscribe(&project, |this, project, event, cx| match event { cx.subscribe(&project, |this, project, event, cx| match event {
project::Event::ActiveEntryChanged(Some(entry_id)) => { project::Event::ActiveEntryChanged(Some(entry_id)) => {
@ -238,7 +236,6 @@ impl ProjectPanel {
// context_menu: cx.add_view(|cx| ContextMenu::new(view_id, cx)), // context_menu: cx.add_view(|cx| ContextMenu::new(view_id, cx)),
_dragged_entry_destination: None, _dragged_entry_destination: None,
_workspace: workspace.weak_handle(), _workspace: workspace.weak_handle(),
has_focus: false,
width: None, width: None,
pending_serialization: Task::ready(None), pending_serialization: Task::ready(None),
}; };
@ -356,16 +353,11 @@ impl ProjectPanel {
} }
fn focus_in(&mut self, cx: &mut ViewContext<Self>) { fn focus_in(&mut self, cx: &mut ViewContext<Self>) {
if !self.has_focus { if !self.focus_handle.contains_focused(cx) {
self.has_focus = true;
cx.emit(Event::Focus); cx.emit(Event::Focus);
} }
} }
fn focus_out(&mut self, _: &mut ViewContext<Self>) {
self.has_focus = false;
}
fn deploy_context_menu( fn deploy_context_menu(
&mut self, &mut self,
position: Point<Pixels>, position: Point<Pixels>,
@ -1557,10 +1549,6 @@ impl Panel for ProjectPanel {
Box::new(ToggleFocus) Box::new(ToggleFocus)
} }
fn has_focus(&self, _: &WindowContext) -> bool {
self.has_focus
}
fn persistent_name() -> &'static str { fn persistent_name() -> &'static str {
"Project Panel" "Project Panel"
} }

View file

@ -13,7 +13,7 @@ use workspace::{item::ItemHandle, ToolbarItemLocation, ToolbarItemView, Workspac
pub struct QuickActionBar { pub struct QuickActionBar {
buffer_search_bar: ViewHandle<BufferSearchBar>, buffer_search_bar: ViewHandle<BufferSearchBar>,
active_item: Option<Box<dyn ItemHandle>>, active_item: Option<Box<dyn ItemHandle>>,
_inlay_hints_enabled_subscription: Option<Subscription>, inlay_hints_enabled_subscription: Option<Subscription>,
workspace: WeakViewHandle<Workspace>, workspace: WeakViewHandle<Workspace>,
} }
@ -22,7 +22,7 @@ impl QuickActionBar {
Self { Self {
buffer_search_bar, buffer_search_bar,
active_item: None, active_item: None,
_inlay_hints_enabled_subscription: None, inlay_hints_enabled_subscription: None,
workspace: workspace.weak_handle(), workspace: workspace.weak_handle(),
} }
} }
@ -161,12 +161,12 @@ impl ToolbarItemView for QuickActionBar {
match active_pane_item { match active_pane_item {
Some(active_item) => { Some(active_item) => {
self.active_item = Some(active_item.boxed_clone()); self.active_item = Some(active_item.boxed_clone());
self._inlay_hints_enabled_subscription.take(); self.inlay_hints_enabled_subscription.take();
if let Some(editor) = active_item.downcast::<Editor>() { if let Some(editor) = active_item.downcast::<Editor>() {
let mut inlay_hints_enabled = editor.read(cx).inlay_hints_enabled(); let mut inlay_hints_enabled = editor.read(cx).inlay_hints_enabled();
let mut supports_inlay_hints = editor.read(cx).supports_inlay_hints(cx); let mut supports_inlay_hints = editor.read(cx).supports_inlay_hints(cx);
self._inlay_hints_enabled_subscription = self.inlay_hints_enabled_subscription =
Some(cx.observe(&editor, move |_, editor, cx| { Some(cx.observe(&editor, move |_, editor, cx| {
let editor = editor.read(cx); let editor = editor.read(cx);
let new_inlay_hints_enabled = editor.inlay_hints_enabled(); let new_inlay_hints_enabled = editor.inlay_hints_enabled();

View file

@ -0,0 +1,22 @@
[package]
name = "quick_action_bar2"
version = "0.1.0"
edition = "2021"
publish = false
[lib]
path = "src/quick_action_bar.rs"
doctest = false
[dependencies]
assistant = { package = "assistant2", path = "../assistant2" }
editor = { package = "editor2", path = "../editor2" }
gpui = { package = "gpui2", path = "../gpui2" }
search = { package = "search2", path = "../search2" }
workspace = { package = "workspace2", path = "../workspace2" }
ui = { package = "ui2", path = "../ui2" }
[dev-dependencies]
editor = { package = "editor2", path = "../editor2", features = ["test-support"] }
gpui = { package = "gpui2", path = "../gpui2", features = ["test-support"] }
workspace = { package = "workspace2", path = "../workspace2", features = ["test-support"] }

View file

@ -0,0 +1,193 @@
use assistant::{AssistantPanel, InlineAssist};
use editor::Editor;
use gpui::{
Action, ClickEvent, Div, ElementId, EventEmitter, InteractiveElement, ParentElement, Render,
Stateful, Styled, Subscription, View, ViewContext, WeakView,
};
use search::BufferSearchBar;
use ui::{prelude::*, ButtonSize, ButtonStyle, Icon, IconButton, IconSize, Tooltip};
use workspace::{
item::ItemHandle, ToolbarItemEvent, ToolbarItemLocation, ToolbarItemView, Workspace,
};
pub struct QuickActionBar {
buffer_search_bar: View<BufferSearchBar>,
active_item: Option<Box<dyn ItemHandle>>,
_inlay_hints_enabled_subscription: Option<Subscription>,
workspace: WeakView<Workspace>,
}
impl QuickActionBar {
pub fn new(buffer_search_bar: View<BufferSearchBar>, workspace: &Workspace) -> Self {
Self {
buffer_search_bar,
active_item: None,
_inlay_hints_enabled_subscription: None,
workspace: workspace.weak_handle(),
}
}
fn active_editor(&self) -> Option<View<Editor>> {
self.active_item
.as_ref()
.and_then(|item| item.downcast::<Editor>())
}
}
impl Render for QuickActionBar {
type Element = Stateful<Div>;
fn render(&mut self, cx: &mut ViewContext<Self>) -> Self::Element {
let Some(editor) = self.active_editor() else {
return div().id("empty quick action bar");
};
let inlay_hints_button = Some(QuickActionBarButton::new(
"toggle inlay hints",
Icon::InlayHint,
editor.read(cx).inlay_hints_enabled(),
Box::new(editor::ToggleInlayHints),
"Toggle Inlay Hints",
{
let editor = editor.clone();
move |_, cx| {
editor.update(cx, |editor, cx| {
editor.toggle_inlay_hints(&editor::ToggleInlayHints, cx);
});
}
},
))
.filter(|_| editor.read(cx).supports_inlay_hints(cx));
let search_button = Some(QuickActionBarButton::new(
"toggle buffer search",
Icon::MagnifyingGlass,
!self.buffer_search_bar.read(cx).is_dismissed(),
Box::new(search::buffer_search::Deploy { focus: false }),
"Buffer Search",
{
let buffer_search_bar = self.buffer_search_bar.clone();
move |_, cx| {
buffer_search_bar.update(cx, |search_bar, cx| search_bar.toggle(cx));
}
},
))
.filter(|_| editor.is_singleton(cx));
let assistant_button = QuickActionBarButton::new(
"toggle inline assistant",
Icon::MagicWand,
false,
Box::new(InlineAssist),
"Inline Assist",
{
let workspace = self.workspace.clone();
move |_, cx| {
if let Some(workspace) = workspace.upgrade() {
workspace.update(cx, |workspace, cx| {
AssistantPanel::inline_assist(workspace, &InlineAssist, cx);
});
}
}
},
);
h_stack()
.id("quick action bar")
.p_1()
.gap_2()
.children(inlay_hints_button)
.children(search_button)
.child(assistant_button)
}
}
impl EventEmitter<ToolbarItemEvent> for QuickActionBar {}
#[derive(IntoElement)]
struct QuickActionBarButton {
id: ElementId,
icon: Icon,
toggled: bool,
action: Box<dyn Action>,
tooltip: SharedString,
on_click: Box<dyn Fn(&ClickEvent, &mut WindowContext)>,
}
impl QuickActionBarButton {
fn new(
id: impl Into<ElementId>,
icon: Icon,
toggled: bool,
action: Box<dyn Action>,
tooltip: impl Into<SharedString>,
on_click: impl Fn(&ClickEvent, &mut WindowContext) + 'static,
) -> Self {
Self {
id: id.into(),
icon,
toggled,
action,
tooltip: tooltip.into(),
on_click: Box::new(on_click),
}
}
}
impl RenderOnce for QuickActionBarButton {
type Rendered = IconButton;
fn render(self, _: &mut WindowContext) -> Self::Rendered {
let tooltip = self.tooltip.clone();
let action = self.action.boxed_clone();
IconButton::new(self.id.clone(), self.icon)
.size(ButtonSize::Compact)
.icon_size(IconSize::Small)
.style(ButtonStyle::Subtle)
.selected(self.toggled)
.tooltip(move |cx| Tooltip::for_action(tooltip.clone(), &*action, cx))
.on_click(move |event, cx| (self.on_click)(event, cx))
}
}
impl ToolbarItemView for QuickActionBar {
fn set_active_pane_item(
&mut self,
active_pane_item: Option<&dyn ItemHandle>,
cx: &mut ViewContext<Self>,
) -> ToolbarItemLocation {
match active_pane_item {
Some(active_item) => {
self.active_item = Some(active_item.boxed_clone());
self._inlay_hints_enabled_subscription.take();
if let Some(editor) = active_item.downcast::<Editor>() {
let mut inlay_hints_enabled = editor.read(cx).inlay_hints_enabled();
let mut supports_inlay_hints = editor.read(cx).supports_inlay_hints(cx);
self._inlay_hints_enabled_subscription =
Some(cx.observe(&editor, move |_, editor, cx| {
let editor = editor.read(cx);
let new_inlay_hints_enabled = editor.inlay_hints_enabled();
let new_supports_inlay_hints = editor.supports_inlay_hints(cx);
let should_notify = inlay_hints_enabled != new_inlay_hints_enabled
|| supports_inlay_hints != new_supports_inlay_hints;
inlay_hints_enabled = new_inlay_hints_enabled;
supports_inlay_hints = new_supports_inlay_hints;
if should_notify {
cx.notify()
}
}));
ToolbarItemLocation::PrimaryRight
} else {
ToolbarItemLocation::Hidden
}
}
None => {
self.active_item = None;
ToolbarItemLocation::Hidden
}
}
}
}

View file

@ -0,0 +1,31 @@
[package]
name = "recent_projects2"
version = "0.1.0"
edition = "2021"
publish = false
[lib]
path = "src/recent_projects.rs"
doctest = false
[dependencies]
db = { path = "../db" }
editor = { package = "editor2", path = "../editor2" }
fuzzy = { package = "fuzzy2", path = "../fuzzy2" }
gpui = { package = "gpui2", path = "../gpui2" }
language = { package = "language2", path = "../language2" }
picker = { package = "picker2", path = "../picker2" }
settings = { package = "settings2", path = "../settings2" }
text = { package = "text2", path = "../text2" }
util = { path = "../util"}
theme = { package = "theme2", path = "../theme2" }
ui = { package = "ui2", path = "../ui2" }
workspace = { package = "workspace2", path = "../workspace2" }
futures.workspace = true
ordered-float.workspace = true
postage.workspace = true
smol.workspace = true
[dev-dependencies]
editor = { package = "editor2", path = "../editor2", features = ["test-support"] }

View file

@ -0,0 +1,131 @@
use std::path::Path;
use fuzzy::StringMatch;
use ui::{prelude::*, HighlightedLabel};
use util::paths::PathExt;
use workspace::WorkspaceLocation;
#[derive(IntoElement)]
pub struct HighlightedText {
pub text: String,
pub highlight_positions: Vec<usize>,
char_count: usize,
}
impl HighlightedText {
fn join(components: impl Iterator<Item = Self>, separator: &str) -> Self {
let mut char_count = 0;
let separator_char_count = separator.chars().count();
let mut text = String::new();
let mut highlight_positions = Vec::new();
for component in components {
if char_count != 0 {
text.push_str(separator);
char_count += separator_char_count;
}
highlight_positions.extend(
component
.highlight_positions
.iter()
.map(|position| position + char_count),
);
text.push_str(&component.text);
char_count += component.text.chars().count();
}
Self {
text,
highlight_positions,
char_count,
}
}
}
impl RenderOnce for HighlightedText {
type Rendered = HighlightedLabel;
fn render(self, _cx: &mut WindowContext) -> Self::Rendered {
HighlightedLabel::new(self.text, self.highlight_positions)
}
}
pub struct HighlightedWorkspaceLocation {
pub names: HighlightedText,
pub paths: Vec<HighlightedText>,
}
impl HighlightedWorkspaceLocation {
pub fn new(string_match: &StringMatch, location: &WorkspaceLocation) -> Self {
let mut path_start_offset = 0;
let (names, paths): (Vec<_>, Vec<_>) = location
.paths()
.iter()
.map(|path| {
let path = path.compact();
let highlighted_text = Self::highlights_for_path(
path.as_ref(),
&string_match.positions,
path_start_offset,
);
path_start_offset += highlighted_text.1.char_count;
highlighted_text
})
.unzip();
Self {
names: HighlightedText::join(names.into_iter().filter_map(|name| name), ", "),
paths,
}
}
// Compute the highlighted text for the name and path
fn highlights_for_path(
path: &Path,
match_positions: &Vec<usize>,
path_start_offset: usize,
) -> (Option<HighlightedText>, HighlightedText) {
let path_string = path.to_string_lossy();
let path_char_count = path_string.chars().count();
// Get the subset of match highlight positions that line up with the given path.
// Also adjusts them to start at the path start
let path_positions = match_positions
.iter()
.copied()
.skip_while(|position| *position < path_start_offset)
.take_while(|position| *position < path_start_offset + path_char_count)
.map(|position| position - path_start_offset)
.collect::<Vec<_>>();
// Again subset the highlight positions to just those that line up with the file_name
// again adjusted to the start of the file_name
let file_name_text_and_positions = path.file_name().map(|file_name| {
let text = file_name.to_string_lossy();
let char_count = text.chars().count();
let file_name_start = path_char_count - char_count;
let highlight_positions = path_positions
.iter()
.copied()
.skip_while(|position| *position < file_name_start)
.take_while(|position| *position < file_name_start + char_count)
.map(|position| position - file_name_start)
.collect::<Vec<_>>();
HighlightedText {
text: text.to_string(),
highlight_positions,
char_count,
}
});
(
file_name_text_and_positions,
HighlightedText {
text: path_string.to_string(),
highlight_positions: path_positions,
char_count: path_char_count,
},
)
}
}

View file

@ -0,0 +1,233 @@
mod highlighted_workspace_location;
use fuzzy::{StringMatch, StringMatchCandidate};
use gpui::{
actions, AppContext, DismissEvent, Div, EventEmitter, FocusHandle, FocusableView, Result, Task,
View, ViewContext, WeakView,
};
use highlighted_workspace_location::HighlightedWorkspaceLocation;
use ordered_float::OrderedFloat;
use picker::{Picker, PickerDelegate};
use std::sync::Arc;
use ui::{prelude::*, ListItem};
use util::paths::PathExt;
use workspace::{
notifications::simple_message_notification::MessageNotification, Workspace, WorkspaceLocation,
WORKSPACE_DB,
};
actions!(OpenRecent);
pub fn init(cx: &mut AppContext) {
cx.observe_new_views(RecentProjects::register).detach();
}
pub struct RecentProjects {
picker: View<Picker<RecentProjectsDelegate>>,
}
impl RecentProjects {
fn new(delegate: RecentProjectsDelegate, cx: &mut ViewContext<Self>) -> Self {
Self {
picker: cx.build_view(|cx| Picker::new(delegate, cx)),
}
}
fn register(workspace: &mut Workspace, _: &mut ViewContext<Workspace>) {
workspace.register_action(|workspace, _: &OpenRecent, cx| {
let Some(recent_projects) = workspace.active_modal::<Self>(cx) else {
if let Some(handler) = Self::open(workspace, cx) {
handler.detach_and_log_err(cx);
}
return;
};
recent_projects.update(cx, |recent_projects, cx| {
recent_projects
.picker
.update(cx, |picker, cx| picker.cycle_selection(cx))
});
});
}
fn open(_: &mut Workspace, cx: &mut ViewContext<Workspace>) -> Option<Task<Result<()>>> {
Some(cx.spawn(|workspace, mut cx| async move {
let workspace_locations: Vec<_> = cx
.background_executor()
.spawn(async {
WORKSPACE_DB
.recent_workspaces_on_disk()
.await
.unwrap_or_default()
.into_iter()
.map(|(_, location)| location)
.collect()
})
.await;
workspace.update(&mut cx, |workspace, cx| {
if !workspace_locations.is_empty() {
let weak_workspace = cx.view().downgrade();
workspace.toggle_modal(cx, |cx| {
let delegate =
RecentProjectsDelegate::new(weak_workspace, workspace_locations, true);
RecentProjects::new(delegate, cx)
});
} else {
workspace.show_notification(0, cx, |cx| {
cx.build_view(|_| MessageNotification::new("No recent projects to open."))
})
}
})?;
Ok(())
}))
}
}
impl EventEmitter<DismissEvent> for RecentProjects {}
impl FocusableView for RecentProjects {
fn focus_handle(&self, cx: &AppContext) -> FocusHandle {
self.picker.focus_handle(cx)
}
}
impl Render for RecentProjects {
type Element = Div;
fn render(&mut self, _cx: &mut ViewContext<Self>) -> Self::Element {
v_stack().w_96().child(self.picker.clone())
}
}
pub struct RecentProjectsDelegate {
workspace: WeakView<Workspace>,
workspace_locations: Vec<WorkspaceLocation>,
selected_match_index: usize,
matches: Vec<StringMatch>,
render_paths: bool,
}
impl RecentProjectsDelegate {
fn new(
workspace: WeakView<Workspace>,
workspace_locations: Vec<WorkspaceLocation>,
render_paths: bool,
) -> Self {
Self {
workspace,
workspace_locations,
selected_match_index: 0,
matches: Default::default(),
render_paths,
}
}
}
impl PickerDelegate for RecentProjectsDelegate {
type ListItem = ListItem;
fn placeholder_text(&self) -> Arc<str> {
"Recent Projects...".into()
}
fn match_count(&self) -> usize {
self.matches.len()
}
fn selected_index(&self) -> usize {
self.selected_match_index
}
fn set_selected_index(&mut self, ix: usize, _cx: &mut ViewContext<Picker<Self>>) {
self.selected_match_index = ix;
}
fn update_matches(
&mut self,
query: String,
cx: &mut ViewContext<Picker<Self>>,
) -> gpui::Task<()> {
let query = query.trim_start();
let smart_case = query.chars().any(|c| c.is_uppercase());
let candidates = self
.workspace_locations
.iter()
.enumerate()
.map(|(id, location)| {
let combined_string = location
.paths()
.iter()
.map(|path| path.compact().to_string_lossy().into_owned())
.collect::<Vec<_>>()
.join("");
StringMatchCandidate::new(id, combined_string)
})
.collect::<Vec<_>>();
self.matches = smol::block_on(fuzzy::match_strings(
candidates.as_slice(),
query,
smart_case,
100,
&Default::default(),
cx.background_executor().clone(),
));
self.matches.sort_unstable_by_key(|m| m.candidate_id);
self.selected_match_index = self
.matches
.iter()
.enumerate()
.rev()
.max_by_key(|(_, m)| OrderedFloat(m.score))
.map(|(ix, _)| ix)
.unwrap_or(0);
Task::ready(())
}
fn confirm(&mut self, _: bool, cx: &mut ViewContext<Picker<Self>>) {
if let Some((selected_match, workspace)) = self
.matches
.get(self.selected_index())
.zip(self.workspace.upgrade())
{
let workspace_location = &self.workspace_locations[selected_match.candidate_id];
workspace
.update(cx, |workspace, cx| {
workspace
.open_workspace_for_paths(workspace_location.paths().as_ref().clone(), cx)
})
.detach_and_log_err(cx);
self.dismissed(cx);
}
}
fn dismissed(&mut self, _cx: &mut ViewContext<Picker<Self>>) {}
fn render_match(
&self,
ix: usize,
selected: bool,
_cx: &mut ViewContext<Picker<Self>>,
) -> Option<Self::ListItem> {
let Some(r#match) = self.matches.get(ix) else {
return None;
};
let highlighted_location = HighlightedWorkspaceLocation::new(
&r#match,
&self.workspace_locations[r#match.candidate_id],
);
Some(
ListItem::new(ix).inset(true).selected(selected).child(
v_stack()
.child(highlighted_location.names)
.when(self.render_paths, |this| {
this.children(highlighted_location.paths)
}),
),
)
}
}

View file

@ -10,15 +10,15 @@ use collections::HashMap;
use editor::{Editor, EditorMode}; use editor::{Editor, EditorMode};
use futures::channel::oneshot; use futures::channel::oneshot;
use gpui::{ use gpui::{
actions, div, red, Action, AppContext, Div, EventEmitter, InteractiveElement as _, IntoElement, actions, div, red, Action, AppContext, Div, EventEmitter, FocusableView,
ParentElement as _, Render, Styled, Subscription, Task, View, ViewContext, VisualContext as _, InteractiveElement as _, IntoElement, ParentElement as _, Render, Styled, Subscription, Task,
WeakView, WindowContext, View, ViewContext, VisualContext as _, WeakView, WindowContext,
}; };
use project::search::SearchQuery; use project::search::SearchQuery;
use serde::Deserialize; use serde::Deserialize;
use std::{any::Any, sync::Arc}; use std::{any::Any, sync::Arc};
use ui::{h_stack, Icon, IconButton, IconElement}; use ui::{h_stack, Clickable, Icon, IconButton, IconElement};
use util::ResultExt; use util::ResultExt;
use workspace::{ use workspace::{
item::ItemHandle, item::ItemHandle,
@ -161,16 +161,6 @@ impl Render for BufferSearchBar {
Some(ui::Label::new(message)) Some(ui::Label::new(message))
}); });
let nav_button_for_direction = |icon, direction| {
render_nav_button(
icon,
self.active_match_index.is_some(),
cx.listener(move |this, _, cx| match direction {
Direction::Prev => this.select_prev_match(&Default::default(), cx),
Direction::Next => this.select_next_match(&Default::default(), cx),
}),
)
};
let should_show_replace_input = self.replace_enabled && supported_options.replacement; let should_show_replace_input = self.replace_enabled && supported_options.replacement;
let replace_all = should_show_replace_input let replace_all = should_show_replace_input
.then(|| super::render_replace_button(ReplaceAll, ui::Icon::ReplaceAll)); .then(|| super::render_replace_button(ReplaceAll, ui::Icon::ReplaceAll));
@ -237,20 +227,32 @@ impl Render for BufferSearchBar {
h_stack() h_stack()
.gap_0p5() .gap_0p5()
.flex_none() .flex_none()
.child(self.render_action_button()) .child(self.render_action_button(cx))
.children(match_count) .children(match_count)
.child(nav_button_for_direction( .child(render_nav_button(
ui::Icon::ChevronLeft, ui::Icon::ChevronLeft,
Direction::Prev, self.active_match_index.is_some(),
cx.listener(move |this, _, cx| {
this.select_prev_match(&Default::default(), cx);
}),
)) ))
.child(nav_button_for_direction( .child(render_nav_button(
ui::Icon::ChevronRight, ui::Icon::ChevronRight,
Direction::Next, self.active_match_index.is_some(),
cx.listener(move |this, _, cx| {
this.select_next_match(&Default::default(), cx);
}),
)), )),
) )
} }
} }
impl FocusableView for BufferSearchBar {
fn focus_handle(&self, cx: &AppContext) -> gpui::FocusHandle {
self.query_editor.focus_handle(cx)
}
}
impl ToolbarItemView for BufferSearchBar { impl ToolbarItemView for BufferSearchBar {
fn set_active_pane_item( fn set_active_pane_item(
&mut self, &mut self,
@ -311,13 +313,7 @@ impl BufferSearchBar {
pane.update(cx, |this, cx| { pane.update(cx, |this, cx| {
this.toolbar().update(cx, |this, cx| { this.toolbar().update(cx, |this, cx| {
if let Some(search_bar) = this.item_of_type::<BufferSearchBar>() { if let Some(search_bar) = this.item_of_type::<BufferSearchBar>() {
search_bar.update(cx, |this, cx| { search_bar.update(cx, |this, cx| this.toggle(cx));
if this.is_dismissed() {
this.show(cx);
} else {
this.dismiss(&Dismiss, cx);
}
});
return; return;
} }
let view = cx.build_view(|cx| BufferSearchBar::new(cx)); let view = cx.build_view(|cx| BufferSearchBar::new(cx));
@ -481,6 +477,14 @@ impl BufferSearchBar {
false false
} }
pub fn toggle(&mut self, cx: &mut ViewContext<Self>) {
if self.is_dismissed() {
self.show(cx);
} else {
self.dismiss(&Dismiss, cx);
}
}
pub fn show(&mut self, cx: &mut ViewContext<Self>) -> bool { pub fn show(&mut self, cx: &mut ViewContext<Self>) -> bool {
if self.active_searchable_item.is_none() { if self.active_searchable_item.is_none() {
return false; return false;
@ -582,12 +586,14 @@ impl BufferSearchBar {
self.update_matches(cx) self.update_matches(cx)
} }
fn render_action_button(&self) -> impl IntoElement { fn render_action_button(&self, cx: &mut ViewContext<Self>) -> impl IntoElement {
// let tooltip_style = theme.tooltip.clone(); // let tooltip_style = theme.tooltip.clone();
// let style = theme.search.action_button.clone(); // let style = theme.search.action_button.clone();
IconButton::new(0, ui::Icon::SelectAll).action(Box::new(SelectAllMatches)) IconButton::new("select-all", ui::Icon::SelectAll).on_click(cx.listener(|this, _, cx| {
this.select_all_matches(&SelectAllMatches, cx);
}))
} }
pub fn activate_search_mode(&mut self, mode: SearchMode, cx: &mut ViewContext<Self>) { pub fn activate_search_mode(&mut self, mode: SearchMode, cx: &mut ViewContext<Self>) {

View file

@ -124,6 +124,17 @@ pub fn update_settings_file<T: Settings>(
pub fn load_default_keymap(cx: &mut AppContext) { pub fn load_default_keymap(cx: &mut AppContext) {
for path in ["keymaps/default.json", "keymaps/vim.json"] { for path in ["keymaps/default.json", "keymaps/vim.json"] {
// TODO: Remove this conditional when we're ready to add Vim support.
// Right now we're avoiding loading the Vim keymap to silence the warnings
// about invalid action bindings.
if path.contains("vim") {
let _: Option<()> = Err(format!(
"TODO: Skipping {path} until we're ready to add Vim support"
))
.log_err();
continue;
}
KeymapFile::load_asset(path, cx).unwrap(); KeymapFile::load_asset(path, cx).unwrap();
} }
@ -132,39 +143,3 @@ pub fn load_default_keymap(cx: &mut AppContext) {
// KeymapFile::load_asset(asset_path, cx).unwrap(); // KeymapFile::load_asset(asset_path, cx).unwrap();
// } // }
} }
pub fn handle_keymap_file_changes(
mut user_keymap_file_rx: mpsc::UnboundedReceiver<String>,
cx: &mut AppContext,
) {
cx.spawn(move |cx| async move {
// let mut settings_subscription = None;
while let Some(user_keymap_content) = user_keymap_file_rx.next().await {
if let Some(keymap_content) = KeymapFile::parse(&user_keymap_content).log_err() {
cx.update(|cx| reload_keymaps(cx, &keymap_content)).ok();
// todo!()
// let mut old_base_keymap = cx.read(|cx| *settings::get::<BaseKeymap>(cx));
// drop(settings_subscription);
// settings_subscription = Some(cx.update(|cx| {
// cx.observe_global::<SettingsStore, _>(move |cx| {
// let new_base_keymap = *settings::get::<BaseKeymap>(cx);
// if new_base_keymap != old_base_keymap {
// old_base_keymap = new_base_keymap.clone();
// reload_keymaps(cx, &keymap_content);
// }
// })
// }));
}
}
})
.detach();
}
fn reload_keymaps(cx: &mut AppContext, keymap_content: &KeymapFile) {
// todo!()
// cx.clear_bindings();
load_default_keymap(cx);
keymap_content.clone().add_to_cx(cx).log_err();
// cx.set_menus(menus::menus());
}

View file

@ -1,118 +1,5 @@
// todo!()
use alacritty_terminal::term::color::Rgb as AlacRgb; use alacritty_terminal::term::color::Rgb as AlacRgb;
// use gpui::color::Color;
// use theme2::TerminalStyle;
///Converts a 2, 8, or 24 bit color ANSI color to the GPUI equivalent
// pub fn convert_color(alac_color: &AnsiColor, style: &TerminalStyle) -> Color {
// match alac_color {
// //Named and theme defined colors
// alacritty_terminal::ansi::Color::Named(n) => match n {
// alacritty_terminal::ansi::NamedColor::Black => style.black,
// alacritty_terminal::ansi::NamedColor::Red => style.red,
// alacritty_terminal::ansi::NamedColor::Green => style.green,
// alacritty_terminal::ansi::NamedColor::Yellow => style.yellow,
// alacritty_terminal::ansi::NamedColor::Blue => style.blue,
// alacritty_terminal::ansi::NamedColor::Magenta => style.magenta,
// alacritty_terminal::ansi::NamedColor::Cyan => style.cyan,
// alacritty_terminal::ansi::NamedColor::White => style.white,
// alacritty_terminal::ansi::NamedColor::BrightBlack => style.bright_black,
// alacritty_terminal::ansi::NamedColor::BrightRed => style.bright_red,
// alacritty_terminal::ansi::NamedColor::BrightGreen => style.bright_green,
// alacritty_terminal::ansi::NamedColor::BrightYellow => style.bright_yellow,
// alacritty_terminal::ansi::NamedColor::BrightBlue => style.bright_blue,
// alacritty_terminal::ansi::NamedColor::BrightMagenta => style.bright_magenta,
// alacritty_terminal::ansi::NamedColor::BrightCyan => style.bright_cyan,
// alacritty_terminal::ansi::NamedColor::BrightWhite => style.bright_white,
// alacritty_terminal::ansi::NamedColor::Foreground => style.foreground,
// alacritty_terminal::ansi::NamedColor::Background => style.background,
// alacritty_terminal::ansi::NamedColor::Cursor => style.cursor,
// alacritty_terminal::ansi::NamedColor::DimBlack => style.dim_black,
// alacritty_terminal::ansi::NamedColor::DimRed => style.dim_red,
// alacritty_terminal::ansi::NamedColor::DimGreen => style.dim_green,
// alacritty_terminal::ansi::NamedColor::DimYellow => style.dim_yellow,
// alacritty_terminal::ansi::NamedColor::DimBlue => style.dim_blue,
// alacritty_terminal::ansi::NamedColor::DimMagenta => style.dim_magenta,
// alacritty_terminal::ansi::NamedColor::DimCyan => style.dim_cyan,
// alacritty_terminal::ansi::NamedColor::DimWhite => style.dim_white,
// alacritty_terminal::ansi::NamedColor::BrightForeground => style.bright_foreground,
// alacritty_terminal::ansi::NamedColor::DimForeground => style.dim_foreground,
// },
// //'True' colors
// alacritty_terminal::ansi::Color::Spec(rgb) => Color::new(rgb.r, rgb.g, rgb.b, u8::MAX),
// //8 bit, indexed colors
// alacritty_terminal::ansi::Color::Indexed(i) => get_color_at_index(&(*i as usize), style),
// }
// }
/// TODO: Move this
///Converts an 8 bit ANSI color to it's GPUI equivalent.
///Accepts usize for compatibility with the alacritty::Colors interface,
///Other than that use case, should only be called with values in the [0,255] range
// pub fn get_color_at_index(index: &usize, style: &TerminalStyle) -> Color {
// match index {
// //0-15 are the same as the named colors above
// 0 => style.black,
// 1 => style.red,
// 2 => style.green,
// 3 => style.yellow,
// 4 => style.blue,
// 5 => style.magenta,
// 6 => style.cyan,
// 7 => style.white,
// 8 => style.bright_black,
// 9 => style.bright_red,
// 10 => style.bright_green,
// 11 => style.bright_yellow,
// 12 => style.bright_blue,
// 13 => style.bright_magenta,
// 14 => style.bright_cyan,
// 15 => style.bright_white,
// //16-231 are mapped to their RGB colors on a 0-5 range per channel
// 16..=231 => {
// let (r, g, b) = rgb_for_index(&(*index as u8)); //Split the index into it's ANSI-RGB components
// let step = (u8::MAX as f32 / 5.).floor() as u8; //Split the RGB range into 5 chunks, with floor so no overflow
// Color::new(r * step, g * step, b * step, u8::MAX) //Map the ANSI-RGB components to an RGB color
// }
// //232-255 are a 24 step grayscale from black to white
// 232..=255 => {
// let i = *index as u8 - 232; //Align index to 0..24
// let step = (u8::MAX as f32 / 24.).floor() as u8; //Split the RGB grayscale values into 24 chunks
// Color::new(i * step, i * step, i * step, u8::MAX) //Map the ANSI-grayscale components to the RGB-grayscale
// }
// //For compatibility with the alacritty::Colors interface
// 256 => style.foreground,
// 257 => style.background,
// 258 => style.cursor,
// 259 => style.dim_black,
// 260 => style.dim_red,
// 261 => style.dim_green,
// 262 => style.dim_yellow,
// 263 => style.dim_blue,
// 264 => style.dim_magenta,
// 265 => style.dim_cyan,
// 266 => style.dim_white,
// 267 => style.bright_foreground,
// 268 => style.black, //'Dim Background', non-standard color
// _ => Color::new(0, 0, 0, 255),
// }
// }
///Generates the rgb channels in [0, 5] for a given index into the 6x6x6 ANSI color cube
///See: [8 bit ansi color](https://en.wikipedia.org/wiki/ANSI_escape_code#8-bit).
///
///Wikipedia gives a formula for calculating the index for a given color:
///
///index = 16 + 36 × r + 6 × g + b (0 ≤ r, g, b ≤ 5)
///
///This function does the reverse, calculating the r, g, and b components from a given index.
// fn rgb_for_index(i: &u8) -> (u8, u8, u8) {
// debug_assert!((&16..=&231).contains(&i));
// let i = i - 16;
// let r = (i - (i % 36)) / 36;
// let g = ((i % 36) - (i % 6)) / 6;
// let b = (i % 36) % 6;
// (r, g, b)
// }
use gpui::Rgba; use gpui::Rgba;
//Convenience method to convert from a GPUI color to an alacritty Rgb //Convenience method to convert from a GPUI color to an alacritty Rgb
@ -123,15 +10,3 @@ pub fn to_alac_rgb(color: impl Into<Rgba>) -> AlacRgb {
let b = ((color.b * color.a) * 255.) as u8; let b = ((color.b * color.a) * 255.) as u8;
AlacRgb::new(r, g, b) AlacRgb::new(r, g, b)
} }
// #[cfg(test)]
// mod tests {
// #[test]
// fn test_rgb_for_index() {
// //Test every possible value in the color cube
// for i in 16..=231 {
// let (r, g, b) = crate::mappings::colors::rgb_for_index(&(i as u8));
// assert_eq!(i, 16 + 36 * r + 6 * g + b);
// }
// }
// }

View file

@ -186,9 +186,9 @@ pub fn mouse_side(
} }
pub fn grid_point(pos: Point<Pixels>, cur_size: TerminalSize, display_offset: usize) -> AlacPoint { pub fn grid_point(pos: Point<Pixels>, cur_size: TerminalSize, display_offset: usize) -> AlacPoint {
let col = GridCol((cur_size.cell_width / pos.x) as usize); let col = GridCol((pos.x / cur_size.cell_width) as usize);
let col = min(col, cur_size.last_column()); let col = min(col, cur_size.last_column());
let line = (cur_size.line_height / pos.y) as i32; let line = (pos.y / cur_size.line_height) as i32;
let line = min(line, cur_size.bottommost_line().0); let line = min(line, cur_size.bottommost_line().0);
AlacPoint::new(GridLine(line - display_offset as i32), col) AlacPoint::new(GridLine(line - display_offset as i32), col)
} }

View file

@ -1103,7 +1103,12 @@ impl Terminal {
} }
} }
pub fn mouse_drag(&mut self, e: MouseMoveEvent, origin: Point<Pixels>, region: Bounds<Pixels>) { pub fn mouse_drag(
&mut self,
e: &MouseMoveEvent,
origin: Point<Pixels>,
region: Bounds<Pixels>,
) {
let position = e.position - origin; let position = e.position - origin;
self.last_mouse_position = Some(position); self.last_mouse_position = Some(position);
@ -1129,7 +1134,7 @@ impl Terminal {
} }
} }
fn drag_line_delta(&mut self, e: MouseMoveEvent, region: Bounds<Pixels>) -> Option<Pixels> { fn drag_line_delta(&mut self, e: &MouseMoveEvent, region: Bounds<Pixels>) -> Option<Pixels> {
//TODO: Why do these need to be doubled? Probably the same problem that the IME has //TODO: Why do these need to be doubled? Probably the same problem that the IME has
let top = region.origin.y + (self.last_content.size.line_height * 2.); let top = region.origin.y + (self.last_content.size.line_height * 2.);
let bottom = region.lower_left().y - (self.last_content.size.line_height * 2.); let bottom = region.lower_left().y - (self.last_content.size.line_height * 2.);
@ -1229,7 +1234,7 @@ impl Terminal {
} }
///Scroll the terminal ///Scroll the terminal
pub fn scroll_wheel(&mut self, e: ScrollWheelEvent, origin: Point<Pixels>) { pub fn scroll_wheel(&mut self, e: &ScrollWheelEvent, origin: Point<Pixels>) {
let mouse_mode = self.mouse_mode(e.shift); let mouse_mode = self.mouse_mode(e.shift);
if let Some(scroll_lines) = self.determine_scroll_lines(&e, mouse_mode) { if let Some(scroll_lines) = self.determine_scroll_lines(&e, mouse_mode) {

View file

@ -1,4 +1,4 @@
use gpui::{AppContext, FontFeatures, Pixels}; use gpui::{px, AbsoluteLength, AppContext, FontFeatures, Pixels};
use schemars::JsonSchema; use schemars::JsonSchema;
use serde_derive::{Deserialize, Serialize}; use serde_derive::{Deserialize, Serialize};
use std::{collections::HashMap, path::PathBuf}; use std::{collections::HashMap, path::PathBuf};
@ -114,12 +114,13 @@ pub enum TerminalLineHeight {
} }
impl TerminalLineHeight { impl TerminalLineHeight {
pub fn value(&self) -> f32 { pub fn value(&self) -> AbsoluteLength {
match self { let value = match self {
TerminalLineHeight::Comfortable => 1.618, TerminalLineHeight::Comfortable => 1.618,
TerminalLineHeight::Standard => 1.3, TerminalLineHeight::Standard => 1.3,
TerminalLineHeight::Custom(line_height) => f32::max(*line_height, 1.), TerminalLineHeight::Custom(line_height) => f32::max(*line_height, 1.),
} };
px(value).into()
} }
} }

View file

@ -21,6 +21,7 @@ workspace = { package = "workspace2", path = "../workspace2" }
db = { package = "db2", path = "../db2" } db = { package = "db2", path = "../db2" }
procinfo = { git = "https://github.com/zed-industries/wezterm", rev = "5cd757e5f2eb039ed0c6bb6512223e69d5efc64d", default-features = false } procinfo = { git = "https://github.com/zed-industries/wezterm", rev = "5cd757e5f2eb039ed0c6bb6512223e69d5efc64d", default-features = false }
terminal = { package = "terminal2", path = "../terminal2" } terminal = { package = "terminal2", path = "../terminal2" }
ui = { package = "ui2", path = "../ui2" }
smallvec.workspace = true smallvec.workspace = true
smol.workspace = true smol.workspace = true
mio-extras = "2.0.6" mio-extras = "2.0.6"

File diff suppressed because it is too large Load diff

View file

@ -4,8 +4,8 @@ use crate::TerminalView;
use db::kvp::KEY_VALUE_STORE; use db::kvp::KEY_VALUE_STORE;
use gpui::{ use gpui::{
actions, div, serde_json, AppContext, AsyncWindowContext, Div, Entity, EventEmitter, actions, div, serde_json, AppContext, AsyncWindowContext, Div, Entity, EventEmitter,
FocusHandle, FocusableView, ParentElement, Render, Subscription, Task, View, ViewContext, FocusHandle, FocusableView, ParentElement, Render, Styled, Subscription, Task, View,
VisualContext, WeakView, WindowContext, ViewContext, VisualContext, WeakView, WindowContext,
}; };
use project::Fs; use project::Fs;
use serde::{Deserialize, Serialize}; use serde::{Deserialize, Serialize};
@ -339,7 +339,7 @@ impl Render for TerminalPanel {
type Element = Div; type Element = Div;
fn render(&mut self, _cx: &mut ViewContext<Self>) -> Self::Element { fn render(&mut self, _cx: &mut ViewContext<Self>) -> Self::Element {
div().child(self.pane.clone()) div().size_full().child(self.pane.clone())
} }
} }
@ -415,10 +415,6 @@ impl Panel for TerminalPanel {
} }
} }
fn has_focus(&self, cx: &WindowContext) -> bool {
self.pane.read(cx).has_focus(cx)
}
fn persistent_name() -> &'static str { fn persistent_name() -> &'static str {
"TerminalPanel" "TerminalPanel"
} }

View file

@ -9,10 +9,9 @@ pub mod terminal_panel;
// use crate::terminal_element::TerminalElement; // use crate::terminal_element::TerminalElement;
use editor::{scroll::autoscroll::Autoscroll, Editor}; use editor::{scroll::autoscroll::Autoscroll, Editor};
use gpui::{ use gpui::{
actions, div, Action, AnyElement, AppContext, Div, Element, EventEmitter, FocusEvent, actions, div, Action, AnyElement, AppContext, Div, EventEmitter, FocusEvent, FocusHandle,
FocusHandle, Focusable, FocusableElement, FocusableView, InputHandler, InteractiveElement, Focusable, FocusableElement, FocusableView, KeyContext, KeyDownEvent, Keystroke, Model,
KeyDownEvent, Keystroke, Model, MouseButton, MouseDownEvent, ParentElement, Pixels, Render, MouseButton, MouseDownEvent, Pixels, Render, Subscription, Task, View, VisualContext, WeakView,
SharedString, Styled, Task, View, ViewContext, VisualContext, WeakView, WindowContext,
}; };
use language::Bias; use language::Bias;
use persistence::TERMINAL_DB; use persistence::TERMINAL_DB;
@ -25,13 +24,14 @@ use terminal::{
terminal_settings::{TerminalBlink, TerminalSettings, WorkingDirectory}, terminal_settings::{TerminalBlink, TerminalSettings, WorkingDirectory},
Event, MaybeNavigationTarget, Terminal, Event, MaybeNavigationTarget, Terminal,
}; };
use terminal_element::TerminalElement;
use ui::{h_stack, prelude::*, ContextMenu, Icon, IconElement, Label};
use util::{paths::PathLikeWithPosition, ResultExt}; use util::{paths::PathLikeWithPosition, ResultExt};
use workspace::{ use workspace::{
item::{BreadcrumbText, Item, ItemEvent}, item::{BreadcrumbText, Item, ItemEvent},
notifications::NotifyResultExt, notifications::NotifyResultExt,
register_deserializable_item, register_deserializable_item,
searchable::{SearchEvent, SearchOptions, SearchableItem}, searchable::{SearchEvent, SearchOptions, SearchableItem},
ui::{ContextMenu, Icon, IconElement, Label},
CloseActiveItem, NewCenterTerminal, Pane, ToolbarItemLocation, Workspace, WorkspaceId, CloseActiveItem, NewCenterTerminal, Pane, ToolbarItemLocation, Workspace, WorkspaceId,
}; };
@ -90,6 +90,7 @@ pub struct TerminalView {
blink_epoch: usize, blink_epoch: usize,
can_navigate_to_selected_word: bool, can_navigate_to_selected_word: bool,
workspace_id: WorkspaceId, workspace_id: WorkspaceId,
_subscriptions: Vec<Subscription>,
} }
impl EventEmitter<Event> for TerminalView {} impl EventEmitter<Event> for TerminalView {}
@ -261,6 +262,20 @@ impl TerminalView {
}) })
.detach(); .detach();
let focus = cx.focus_handle();
// let focus_in = cx.on_focus_in(&focus, |this, cx| {
// this.has_new_content = false;
// this.terminal.read(cx).focus_in();
// this.blink_cursors(this.blink_epoch, cx);
// cx.notify();
// });
// let focus_out = cx.on_focus_out(&focus, |this, cx| {
// this.terminal.update(cx, |terminal, _| {
// terminal.focus_out();
// });
// cx.notify();
// });
Self { Self {
terminal, terminal,
has_new_content: true, has_new_content: true,
@ -273,6 +288,7 @@ impl TerminalView {
blink_epoch: 0, blink_epoch: 0,
can_navigate_to_selected_word: false, can_navigate_to_selected_word: false,
workspace_id, workspace_id,
_subscriptions: vec![/*focus_in, focus_out*/],
} }
} }
@ -302,8 +318,7 @@ impl TerminalView {
menu.action("Clear", Box::new(Clear)) menu.action("Clear", Box::new(Clear))
.action("Close", Box::new(CloseActiveItem { save_intent: None })) .action("Close", Box::new(CloseActiveItem { save_intent: None }))
})); }));
dbg!(&position); // todo!(context menus)
// todo!()
// self.context_menu // self.context_menu
// .show(position, AnchorCorner::TopLeft, menu_entries, cx); // .show(position, AnchorCorner::TopLeft, menu_entries, cx);
// cx.notify(); // cx.notify();
@ -448,6 +463,81 @@ impl TerminalView {
}); });
} }
} }
fn dispatch_context(&self, cx: &AppContext) -> KeyContext {
let mut dispatch_context = KeyContext::default();
dispatch_context.add("Terminal");
let mode = self.terminal.read(cx).last_content.mode;
dispatch_context.set(
"screen",
if mode.contains(TermMode::ALT_SCREEN) {
"alt"
} else {
"normal"
},
);
if mode.contains(TermMode::APP_CURSOR) {
dispatch_context.add("DECCKM");
}
if mode.contains(TermMode::APP_KEYPAD) {
dispatch_context.add("DECPAM");
} else {
dispatch_context.add("DECPNM");
}
if mode.contains(TermMode::SHOW_CURSOR) {
dispatch_context.add("DECTCEM");
}
if mode.contains(TermMode::LINE_WRAP) {
dispatch_context.add("DECAWM");
}
if mode.contains(TermMode::ORIGIN) {
dispatch_context.add("DECOM");
}
if mode.contains(TermMode::INSERT) {
dispatch_context.add("IRM");
}
//LNM is apparently the name for this. https://vt100.net/docs/vt510-rm/LNM.html
if mode.contains(TermMode::LINE_FEED_NEW_LINE) {
dispatch_context.add("LNM");
}
if mode.contains(TermMode::FOCUS_IN_OUT) {
dispatch_context.add("report_focus");
}
if mode.contains(TermMode::ALTERNATE_SCROLL) {
dispatch_context.add("alternate_scroll");
}
if mode.contains(TermMode::BRACKETED_PASTE) {
dispatch_context.add("bracketed_paste");
}
if mode.intersects(TermMode::MOUSE_MODE) {
dispatch_context.add("any_mouse_reporting");
}
{
let mouse_reporting = if mode.contains(TermMode::MOUSE_REPORT_CLICK) {
"click"
} else if mode.contains(TermMode::MOUSE_DRAG) {
"drag"
} else if mode.contains(TermMode::MOUSE_MOTION) {
"motion"
} else {
"off"
};
dispatch_context.set("mouse_reporting", mouse_reporting);
}
{
let format = if mode.contains(TermMode::SGR_MOUSE) {
"sgr"
} else if mode.contains(TermMode::UTF8_MOUSE) {
"utf8"
} else {
"normal"
};
dispatch_context.set("mouse_format", format);
};
dispatch_context
}
} }
fn possible_open_targets( fn possible_open_targets(
@ -532,17 +622,20 @@ impl Render for TerminalView {
type Element = Focusable<Div>; type Element = Focusable<Div>;
fn render(&mut self, cx: &mut ViewContext<Self>) -> Self::Element { fn render(&mut self, cx: &mut ViewContext<Self>) -> Self::Element {
let terminal_handle = self.terminal.clone().downgrade(); let terminal_handle = self.terminal.clone();
let this_view = cx.view().clone();
let self_id = cx.entity_id(); let self_id = cx.entity_id();
let focused = self.focus_handle.is_focused(cx); let focused = self.focus_handle.is_focused(cx);
div() div()
.size_full()
.relative() .relative()
.child( .child(
div() div()
.z_index(0) .z_index(0)
.absolute() .absolute()
.size_full()
.on_key_down(cx.listener(Self::key_down)) .on_key_down(cx.listener(Self::key_down))
.on_action(cx.listener(TerminalView::send_text)) .on_action(cx.listener(TerminalView::send_text))
.on_action(cx.listener(TerminalView::send_keystroke)) .on_action(cx.listener(TerminalView::send_keystroke))
@ -551,15 +644,14 @@ impl Render for TerminalView {
.on_action(cx.listener(TerminalView::clear)) .on_action(cx.listener(TerminalView::clear))
.on_action(cx.listener(TerminalView::show_character_palette)) .on_action(cx.listener(TerminalView::show_character_palette))
.on_action(cx.listener(TerminalView::select_all)) .on_action(cx.listener(TerminalView::select_all))
// todo!() .child(TerminalElement::new(
.child( terminal_handle,
"TERMINAL HERE", // TerminalElement::new( this_view,
// terminal_handle, self.focus_handle.clone(),
// focused, focused,
// self.should_show_cursor(focused, cx), self.should_show_cursor(focused, cx),
// self.can_navigate_to_selected_word, self.can_navigate_to_selected_word,
// ) ))
)
.on_mouse_down( .on_mouse_down(
MouseButton::Right, MouseButton::Right,
cx.listener(|this, event: &MouseDownEvent, cx| { cx.listener(|this, event: &MouseDownEvent, cx| {
@ -579,163 +671,9 @@ impl Render for TerminalView {
} }
} }
// impl View for TerminalView {
//todo!()
// fn modifiers_changed(
// &mut self,
// event: &ModifiersChangedEvent,
// cx: &mut ViewContext<Self>,
// ) -> bool {
// let handled = self
// .terminal()
// .update(cx, |term, _| term.try_modifiers_change(&event.modifiers));
// if handled {
// cx.notify();
// }
// handled
// }
// }
// todo!()
// fn update_keymap_context(&self, keymap: &mut KeymapContext, cx: &gpui::AppContext) {
// Self::reset_to_default_keymap_context(keymap);
// let mode = self.terminal.read(cx).last_content.mode;
// keymap.add_key(
// "screen",
// if mode.contains(TermMode::ALT_SCREEN) {
// "alt"
// } else {
// "normal"
// },
// );
// if mode.contains(TermMode::APP_CURSOR) {
// keymap.add_identifier("DECCKM");
// }
// if mode.contains(TermMode::APP_KEYPAD) {
// keymap.add_identifier("DECPAM");
// } else {
// keymap.add_identifier("DECPNM");
// }
// if mode.contains(TermMode::SHOW_CURSOR) {
// keymap.add_identifier("DECTCEM");
// }
// if mode.contains(TermMode::LINE_WRAP) {
// keymap.add_identifier("DECAWM");
// }
// if mode.contains(TermMode::ORIGIN) {
// keymap.add_identifier("DECOM");
// }
// if mode.contains(TermMode::INSERT) {
// keymap.add_identifier("IRM");
// }
// //LNM is apparently the name for this. https://vt100.net/docs/vt510-rm/LNM.html
// if mode.contains(TermMode::LINE_FEED_NEW_LINE) {
// keymap.add_identifier("LNM");
// }
// if mode.contains(TermMode::FOCUS_IN_OUT) {
// keymap.add_identifier("report_focus");
// }
// if mode.contains(TermMode::ALTERNATE_SCROLL) {
// keymap.add_identifier("alternate_scroll");
// }
// if mode.contains(TermMode::BRACKETED_PASTE) {
// keymap.add_identifier("bracketed_paste");
// }
// if mode.intersects(TermMode::MOUSE_MODE) {
// keymap.add_identifier("any_mouse_reporting");
// }
// {
// let mouse_reporting = if mode.contains(TermMode::MOUSE_REPORT_CLICK) {
// "click"
// } else if mode.contains(TermMode::MOUSE_DRAG) {
// "drag"
// } else if mode.contains(TermMode::MOUSE_MOTION) {
// "motion"
// } else {
// "off"
// };
// keymap.add_key("mouse_reporting", mouse_reporting);
// }
// {
// let format = if mode.contains(TermMode::SGR_MOUSE) {
// "sgr"
// } else if mode.contains(TermMode::UTF8_MOUSE) {
// "utf8"
// } else {
// "normal"
// };
// keymap.add_key("mouse_format", format);
// }
// }
impl InputHandler for TerminalView {
fn text_for_range(
&mut self,
range: std::ops::Range<usize>,
cx: &mut ViewContext<Self>,
) -> Option<String> {
todo!()
}
fn selected_text_range(
&mut self,
cx: &mut ViewContext<Self>,
) -> Option<std::ops::Range<usize>> {
if self
.terminal
.read(cx)
.last_content
.mode
.contains(TermMode::ALT_SCREEN)
{
None
} else {
Some(0..0)
}
}
fn marked_text_range(&self, cx: &mut ViewContext<Self>) -> Option<std::ops::Range<usize>> {
todo!()
}
fn unmark_text(&mut self, cx: &mut ViewContext<Self>) {
todo!()
}
fn replace_text_in_range(
&mut self,
_: Option<std::ops::Range<usize>>,
text: &str,
cx: &mut ViewContext<Self>,
) {
self.terminal.update(cx, |terminal, _| {
terminal.input(text.into());
});
}
fn replace_and_mark_text_in_range(
&mut self,
range: Option<std::ops::Range<usize>>,
new_text: &str,
new_selected_range: Option<std::ops::Range<usize>>,
cx: &mut ViewContext<Self>,
) {
todo!()
}
fn bounds_for_range(
&mut self,
range_utf16: std::ops::Range<usize>,
element_bounds: gpui::Bounds<Pixels>,
cx: &mut ViewContext<Self>,
) -> Option<gpui::Bounds<Pixels>> {
todo!()
}
}
impl Item for TerminalView { impl Item for TerminalView {
type Event = ItemEvent;
fn tab_tooltip_text(&self, cx: &AppContext) -> Option<SharedString> { fn tab_tooltip_text(&self, cx: &AppContext) -> Option<SharedString> {
Some(self.terminal().read(cx).title().into()) Some(self.terminal().read(cx).title().into())
} }
@ -743,7 +681,8 @@ impl Item for TerminalView {
fn tab_content(&self, _detail: Option<usize>, cx: &WindowContext) -> AnyElement { fn tab_content(&self, _detail: Option<usize>, cx: &WindowContext) -> AnyElement {
let title = self.terminal().read(cx).title(); let title = self.terminal().read(cx).title();
div() h_stack()
.gap_2()
.child(IconElement::new(Icon::Terminal)) .child(IconElement::new(Icon::Terminal))
.child(Label::new(title)) .child(Label::new(title))
.into_any() .into_any()
@ -776,7 +715,7 @@ impl Item for TerminalView {
false false
} }
// todo!() // todo!(search)
// fn as_searchable(&self, handle: &View<Self>) -> Option<Box<dyn SearchableItemHandle>> { // fn as_searchable(&self, handle: &View<Self>) -> Option<Box<dyn SearchableItemHandle>> {
// Some(Box::new(handle.clone())) // Some(Box::new(handle.clone()))
// } // }
@ -806,22 +745,23 @@ impl Item for TerminalView {
let window = cx.window_handle(); let window = cx.window_handle();
cx.spawn(|pane, mut cx| async move { cx.spawn(|pane, mut cx| async move {
let cwd = None; let cwd = None;
// todo!() TERMINAL_DB
// TERMINAL_DB .get_working_directory(item_id, workspace_id)
// .get_working_directory(item_id, workspace_id) .log_err()
// .log_err() .flatten()
// .flatten() .or_else(|| {
// .or_else(|| { cx.update(|_, cx| {
// cx.read(|cx| { let strategy = TerminalSettings::get_global(cx).working_directory.clone();
// let strategy = TerminalSettings::get_global(cx).working_directory.clone(); workspace
// workspace .upgrade()
// .upgrade() .map(|workspace| {
// .map(|workspace| { get_working_directory(workspace.read(cx), cx, strategy)
// get_working_directory(workspace.read(cx), cx, strategy) })
// }) .flatten()
// .flatten() })
// }) .ok()
// }); .flatten()
});
let terminal = project.update(&mut cx, |project, cx| { let terminal = project.update(&mut cx, |project, cx| {
project.create_terminal(cwd, window, cx) project.create_terminal(cwd, window, cx)
@ -833,16 +773,19 @@ impl Item for TerminalView {
} }
fn added_to_workspace(&mut self, workspace: &mut Workspace, cx: &mut ViewContext<Self>) { fn added_to_workspace(&mut self, workspace: &mut Workspace, cx: &mut ViewContext<Self>) {
// todo!() cx.background_executor()
// cx.background() .spawn(TERMINAL_DB.update_workspace_id(
// .spawn(TERMINAL_DB.update_workspace_id( workspace.database_id(),
// workspace.database_id(), self.workspace_id,
// self.workspace_id, cx.entity_id().as_u64(),
// cx.view_id(), ))
// )) .detach();
// .detach();
self.workspace_id = workspace.database_id(); self.workspace_id = workspace.database_id();
} }
fn to_item_events(event: &Self::Event, mut f: impl FnMut(ItemEvent)) {
f(*event)
}
} }
impl SearchableItem for TerminalView { impl SearchableItem for TerminalView {

View file

@ -5,7 +5,7 @@ use crate::ColorScale;
use crate::{SystemColors, ThemeColors}; use crate::{SystemColors, ThemeColors};
pub(crate) fn neutral() -> ColorScaleSet { pub(crate) fn neutral() -> ColorScaleSet {
slate() sand()
} }
impl ThemeColors { impl ThemeColors {
@ -29,12 +29,12 @@ impl ThemeColors {
element_disabled: neutral().light_alpha().step_3(), element_disabled: neutral().light_alpha().step_3(),
drop_target_background: blue().light_alpha().step_2(), drop_target_background: blue().light_alpha().step_2(),
ghost_element_background: system.transparent, ghost_element_background: system.transparent,
ghost_element_hover: neutral().light_alpha().step_4(), ghost_element_hover: neutral().light_alpha().step_3(),
ghost_element_active: neutral().light_alpha().step_5(), ghost_element_active: neutral().light_alpha().step_4(),
ghost_element_selected: neutral().light_alpha().step_5(), ghost_element_selected: neutral().light_alpha().step_5(),
ghost_element_disabled: neutral().light_alpha().step_3(), ghost_element_disabled: neutral().light_alpha().step_3(),
text: yellow().light().step_9(), text: neutral().light().step_12(),
text_muted: neutral().light().step_11(), text_muted: neutral().light().step_10(),
text_placeholder: neutral().light().step_10(), text_placeholder: neutral().light().step_10(),
text_disabled: neutral().light().step_9(), text_disabled: neutral().light().step_9(),
text_accent: blue().light().step_11(), text_accent: blue().light().step_11(),
@ -49,17 +49,19 @@ impl ThemeColors {
tab_bar_background: neutral().light().step_2(), tab_bar_background: neutral().light().step_2(),
tab_active_background: neutral().light().step_1(), tab_active_background: neutral().light().step_1(),
tab_inactive_background: neutral().light().step_2(), tab_inactive_background: neutral().light().step_2(),
search_match_background: neutral().light().step_2(), // todo!(this was inserted by Mikayla)
editor_background: neutral().light().step_1(), editor_background: neutral().light().step_1(),
editor_gutter_background: neutral().light().step_1(), // todo!("pick the right colors") editor_gutter_background: neutral().light().step_1(), // todo!("pick the right colors")
editor_subheader_background: neutral().light().step_2(), editor_subheader_background: neutral().light().step_2(),
editor_active_line_background: neutral().light_alpha().step_3(), editor_active_line_background: neutral().light_alpha().step_3(),
editor_line_number: neutral().light_alpha().step_3(), // todo!("pick the right colors") editor_line_number: neutral().light().step_10(),
editor_active_line_number: neutral().light_alpha().step_3(), // todo!("pick the right colors") editor_active_line_number: neutral().light().step_11(),
editor_highlighted_line_background: neutral().light_alpha().step_4(), // todo!("pick the right colors") editor_highlighted_line_background: neutral().light_alpha().step_3(),
editor_invisible: neutral().light_alpha().step_4(), // todo!("pick the right colors") editor_invisible: neutral().light().step_10(),
editor_wrap_guide: neutral().light_alpha().step_4(), // todo!("pick the right colors") editor_wrap_guide: neutral().light_alpha().step_7(),
editor_active_wrap_guide: neutral().light_alpha().step_4(), // todo!("pick the right colors") editor_active_wrap_guide: neutral().light_alpha().step_8(), // todo!("pick the right colors")
editor_document_highlight_read_background: neutral().light_alpha().step_4(), // todo!("pick the right colors") editor_document_highlight_read_background: neutral().light_alpha().step_3(), // todo!("pick the right colors")
editor_document_highlight_write_background: neutral().light_alpha().step_4(), // todo!("pick the right colors") editor_document_highlight_write_background: neutral().light_alpha().step_4(), // todo!("pick the right colors")
terminal_background: neutral().light().step_1(), terminal_background: neutral().light().step_1(),
terminal_ansi_black: black().light().step_12(), terminal_ansi_black: black().light().step_12(),
@ -121,6 +123,8 @@ impl ThemeColors {
tab_bar_background: neutral().dark().step_2(), tab_bar_background: neutral().dark().step_2(),
tab_active_background: neutral().dark().step_1(), tab_active_background: neutral().dark().step_1(),
tab_inactive_background: neutral().dark().step_2(), tab_inactive_background: neutral().dark().step_2(),
search_match_background: neutral().dark().step_2(), // todo!(this was inserted by Mikayla)
editor_background: neutral().dark().step_1(), editor_background: neutral().dark().step_1(),
editor_gutter_background: neutral().dark().step_1(), editor_gutter_background: neutral().dark().step_1(),
editor_subheader_background: neutral().dark().step_3(), editor_subheader_background: neutral().dark().step_3(),

View file

@ -1,47 +1,51 @@
use std::sync::Arc;
use crate::{ use crate::{
default_color_scales,
one_themes::{one_dark, one_family}, one_themes::{one_dark, one_family},
Theme, ThemeFamily, Appearance, PlayerColors, StatusColors, SyntaxTheme, SystemColors, Theme, ThemeColors,
ThemeFamily, ThemeStyles,
}; };
// fn zed_pro_daylight() -> Theme { fn zed_pro_daylight() -> Theme {
// Theme { Theme {
// id: "zed_pro_daylight".to_string(), id: "zed_pro_daylight".to_string(),
// name: "Zed Pro Daylight".into(), name: "Zed Pro Daylight".into(),
// appearance: Appearance::Light, appearance: Appearance::Light,
// styles: ThemeStyles { styles: ThemeStyles {
// system: SystemColors::default(), system: SystemColors::default(),
// colors: ThemeColors::light(), colors: ThemeColors::light(),
// status: StatusColors::light(), status: StatusColors::light(),
// player: PlayerColors::light(), player: PlayerColors::light(),
// syntax: Arc::new(SyntaxTheme::light()), syntax: Arc::new(SyntaxTheme::light()),
// }, },
// } }
// } }
// pub(crate) fn zed_pro_moonlight() -> Theme { pub(crate) fn zed_pro_moonlight() -> Theme {
// Theme { Theme {
// id: "zed_pro_moonlight".to_string(), id: "zed_pro_moonlight".to_string(),
// name: "Zed Pro Moonlight".into(), name: "Zed Pro Moonlight".into(),
// appearance: Appearance::Dark, appearance: Appearance::Dark,
// styles: ThemeStyles { styles: ThemeStyles {
// system: SystemColors::default(), system: SystemColors::default(),
// colors: ThemeColors::dark(), colors: ThemeColors::dark(),
// status: StatusColors::dark(), status: StatusColors::dark(),
// player: PlayerColors::dark(), player: PlayerColors::dark(),
// syntax: Arc::new(SyntaxTheme::dark()), syntax: Arc::new(SyntaxTheme::dark()),
// }, },
// } }
// } }
// pub fn zed_pro_family() -> ThemeFamily { pub fn zed_pro_family() -> ThemeFamily {
// ThemeFamily { ThemeFamily {
// id: "zed_pro".to_string(), id: "zed_pro".to_string(),
// name: "Zed Pro".into(), name: "Zed Pro".into(),
// author: "Zed Team".into(), author: "Zed Team".into(),
// themes: vec![zed_pro_daylight(), zed_pro_moonlight()], themes: vec![zed_pro_daylight(), zed_pro_moonlight()],
// scales: default_color_scales(), scales: default_color_scales(),
// } }
// } }
impl Default for ThemeFamily { impl Default for ThemeFamily {
fn default() -> Self { fn default() -> Self {

View file

@ -75,6 +75,8 @@ pub(crate) fn one_dark() -> Theme {
tab_bar_background: bg, tab_bar_background: bg,
tab_inactive_background: bg, tab_inactive_background: bg,
tab_active_background: editor, tab_active_background: editor,
search_match_background: bg, // todo!(this was inserted by Mikayla)
editor_background: editor, editor_background: editor,
editor_gutter_background: editor, editor_gutter_background: editor,
editor_subheader_background: bg, editor_subheader_background: bg,
@ -92,6 +94,7 @@ pub(crate) fn one_dark() -> Theme {
0.2, 0.2,
), ),
editor_document_highlight_write_background: gpui::red(), editor_document_highlight_write_background: gpui::red(),
terminal_background: bg, terminal_background: bg,
// todo!("Use one colors for terminal") // todo!("Use one colors for terminal")
terminal_ansi_black: crate::black().dark().step_12(), terminal_ansi_black: crate::black().dark().step_12(),
@ -191,8 +194,6 @@ pub(crate) fn one_dark() -> Theme {
("variable.special".into(), red.into()), ("variable.special".into(), red.into()),
("variant".into(), HighlightStyle::default()), ("variant".into(), HighlightStyle::default()),
], ],
inlay_style: HighlightStyle::default(),
suggestion_style: HighlightStyle::default(),
}), }),
}, },
} }

View file

@ -6,8 +6,8 @@ use gpui::{HighlightStyle, SharedString};
use refineable::Refineable; use refineable::Refineable;
use crate::{ use crate::{
one_themes::one_family, Appearance, PlayerColors, StatusColors, SyntaxTheme, SystemColors, one_themes::one_family, zed_pro_family, Appearance, PlayerColors, StatusColors, SyntaxTheme,
Theme, ThemeColors, ThemeFamily, ThemeStyles, UserTheme, UserThemeFamily, SystemColors, Theme, ThemeColors, ThemeFamily, ThemeStyles, UserTheme, UserThemeFamily,
}; };
pub struct ThemeRegistry { pub struct ThemeRegistry {
@ -117,7 +117,7 @@ impl Default for ThemeRegistry {
themes: HashMap::default(), themes: HashMap::default(),
}; };
this.insert_theme_families([one_family()]); this.insert_theme_families([zed_pro_family(), one_family()]);
this this
} }

View file

@ -27,7 +27,7 @@ pub struct ThemeSettings {
} }
#[derive(Default)] #[derive(Default)]
pub struct AdjustedBufferFontSize(Option<Pixels>); pub struct AdjustedBufferFontSize(Pixels);
#[derive(Clone, Debug, Default, Serialize, Deserialize, JsonSchema)] #[derive(Clone, Debug, Default, Serialize, Deserialize, JsonSchema)]
pub struct ThemeSettingsContent { pub struct ThemeSettingsContent {
@ -69,12 +69,10 @@ impl BufferLineHeight {
} }
impl ThemeSettings { impl ThemeSettings {
pub fn buffer_font_size(&self, cx: &mut AppContext) -> Pixels { pub fn buffer_font_size(&self, cx: &AppContext) -> Pixels {
let font_size = *cx cx.try_global::<AdjustedBufferFontSize>()
.default_global::<AdjustedBufferFontSize>() .map_or(self.buffer_font_size, |size| size.0)
.0 .max(MIN_FONT_SIZE)
.get_or_insert(self.buffer_font_size.into());
font_size.max(MIN_FONT_SIZE)
} }
pub fn line_height(&self) -> f32 { pub fn line_height(&self) -> f32 {
@ -83,9 +81,9 @@ impl ThemeSettings {
} }
pub fn adjusted_font_size(size: Pixels, cx: &mut AppContext) -> Pixels { pub fn adjusted_font_size(size: Pixels, cx: &mut AppContext) -> Pixels {
if let Some(adjusted_size) = cx.default_global::<AdjustedBufferFontSize>().0 { if let Some(AdjustedBufferFontSize(adjusted_size)) = cx.try_global::<AdjustedBufferFontSize>() {
let buffer_font_size = ThemeSettings::get_global(cx).buffer_font_size; let buffer_font_size = ThemeSettings::get_global(cx).buffer_font_size;
let delta = adjusted_size - buffer_font_size; let delta = *adjusted_size - buffer_font_size;
size + delta size + delta
} else { } else {
size size
@ -95,18 +93,19 @@ pub fn adjusted_font_size(size: Pixels, cx: &mut AppContext) -> Pixels {
pub fn adjust_font_size(cx: &mut AppContext, f: fn(&mut Pixels)) { pub fn adjust_font_size(cx: &mut AppContext, f: fn(&mut Pixels)) {
let buffer_font_size = ThemeSettings::get_global(cx).buffer_font_size; let buffer_font_size = ThemeSettings::get_global(cx).buffer_font_size;
let adjusted_size = cx let mut adjusted_size = cx
.default_global::<AdjustedBufferFontSize>() .try_global::<AdjustedBufferFontSize>()
.0 .map_or(buffer_font_size, |adjusted_size| adjusted_size.0);
.get_or_insert(buffer_font_size);
f(adjusted_size); f(&mut adjusted_size);
*adjusted_size = (*adjusted_size).max(MIN_FONT_SIZE - buffer_font_size); adjusted_size = adjusted_size.max(MIN_FONT_SIZE);
cx.set_global(AdjustedBufferFontSize(adjusted_size));
cx.refresh(); cx.refresh();
} }
pub fn reset_font_size(cx: &mut AppContext) { pub fn reset_font_size(cx: &mut AppContext) {
if cx.has_global::<AdjustedBufferFontSize>() { if cx.has_global::<AdjustedBufferFontSize>() {
cx.global_mut::<AdjustedBufferFontSize>().0 = None; cx.remove_global::<AdjustedBufferFontSize>();
cx.refresh(); cx.refresh();
} }
} }

View file

@ -114,6 +114,7 @@ pub struct ThemeColors {
pub tab_bar_background: Hsla, pub tab_bar_background: Hsla,
pub tab_inactive_background: Hsla, pub tab_inactive_background: Hsla,
pub tab_active_background: Hsla, pub tab_active_background: Hsla,
pub search_match_background: Hsla,
// pub panel_background: Hsla, // pub panel_background: Hsla,
// pub pane_focused_border: Hsla, // pub pane_focused_border: Hsla,
// /// The color of the scrollbar thumb. // /// The color of the scrollbar thumb.

View file

@ -8,12 +8,6 @@ use crate::{
#[derive(Clone, Default)] #[derive(Clone, Default)]
pub struct SyntaxTheme { pub struct SyntaxTheme {
pub highlights: Vec<(String, HighlightStyle)>, pub highlights: Vec<(String, HighlightStyle)>,
// todo!("Remove this in favor of StatusColor.hint")
// If this should be overridable we should move it to ThemeColors
pub inlay_style: HighlightStyle,
// todo!("Remove this in favor of StatusColor.prediction")
// If this should be overridable we should move it to ThemeColors
pub suggestion_style: HighlightStyle,
} }
impl SyntaxTheme { impl SyntaxTheme {
@ -22,8 +16,8 @@ impl SyntaxTheme {
highlights: vec![ highlights: vec![
("attribute".into(), cyan().light().step_11().into()), ("attribute".into(), cyan().light().step_11().into()),
("boolean".into(), tomato().light().step_11().into()), ("boolean".into(), tomato().light().step_11().into()),
("comment".into(), neutral().light().step_11().into()), ("comment".into(), neutral().light().step_10().into()),
("comment.doc".into(), iris().light().step_12().into()), ("comment.doc".into(), iris().light().step_11().into()),
("constant".into(), red().light().step_9().into()), ("constant".into(), red().light().step_9().into()),
("constructor".into(), red().light().step_9().into()), ("constructor".into(), red().light().step_9().into()),
("embedded".into(), red().light().step_9().into()), ("embedded".into(), red().light().step_9().into()),
@ -32,11 +26,11 @@ impl SyntaxTheme {
("enum".into(), red().light().step_9().into()), ("enum".into(), red().light().step_9().into()),
("function".into(), red().light().step_9().into()), ("function".into(), red().light().step_9().into()),
("hint".into(), red().light().step_9().into()), ("hint".into(), red().light().step_9().into()),
("keyword".into(), orange().light().step_11().into()), ("keyword".into(), orange().light().step_9().into()),
("label".into(), red().light().step_9().into()), ("label".into(), red().light().step_9().into()),
("link_text".into(), red().light().step_9().into()), ("link_text".into(), red().light().step_9().into()),
("link_uri".into(), red().light().step_9().into()), ("link_uri".into(), red().light().step_9().into()),
("number".into(), red().light().step_9().into()), ("number".into(), purple().light().step_10().into()),
("operator".into(), red().light().step_9().into()), ("operator".into(), red().light().step_9().into()),
("predictive".into(), red().light().step_9().into()), ("predictive".into(), red().light().step_9().into()),
("preproc".into(), red().light().step_9().into()), ("preproc".into(), red().light().step_9().into()),
@ -49,16 +43,16 @@ impl SyntaxTheme {
), ),
( (
"punctuation.delimiter".into(), "punctuation.delimiter".into(),
neutral().light().step_11().into(), neutral().light().step_10().into(),
), ),
( (
"punctuation.list_marker".into(), "punctuation.list_marker".into(),
blue().light().step_11().into(), blue().light().step_11().into(),
), ),
("punctuation.special".into(), red().light().step_9().into()), ("punctuation.special".into(), red().light().step_9().into()),
("string".into(), jade().light().step_11().into()), ("string".into(), jade().light().step_9().into()),
("string.escape".into(), red().light().step_9().into()), ("string.escape".into(), red().light().step_9().into()),
("string.regex".into(), tomato().light().step_11().into()), ("string.regex".into(), tomato().light().step_9().into()),
("string.special".into(), red().light().step_9().into()), ("string.special".into(), red().light().step_9().into()),
( (
"string.special.symbol".into(), "string.special.symbol".into(),
@ -67,13 +61,11 @@ impl SyntaxTheme {
("tag".into(), red().light().step_9().into()), ("tag".into(), red().light().step_9().into()),
("text.literal".into(), red().light().step_9().into()), ("text.literal".into(), red().light().step_9().into()),
("title".into(), red().light().step_9().into()), ("title".into(), red().light().step_9().into()),
("type".into(), red().light().step_9().into()), ("type".into(), cyan().light().step_9().into()),
("variable".into(), red().light().step_9().into()), ("variable".into(), red().light().step_9().into()),
("variable.special".into(), red().light().step_9().into()), ("variable.special".into(), red().light().step_9().into()),
("variant".into(), red().light().step_9().into()), ("variant".into(), red().light().step_9().into()),
], ],
inlay_style: tomato().light().step_1().into(), // todo!("nate: use a proper style")
suggestion_style: orange().light().step_1().into(), // todo!("nate: use proper style")
} }
} }
@ -132,8 +124,6 @@ impl SyntaxTheme {
("variable.special".into(), red().dark().step_11().into()), ("variable.special".into(), red().dark().step_11().into()),
("variant".into(), red().dark().step_11().into()), ("variant".into(), red().dark().step_11().into()),
], ],
inlay_style: neutral().dark().step_11().into(), // todo!("nate: use a proper style")
suggestion_style: orange().dark().step_11().into(), // todo!("nate: use a proper style")
} }
} }
@ -152,8 +142,6 @@ impl SyntaxTheme {
) )
}) })
.collect(), .collect(),
inlay_style: HighlightStyle::default(),
suggestion_style: HighlightStyle::default(),
} }
} }

View file

@ -5,6 +5,7 @@ mod context_menu;
mod disclosure; mod disclosure;
mod divider; mod divider;
mod icon; mod icon;
mod indicator;
mod keybinding; mod keybinding;
mod label; mod label;
mod list; mod list;
@ -24,6 +25,7 @@ pub use context_menu::*;
pub use disclosure::*; pub use disclosure::*;
pub use divider::*; pub use divider::*;
pub use icon::*; pub use icon::*;
pub use indicator::*;
pub use keybinding::*; pub use keybinding::*;
pub use label::*; pub use label::*;
pub use list::*; pub use list::*;

View file

@ -359,11 +359,7 @@ impl RenderOnce for ButtonLike {
}, },
) )
.when_some(self.tooltip, |this, tooltip| { .when_some(self.tooltip, |this, tooltip| {
if !self.selected {
this.tooltip(move |cx| tooltip(cx)) this.tooltip(move |cx| tooltip(cx))
} else {
this
}
}) })
.children(self.children) .children(self.children)
} }

View file

@ -1,4 +1,4 @@
use gpui::{Action, AnyView, DefiniteLength}; use gpui::{AnyView, DefiniteLength};
use crate::prelude::*; use crate::prelude::*;
use crate::{ButtonCommon, ButtonLike, ButtonSize, ButtonStyle, Icon, IconSize}; use crate::{ButtonCommon, ButtonLike, ButtonSize, ButtonStyle, Icon, IconSize};
@ -39,10 +39,6 @@ impl IconButton {
self.selected_icon = icon.into(); self.selected_icon = icon.into();
self self
} }
pub fn action(self, action: Box<dyn Action>) -> Self {
self.on_click(move |_event, cx| cx.dispatch_action(action.boxed_clone()))
}
} }
impl Disableable for IconButton { impl Disableable for IconButton {

View file

@ -1,15 +1,26 @@
use gpui::{rems, svg, IntoElement, Svg}; use gpui::{rems, svg, IntoElement, Rems, Svg};
use strum::EnumIter; use strum::EnumIter;
use crate::prelude::*; use crate::prelude::*;
#[derive(Default, PartialEq, Copy, Clone)] #[derive(Default, PartialEq, Copy, Clone)]
pub enum IconSize { pub enum IconSize {
XSmall,
Small, Small,
#[default] #[default]
Medium, Medium,
} }
impl IconSize {
pub fn rems(self) -> Rems {
match self {
IconSize::XSmall => rems(12. / 16.),
IconSize::Small => rems(14. / 16.),
IconSize::Medium => rems(16. / 16.),
}
}
}
#[derive(Debug, PartialEq, Copy, Clone, EnumIter)] #[derive(Debug, PartialEq, Copy, Clone, EnumIter)]
pub enum Icon { pub enum Icon {
Ai, Ai,
@ -81,6 +92,8 @@ pub enum Icon {
Shift, Shift,
Option, Option,
Return, Return,
Update,
ZedXCopilot,
} }
impl Icon { impl Icon {
@ -109,6 +122,7 @@ impl Icon {
Icon::Close => "icons/x.svg", Icon::Close => "icons/x.svg",
Icon::Collab => "icons/user_group_16.svg", Icon::Collab => "icons/user_group_16.svg",
Icon::Copilot => "icons/copilot.svg", Icon::Copilot => "icons/copilot.svg",
Icon::CopilotInit => "icons/copilot_init.svg", Icon::CopilotInit => "icons/copilot_init.svg",
Icon::CopilotError => "icons/copilot_error.svg", Icon::CopilotError => "icons/copilot_error.svg",
Icon::CopilotDisabled => "icons/copilot_disabled.svg", Icon::CopilotDisabled => "icons/copilot_disabled.svg",
@ -155,6 +169,8 @@ impl Icon {
Icon::Shift => "icons/shift.svg", Icon::Shift => "icons/shift.svg",
Icon::Option => "icons/option.svg", Icon::Option => "icons/option.svg",
Icon::Return => "icons/return.svg", Icon::Return => "icons/return.svg",
Icon::Update => "icons/update.svg",
Icon::ZedXCopilot => "icons/zed_x_copilot.svg",
} }
} }
} }
@ -170,13 +186,8 @@ impl RenderOnce for IconElement {
type Rendered = Svg; type Rendered = Svg;
fn render(self, cx: &mut WindowContext) -> Self::Rendered { fn render(self, cx: &mut WindowContext) -> Self::Rendered {
let svg_size = match self.size {
IconSize::Small => rems(14. / 16.),
IconSize::Medium => rems(16. / 16.),
};
svg() svg()
.size(svg_size) .size(self.size.rems())
.flex_none() .flex_none()
.path(self.path) .path(self.path)
.text_color(self.color.color(cx)) .text_color(self.color.color(cx))

View file

@ -0,0 +1,60 @@
use gpui::{Div, Position};
use crate::prelude::*;
#[derive(Default)]
pub enum IndicatorStyle {
#[default]
Dot,
Bar,
}
#[derive(IntoElement)]
pub struct Indicator {
position: Position,
style: IndicatorStyle,
color: Color,
}
impl Indicator {
pub fn dot() -> Self {
Self {
position: Position::Relative,
style: IndicatorStyle::Dot,
color: Color::Default,
}
}
pub fn bar() -> Self {
Self {
position: Position::Relative,
style: IndicatorStyle::Dot,
color: Color::Default,
}
}
pub fn color(mut self, color: Color) -> Self {
self.color = color;
self
}
pub fn absolute(mut self) -> Self {
self.position = Position::Absolute;
self
}
}
impl RenderOnce for Indicator {
type Rendered = Div;
fn render(self, cx: &mut WindowContext) -> Self::Rendered {
div()
.flex_none()
.map(|this| match self.style {
IndicatorStyle::Dot => this.w_1p5().h_1p5().rounded_full(),
IndicatorStyle::Bar => this.w_full().h_1p5().rounded_t_md(),
})
.when(self.position == Position::Absolute, |this| this.absolute())
.bg(self.color.color(cx))
}
}

View file

@ -1,180 +1,7 @@
use std::ops::Range; mod highlighted_label;
mod label;
mod label_like;
use crate::prelude::*; pub use highlighted_label::*;
use crate::styled_ext::StyledExt; pub use label::*;
use gpui::{relative, Div, HighlightStyle, IntoElement, StyledText, WindowContext}; pub use label_like::*;
#[derive(Debug, PartialEq, Eq, PartialOrd, Ord, Hash, Clone, Copy, Default)]
pub enum LabelSize {
#[default]
Default,
Small,
}
#[derive(Default, PartialEq, Copy, Clone)]
pub enum LineHeightStyle {
#[default]
TextLabel,
/// Sets the line height to 1
UILabel,
}
#[derive(IntoElement, Clone)]
pub struct Label {
label: SharedString,
size: LabelSize,
line_height_style: LineHeightStyle,
color: Color,
strikethrough: bool,
}
impl RenderOnce for Label {
type Rendered = Div;
fn render(self, cx: &mut WindowContext) -> Self::Rendered {
div()
.when(self.strikethrough, |this| {
this.relative().child(
div()
.absolute()
.top_1_2()
.w_full()
.h_px()
.bg(Color::Hidden.color(cx)),
)
})
.map(|this| match self.size {
LabelSize::Default => this.text_ui(),
LabelSize::Small => this.text_ui_sm(),
})
.when(self.line_height_style == LineHeightStyle::UILabel, |this| {
this.line_height(relative(1.))
})
.text_color(self.color.color(cx))
.child(self.label.clone())
}
}
impl Label {
pub fn new(label: impl Into<SharedString>) -> Self {
Self {
label: label.into(),
size: LabelSize::Default,
line_height_style: LineHeightStyle::default(),
color: Color::Default,
strikethrough: false,
}
}
pub fn size(mut self, size: LabelSize) -> Self {
self.size = size;
self
}
pub fn color(mut self, color: Color) -> Self {
self.color = color;
self
}
pub fn line_height_style(mut self, line_height_style: LineHeightStyle) -> Self {
self.line_height_style = line_height_style;
self
}
pub fn set_strikethrough(mut self, strikethrough: bool) -> Self {
self.strikethrough = strikethrough;
self
}
}
#[derive(IntoElement)]
pub struct HighlightedLabel {
label: SharedString,
size: LabelSize,
color: Color,
highlight_indices: Vec<usize>,
strikethrough: bool,
}
impl RenderOnce for HighlightedLabel {
type Rendered = Div;
fn render(self, cx: &mut WindowContext) -> Self::Rendered {
let highlight_color = cx.theme().colors().text_accent;
let mut highlight_indices = self.highlight_indices.iter().copied().peekable();
let mut highlights: Vec<(Range<usize>, HighlightStyle)> = Vec::new();
while let Some(start_ix) = highlight_indices.next() {
let mut end_ix = start_ix;
loop {
end_ix = end_ix + self.label[end_ix..].chars().next().unwrap().len_utf8();
if let Some(&next_ix) = highlight_indices.peek() {
if next_ix == end_ix {
end_ix = next_ix;
highlight_indices.next();
continue;
}
}
break;
}
highlights.push((
start_ix..end_ix,
HighlightStyle {
color: Some(highlight_color),
..Default::default()
},
));
}
div()
.flex()
.when(self.strikethrough, |this| {
this.relative().child(
div()
.absolute()
.top_px()
.my_auto()
.w_full()
.h_px()
.bg(Color::Hidden.color(cx)),
)
})
.map(|this| match self.size {
LabelSize::Default => this.text_ui(),
LabelSize::Small => this.text_ui_sm(),
})
.child(StyledText::new(self.label).with_highlights(&cx.text_style(), highlights))
}
}
impl HighlightedLabel {
/// shows a label with the given characters highlighted.
/// characters are identified by utf8 byte position.
pub fn new(label: impl Into<SharedString>, highlight_indices: Vec<usize>) -> Self {
Self {
label: label.into(),
size: LabelSize::Default,
color: Color::Default,
highlight_indices,
strikethrough: false,
}
}
pub fn size(mut self, size: LabelSize) -> Self {
self.size = size;
self
}
pub fn color(mut self, color: Color) -> Self {
self.color = color;
self
}
pub fn set_strikethrough(mut self, strikethrough: bool) -> Self {
self.strikethrough = strikethrough;
self
}
}

View file

@ -0,0 +1,86 @@
use std::ops::Range;
use gpui::{HighlightStyle, StyledText};
use crate::{prelude::*, LabelCommon, LabelLike, LabelSize, LineHeightStyle};
#[derive(IntoElement)]
pub struct HighlightedLabel {
base: LabelLike,
label: SharedString,
highlight_indices: Vec<usize>,
}
impl HighlightedLabel {
/// Constructs a label with the given characters highlighted.
/// Characters are identified by UTF-8 byte position.
pub fn new(label: impl Into<SharedString>, highlight_indices: Vec<usize>) -> Self {
Self {
base: LabelLike::new(),
label: label.into(),
highlight_indices,
}
}
}
impl LabelCommon for HighlightedLabel {
fn size(mut self, size: LabelSize) -> Self {
self.base = self.base.size(size);
self
}
fn line_height_style(mut self, line_height_style: LineHeightStyle) -> Self {
self.base = self.base.line_height_style(line_height_style);
self
}
fn color(mut self, color: Color) -> Self {
self.base = self.base.color(color);
self
}
fn strikethrough(mut self, strikethrough: bool) -> Self {
self.base = self.base.strikethrough(strikethrough);
self
}
}
impl RenderOnce for HighlightedLabel {
type Rendered = LabelLike;
fn render(self, cx: &mut WindowContext) -> Self::Rendered {
let highlight_color = cx.theme().colors().text_accent;
let mut highlight_indices = self.highlight_indices.iter().copied().peekable();
let mut highlights: Vec<(Range<usize>, HighlightStyle)> = Vec::new();
while let Some(start_ix) = highlight_indices.next() {
let mut end_ix = start_ix;
loop {
end_ix = end_ix + self.label[end_ix..].chars().next().unwrap().len_utf8();
if let Some(&next_ix) = highlight_indices.peek() {
if next_ix == end_ix {
end_ix = next_ix;
highlight_indices.next();
continue;
}
}
break;
}
highlights.push((
start_ix..end_ix,
HighlightStyle {
color: Some(highlight_color),
..Default::default()
},
));
}
let mut text_style = cx.text_style().clone();
text_style.color = self.base.color.color(cx);
LabelLike::new().child(StyledText::new(self.label).with_highlights(&text_style, highlights))
}
}

View file

@ -0,0 +1,48 @@
use gpui::WindowContext;
use crate::{prelude::*, LabelCommon, LabelLike, LabelSize, LineHeightStyle};
#[derive(IntoElement)]
pub struct Label {
base: LabelLike,
label: SharedString,
}
impl Label {
pub fn new(label: impl Into<SharedString>) -> Self {
Self {
base: LabelLike::new(),
label: label.into(),
}
}
}
impl LabelCommon for Label {
fn size(mut self, size: LabelSize) -> Self {
self.base = self.base.size(size);
self
}
fn line_height_style(mut self, line_height_style: LineHeightStyle) -> Self {
self.base = self.base.line_height_style(line_height_style);
self
}
fn color(mut self, color: Color) -> Self {
self.base = self.base.color(color);
self
}
fn strikethrough(mut self, strikethrough: bool) -> Self {
self.base = self.base.strikethrough(strikethrough);
self
}
}
impl RenderOnce for Label {
type Rendered = LabelLike;
fn render(self, _cx: &mut WindowContext) -> Self::Rendered {
self.base.child(self.label)
}
}

View file

@ -0,0 +1,102 @@
use gpui::{relative, AnyElement, Div, Styled};
use smallvec::SmallVec;
use crate::prelude::*;
#[derive(Debug, PartialEq, Eq, PartialOrd, Ord, Hash, Clone, Copy, Default)]
pub enum LabelSize {
#[default]
Default,
Small,
}
#[derive(Default, PartialEq, Copy, Clone)]
pub enum LineHeightStyle {
#[default]
TextLabel,
/// Sets the line height to 1
UILabel,
}
pub trait LabelCommon {
fn size(self, size: LabelSize) -> Self;
fn line_height_style(self, line_height_style: LineHeightStyle) -> Self;
fn color(self, color: Color) -> Self;
fn strikethrough(self, strikethrough: bool) -> Self;
}
#[derive(IntoElement)]
pub struct LabelLike {
size: LabelSize,
line_height_style: LineHeightStyle,
pub(crate) color: Color,
strikethrough: bool,
children: SmallVec<[AnyElement; 2]>,
}
impl LabelLike {
pub fn new() -> Self {
Self {
size: LabelSize::Default,
line_height_style: LineHeightStyle::default(),
color: Color::Default,
strikethrough: false,
children: SmallVec::new(),
}
}
}
impl LabelCommon for LabelLike {
fn size(mut self, size: LabelSize) -> Self {
self.size = size;
self
}
fn line_height_style(mut self, line_height_style: LineHeightStyle) -> Self {
self.line_height_style = line_height_style;
self
}
fn color(mut self, color: Color) -> Self {
self.color = color;
self
}
fn strikethrough(mut self, strikethrough: bool) -> Self {
self.strikethrough = strikethrough;
self
}
}
impl ParentElement for LabelLike {
fn children_mut(&mut self) -> &mut SmallVec<[AnyElement; 2]> {
&mut self.children
}
}
impl RenderOnce for LabelLike {
type Rendered = Div;
fn render(self, cx: &mut WindowContext) -> Self::Rendered {
div()
.when(self.strikethrough, |this| {
this.relative().child(
div()
.absolute()
.top_1_2()
.w_full()
.h_px()
.bg(Color::Hidden.color(cx)),
)
})
.map(|this| match self.size {
LabelSize::Default => this.text_ui(),
LabelSize::Small => this.text_ui_sm(),
})
.when(self.line_height_style == LineHeightStyle::UILabel, |this| {
this.line_height(relative(1.))
})
.text_color(self.color.color(cx))
.children(self.children)
}
}

View file

@ -51,5 +51,13 @@ impl Render for IconButtonStory {
.tooltip(|cx| Tooltip::text("Open messages", cx)), .tooltip(|cx| Tooltip::text("Open messages", cx)),
), ),
) )
.child(Story::label("Selected with `tooltip`"))
.child(
div().w_8().child(
IconButton::new("selected_with_tooltip", Icon::InlayHint)
.selected(true)
.tooltip(|cx| Tooltip::text("Toggle inlay hints", cx)),
),
)
} }
} }

View file

@ -23,5 +23,9 @@ impl Render for LabelStory {
"Héllo, world!", "Héllo, world!",
vec![0, 1, 3, 8, 9, 13], vec![0, 1, 3, 8, 9, 13],
)) ))
.child(Story::label("Highlighted with `color`"))
.child(
HighlightedLabel::new("Hello, world!", vec![0, 1, 2, 7, 8, 12]).color(Color::Error),
)
} }
} }

View file

@ -84,6 +84,7 @@ impl Render for Tooltip {
.px_2() .px_2()
.child( .child(
h_stack() h_stack()
.gap_2()
.child(self.title.clone()) .child(self.title.clone())
.when_some(self.key_binding.clone(), |this, key_binding| { .when_some(self.key_binding.clone(), |this, key_binding| {
this.justify_between().child(key_binding) this.justify_between().child(key_binding)

View file

@ -9,5 +9,5 @@ pub use crate::disableable::*;
pub use crate::fixed::*; pub use crate::fixed::*;
pub use crate::selectable::*; pub use crate::selectable::*;
pub use crate::{h_stack, v_stack}; pub use crate::{h_stack, v_stack};
pub use crate::{ButtonCommon, Color, StyledExt}; pub use crate::{ButtonCommon, Color, LabelCommon, StyledExt};
pub use theme::ActiveTheme; pub use theme::ActiveTheme;

View file

@ -70,8 +70,7 @@ pub trait StyledExt: Styled + Sized {
/// or other places that text needs to match the user's buffer font size. /// or other places that text needs to match the user's buffer font size.
fn text_buffer(self, cx: &mut WindowContext) -> Self { fn text_buffer(self, cx: &mut WindowContext) -> Self {
let settings = ThemeSettings::get_global(cx); let settings = ThemeSettings::get_global(cx);
self.text_size(settings.buffer_font_size(cx))
self.text_size(settings.buffer_font_size)
} }
/// The [`Surface`](ui2::ElevationIndex::Surface) elevation level, located above the app background, is the standard level for all elements /// The [`Surface`](ui2::ElevationIndex::Surface) elevation level, located above the app background, is the standard level for all elements

View file

@ -44,12 +44,18 @@ impl<'a, T: ?Sized> From<&'a T> for ArcCow<'a, T> {
} }
} }
impl<T> From<Arc<T>> for ArcCow<'_, T> { impl<T: ?Sized> From<Arc<T>> for ArcCow<'_, T> {
fn from(s: Arc<T>) -> Self { fn from(s: Arc<T>) -> Self {
Self::Owned(s) Self::Owned(s)
} }
} }
impl<T: ?Sized> From<&'_ Arc<T>> for ArcCow<'_, T> {
fn from(s: &'_ Arc<T>) -> Self {
Self::Owned(s.clone())
}
}
impl From<String> for ArcCow<'_, str> { impl From<String> for ArcCow<'_, str> {
fn from(value: String) -> Self { fn from(value: String) -> Self {
Self::Owned(value.into()) Self::Owned(value.into())

Some files were not shown because too many files have changed in this diff Show more